fix: cache icons in settings

The logic is inverted everywhere, e.g. when `hideGroupReactions` is true, it's actually meant to show, not hide

Telegram/CMakeLists.txt

@@ -1339,6 +1339,8 @@ PRIVATE
     media/view/media_view_playback_controls.h
     media/view/media_view_playback_progress.cpp
     media/view/media_view_playback_progress.h
+    media/view/media_view_playback_sponsored.cpp
+    media/view/media_view_playback_sponsored.h
     media/system_media_controls_manager.h
     media/system_media_controls_manager.cpp
     menu/menu_antispam_validator.cpp
@@ -2071,7 +2073,7 @@ if (MSVC)
             /DELAYLOAD:API-MS-Win-Core-ProcessThreads-l1-1-0.dll
             /DELAYLOAD:API-MS-Win-Core-Synch-l1-2-0.dll # Synchronization.lib
             /DELAYLOAD:API-MS-Win-Core-SysInfo-l1-1-0.dll
-            /DELAYLOAD:API-MS-Win-Core-Timezone-l1-1-0.dll
+            # /DELAYLOAD:API-MS-Win-Core-Timezone-l1-1-0.dll
             /DELAYLOAD:API-MS-Win-Core-WinRT-l1-1-0.dll
             /DELAYLOAD:API-MS-Win-Core-WinRT-Error-l1-1-0.dll
             /DELAYLOAD:API-MS-Win-Core-WinRT-String-l1-1-0.dll

Telegram/Resources/icons/tray_monochrome.svg

@@ -1,10 +1,10 @@
-<svg width="17" height="17" viewBox="0 0 17 17" fill="none" xmlns="http://www.w3.org/2000/svg">
-<g clip-path="url(#clip0_1067_20)">
-<path d="M7.58588 9.73341C8.52939 10.6769 9.41338 12.269 10.085 13.6905C10.5357 14.6445 12.0164 14.6078 12.3503 13.6068L15.8086 3.23922C16.1618 2.1804 15.1541 1.17304 14.0954 1.52654L3.74092 4.98387C2.73902 5.3184 2.70382 6.80252 3.65913 7.2532C5.0706 7.91907 6.64716 8.79469 7.58588 9.73341Z" fill="white"/>
+<svg width="16" height="16" viewBox="0 0 16 16" fill="none" xmlns="http://www.w3.org/2000/svg">
+<g clip-path="url(#clip0_1362_52)">
+<path d="M6.92088 9.06526C7.86439 10.0088 8.74838 11.6009 9.41997 13.0223C9.87073 13.9764 11.3514 13.9397 11.6853 12.9387L15.1436 2.57106C15.4968 1.51225 14.4891 0.504885 13.4304 0.858384L3.07592 4.31571C2.07402 4.65025 2.03882 6.13437 2.99412 6.58505C4.4056 7.25092 5.98216 8.12654 6.92088 9.06526Z" fill="white"/>
 </g>
 <defs>
-<clipPath id="clip0_1067_20">
-<rect width="16" height="16.0037" fill="white" transform="translate(0.665001 0.668152)"/>
+<clipPath id="clip0_1362_52">
+<rect width="16" height="16.0037" fill="white"/>
 </clipPath>
 </defs>
 </svg>

Telegram/Resources/langs/lang.strings

@@ -434,6 +434,9 @@ https://github.com/telegramdesktop/tdesktop/blob/master/LEGAL
 "lng_dlg_new_channel_name" = "Channel name";
 "lng_dlg_new_bot_name" = "Bot name";
 "lng_no_chats" = "Your chats will be here";
+"lng_no_conversations" = "You have no\nconversations yet.";
+"lng_no_conversations_button" = "New Message";
+"lng_no_conversations_subtitle" = "Your contacts on Telegram";
 "lng_no_chats_filter" = "No chats currently belong to this folder.";
 "lng_no_saved_sublists" = "You can save messages from other chats here.";
 "lng_contacts_loading" = "Loading...";
@@ -4260,6 +4263,7 @@ https://github.com/telegramdesktop/tdesktop/blob/master/LEGAL
 "lng_context_to_msg" = "Go To Message";
 "lng_context_reply_msg" = "Reply";
 "lng_context_quote_and_reply" = "Quote & Reply";
+"lng_context_reply_to_task" = "Reply to Task";
 "lng_context_edit_msg" = "Edit";
 "lng_context_add_factcheck" = "Add Fact Check";
 "lng_context_edit_factcheck" = "Edit Fact Check";
@@ -4450,6 +4454,7 @@ https://github.com/telegramdesktop/tdesktop/blob/master/LEGAL
 "lng_inline_switch_cant" = "Sorry, no way to write here :(";
 "lng_preview_reply_to" = "Reply to {name}";
 "lng_preview_reply_to_quote" = "Reply to quote from {name}";
+"lng_preview_reply_to_task" = "Reply to task from {title}";
 
 "lng_suggest_bar_title" = "Suggest a Post Below";
 "lng_suggest_bar_text" = "Click to offer a price for publishing.";

Telegram/Resources/qrc/telegram/animations.qrc

@@ -38,6 +38,7 @@
     <file alias="topics_tabs.tgs">../../animations/edit_peers/topics_tabs.tgs</file>
     <file alias="topics_list.tgs">../../animations/edit_peers/topics_list.tgs</file>
     <file alias="direct_messages.tgs">../../animations/edit_peers/direct_messages.tgs</file>
+    <file alias="no_chats.tgs">../../animations/no_chats.tgs</file>
 
     <file alias="dice_idle.tgs">../../animations/dice/dice_idle.tgs</file>
     <file alias="dart_idle.tgs">../../animations/dice/dart_idle.tgs</file>

Telegram/Resources/uwp/AppX/AppxManifest.xml

@@ -10,7 +10,7 @@
   <Identity Name="TelegramMessengerLLP.TelegramDesktop"
     ProcessorArchitecture="ARCHITECTURE"
     Publisher="CN=536BC709-8EE1-4478-AF22-F0F0F26FF64A"
-    Version="5.16.3.0" />
+    Version="5.16.4.0" />
   <Properties>
     <DisplayName>Telegram Desktop</DisplayName>
     <PublisherDisplayName>Telegram Messenger LLP</PublisherDisplayName>

Telegram/Resources/winrc/Telegram.rc

@@ -44,8 +44,8 @@ IDI_ICON1               ICON                    "..\\art\\icon256.ico"
 //
 
 VS_VERSION_INFO VERSIONINFO
- FILEVERSION 5,16,3,0
- PRODUCTVERSION 5,16,3,0
+ FILEVERSION 5,16,4,0
+ PRODUCTVERSION 5,16,4,0
  FILEFLAGSMASK 0x3fL
 #ifdef _DEBUG
  FILEFLAGS 0x1L
@@ -62,10 +62,10 @@ BEGIN
         BEGIN
             VALUE "CompanyName", "Radolyn Labs"
             VALUE "FileDescription", "AyuGram Desktop"
-            VALUE "FileVersion", "5.16.3.0"
+            VALUE "FileVersion", "5.16.4.0"
             VALUE "LegalCopyright", "Copyright (C) 2014-2025"
             VALUE "ProductName", "AyuGram Desktop"
-            VALUE "ProductVersion", "5.16.3.0"
+            VALUE "ProductVersion", "5.16.4.0"
         END
     END
     BLOCK "VarFileInfo"

Telegram/Resources/winrc/Updater.rc

@@ -35,8 +35,8 @@ LANGUAGE LANG_ENGLISH, SUBLANG_ENGLISH_US
 //
 
 VS_VERSION_INFO VERSIONINFO
- FILEVERSION 5,16,3,0
- PRODUCTVERSION 5,16,3,0
+ FILEVERSION 5,16,4,0
+ PRODUCTVERSION 5,16,4,0
  FILEFLAGSMASK 0x3fL
 #ifdef _DEBUG
  FILEFLAGS 0x1L
@@ -53,10 +53,10 @@ BEGIN
         BEGIN
             VALUE "CompanyName", "Radolyn Labs"
             VALUE "FileDescription", "AyuGram Desktop Updater"
-            VALUE "FileVersion", "5.16.3.0"
+            VALUE "FileVersion", "5.16.4.0"
             VALUE "LegalCopyright", "Copyright (C) 2014-2025"
             VALUE "ProductName", "AyuGram Desktop"
-            VALUE "ProductVersion", "5.16.3.0"
+            VALUE "ProductVersion", "5.16.4.0"
         END
     END
     BLOCK "VarFileInfo"

Telegram/SourceFiles/api/api_unread_things.cpp

@@ -47,10 +47,10 @@ bool UnreadThings::trackReactions(Data::Thread *thread) const {
 		return false;
 	}
 	const auto &settings = AyuSettings::getInstance();
-	if (peer->isChannel() && !peer->isMegagroup() && !settings.hideChannelReactions) {
+	if (peer->isChannel() && !peer->isMegagroup() && !settings.showChannelReactions) {
 		return false;
 	}
-	if (peer->isMegagroup() && !settings.hideGroupReactions) {
+	if (peer->isMegagroup() && !settings.showGroupReactions) {
 		return false;
 	}
 	return peer->isUser() || peer->isChat() || peer->isMegagroup();

Telegram/SourceFiles/api/api_views.cpp

@@ -15,6 +15,10 @@ https://github.com/telegramdesktop/tdesktop/blob/master/LEGAL
 #include "history/history_item.h"
 #include "main/main_session.h"
 
+// AyuGram includes
+#include "ayu/ayu_settings.h"
+
+
 namespace Api {
 namespace {
 
@@ -83,6 +87,8 @@ void ViewsManager::pollExtendedMedia(
 }
 
 void ViewsManager::viewsIncrement() {
+	const auto &settings = AyuSettings::getInstance();
+
 	for (auto i = _toIncrement.begin(); i != _toIncrement.cend();) {
 		if (_incrementRequests.contains(i->first)) {
 			++i;
@@ -97,7 +103,7 @@ void ViewsManager::viewsIncrement() {
 		const auto requestId = _api.request(MTPmessages_GetMessagesViews(
 			i->first->input,
 			MTP_vector<MTPint>(ids),
-			MTP_bool(true)
+			MTP_bool(settings.sendReadMessages)
 		)).done([=](
 				const MTPmessages_MessageViews &result,
 				mtpRequestId requestId) {

Telegram/SourceFiles/ayu/ayu_settings.cpp

@@ -231,8 +231,8 @@ AyuGramSettings::AyuGramSettings() {
 
 	disableNotificationsDelay = false;
 	localPremium = false;
-	hideChannelReactions = true;
-	hideGroupReactions = true;
+	showChannelReactions = true;
+	showGroupReactions = true;
 
 	// ~ Customization
 	appIcon =
@@ -420,11 +420,11 @@ void set_localPremium(bool val) {
 }
 
 void set_hideChannelReactions(bool val) {
-	settings->hideChannelReactions = val;
+	settings->showChannelReactions = val;
 }
 
 void set_hideGroupReactions(bool val) {
-	settings->hideGroupReactions = val;
+	settings->showGroupReactions = val;
 }
 
 void set_appIcon(const QString &val) {

Telegram/SourceFiles/ayu/ayu_settings.h

@@ -76,8 +76,8 @@ public:
 
 	bool disableNotificationsDelay;
 	bool localPremium;
-	bool hideChannelReactions;
-	bool hideGroupReactions;
+	bool showChannelReactions;
+	bool showGroupReactions;
 
 	QString appIcon;
 	bool simpleQuotesAndReplies;
@@ -259,8 +259,8 @@ inline void to_json(nlohmann::json &nlohmann_json_j, const AyuGramSettings &nloh
 	NLOHMANN_JSON_TO(showGhostToggleInTray)
 	NLOHMANN_JSON_TO(showStreamerToggleInTray)
 	NLOHMANN_JSON_TO(monoFont)
-	NLOHMANN_JSON_TO(hideChannelReactions)
-	NLOHMANN_JSON_TO(hideGroupReactions)
+	NLOHMANN_JSON_TO(showChannelReactions)
+	NLOHMANN_JSON_TO(showGroupReactions)
 	NLOHMANN_JSON_TO(hideNotificationCounters)
 	NLOHMANN_JSON_TO(hideNotificationBadge)
 	NLOHMANN_JSON_TO(hideAllChatsFolder)
@@ -324,8 +324,8 @@ inline void from_json(const nlohmann::json &nlohmann_json_j, AyuGramSettings &nl
 	NLOHMANN_JSON_FROM_WITH_DEFAULT(showGhostToggleInTray)
 	NLOHMANN_JSON_FROM_WITH_DEFAULT(showStreamerToggleInTray)
 	NLOHMANN_JSON_FROM_WITH_DEFAULT(monoFont)
-	NLOHMANN_JSON_FROM_WITH_DEFAULT(hideChannelReactions)
-	NLOHMANN_JSON_FROM_WITH_DEFAULT(hideGroupReactions)
+	NLOHMANN_JSON_FROM_WITH_DEFAULT(showChannelReactions)
+	NLOHMANN_JSON_FROM_WITH_DEFAULT(showGroupReactions)
 	NLOHMANN_JSON_FROM_WITH_DEFAULT(hideNotificationCounters)
 	NLOHMANN_JSON_FROM_WITH_DEFAULT(hideNotificationBadge)
 	NLOHMANN_JSON_FROM_WITH_DEFAULT(hideAllChatsFolder)

Telegram/SourceFiles/ayu/features/forward/ayu_forward.cpp

@@ -99,8 +99,11 @@ std::pair<QString, QString> stateName(const PeerId &id) {
 
 void ForwardState::updateBottomBar(const Main::Session &session, const PeerId *peer, const State &st) {
 	state = st;
-
-	session.changes().peerUpdated(session.data().peer(*peer), Data::PeerUpdate::Flag::Rights);
+	auto peerCopy = *peer;
+	crl::on_main([&, peerCopy]
+	{
+		session.changes().peerUpdated(session.data().peer(peerCopy), Data::PeerUpdate::Flag::Rights);
+	});
 }
 
 static Ui::PreparedList prepareMedia(not_null<Main::Session*> session,
@@ -111,6 +114,10 @@ static Ui::PreparedList prepareMedia(not_null<Main::Session*> session,
 	{
 		groupMedia.emplace_back(media);
 		auto prepared = Ui::PreparedFile(AyuSync::filePath(session, media));
+		if (prepared.path.isEmpty()) {
+			// otherwise will fail assertion in PrepareDetails
+			return prepared;
+		}
 		Storage::PrepareDetails(prepared, st::sendMediaPreviewSize, PhotoSideLimit());
 		return prepared;
 	};
@@ -120,7 +127,9 @@ static Ui::PreparedList prepareMedia(not_null<Main::Session*> session,
 	const auto groupId = startItem->groupId();
 
 	Ui::PreparedList list;
-	list.files.emplace_back(prepare(media));
+	if (auto prepared = prepare(media); !prepared.path.isEmpty()) {
+		list.files.emplace_back(std::move(prepared));
+	}
 
 	if (!groupId.value) {
 		return list;
@@ -132,7 +141,9 @@ static Ui::PreparedList prepareMedia(not_null<Main::Session*> session,
 			break;
 		}
 		if (const auto nextMedia = nextItem->media()) {
-			list.files.emplace_back(prepare(nextMedia));
+			if (auto prepared = prepare(nextMedia); !prepared.path.isEmpty()) {
+				list.files.emplace_back(std::move(prepared));
+			}
 			i = k;
 		}
 	}
@@ -202,12 +213,11 @@ void sendMedia(
 }
 
 bool isAyuForwardNeeded(const std::vector<not_null<HistoryItem*>> &items) {
-	for (const auto &item : items) {
-		if (isAyuForwardNeeded(item)) {
-			return true;
-		}
-	}
-	return false;
+	const auto needAyuForward = [&](const auto &item)
+	{
+		return isAyuForwardNeeded(item);
+	};
+	return std::ranges::any_of(items, needAyuForward);
 }
 
 bool isAyuForwardNeeded(not_null<HistoryItem*> item) {
@@ -232,7 +242,10 @@ void intelligentForward(
 	const Api::SendAction &action,
 	const Data::ResolvedForwardDraft &draft) {
 	const auto history = action.history;
-	history->setForwardDraft(action.replyTo.topicRootId, action.replyTo.monoforumPeerId, {});
+	crl::on_main([&]
+	{
+		history->setForwardDraft(action.replyTo.topicRootId, action.replyTo.monoforumPeerId, {});
+	});
 
 	const auto items = draft.items;
 	const auto peer = history->peer;
@@ -291,12 +304,15 @@ void forwardMessages(
 	not_null<Main::Session*> session,
 	const Api::SendAction &action,
 	bool forwardState,
-	Data::ResolvedForwardDraft draft) {
+	const Data::ResolvedForwardDraft &draft) {
 	const auto items = draft.items;
 	const auto history = action.history;
 	const auto peer = history->peer;
 
-	history->setForwardDraft(action.replyTo.topicRootId, action.replyTo.monoforumPeerId, {});
+	crl::on_main([&]
+	{
+		history->setForwardDraft(action.replyTo.topicRootId, action.replyTo.monoforumPeerId, {});
+	});
 
 	std::shared_ptr<ForwardState> state;
 
@@ -378,6 +394,23 @@ void forwardMessages(
 				}
 			}
 
+			// remove not finished files
+			for (int j = preparedMedia.files.size() - 1; j >= 0; j--) {
+				auto &file = preparedMedia.files[j];
+
+				QFile f(file.path);
+				if (groupMedia[j]->photo() && f.size() < groupMedia[j]->photo()->imageByteSize(Data::PhotoSize::Large)
+					||
+					groupMedia[j]->document() && f.size() < groupMedia[j]->document()->size
+				) {
+					preparedMedia.files.erase(preparedMedia.files.begin() + j);
+				}
+			}
+
+			if (preparedMedia.files.empty()) {
+				continue;
+			}
+
 			auto groups = Ui::DivideByGroups(
 				std::move(preparedMedia),
 				way,

Telegram/SourceFiles/ayu/features/forward/ayu_forward.h

@@ -47,6 +47,6 @@ void forwardMessages(
 	not_null<Main::Session*> session,
 	const Api::SendAction &action,
 	bool forwardState,
-	Data::ResolvedForwardDraft draft);
+	const Data::ResolvedForwardDraft &draft);
 
 }

Telegram/SourceFiles/ayu/features/forward/ayu_sync.cpp

@@ -5,8 +5,9 @@
 //
 // Copyright @Radolyn, 2025
 #include "ayu_sync.h"
-#include "apiwrap.h"
 #include "api/api_sending.h"
+#include "apiwrap.h"
+#include "ayu/utils/telegram_helpers.h"
 #include "core/application.h"
 #include "core/core_settings.h"
 #include "core/file_utilities.h"
@@ -54,7 +55,7 @@ private:
 namespace AyuSync {
 
 QString pathForSave(not_null<Main::Session*> session) {
-	const auto path = Core::App().settings().downloadPath();
+	auto path = Core::App().settings().downloadPath();
 	if (path.isEmpty()) {
 		return File::DefaultDownloadPath(session);
 	}
@@ -65,6 +66,10 @@ QString pathForSave(not_null<Main::Session*> session) {
 }
 
 QString filePath(not_null<Main::Session*> session, const Data::Media *media) {
+	if (!media) {
+		return {};
+	}
+
 	if (const auto document = media->document()) {
 		if (!document->filename().isEmpty()) {
 			return pathForSave(session) + media->document()->filename();
@@ -84,7 +89,7 @@ QString filePath(not_null<Main::Session*> session, const Data::Media *media) {
 		return pathForSave(session) + QString::number(photo->getDC()) + "_" + QString::number(photo->id) + ".jpg";
 	}
 
-	return QString();
+	return {};
 }
 
 qint64 fileSize(not_null<HistoryItem*> item) {
@@ -127,21 +132,42 @@ void loadDocumentSync(not_null<Main::Session*> session, DocumentData *data, not_
 	auto latch = std::make_shared<TimedCountDownLatch>(1);
 	auto lifetime = std::make_shared<rpl::lifetime>();
 
-	data->save(Data::FileOriginMessage(item->fullId()), filePath(session, item->media()));
-
-	rpl::single() | rpl::then(
-		session->downloaderTaskFinished()
-	) | rpl::filter([&]
+	auto path = filePath(session, item->media());
+	if (path.isEmpty()) {
+		return;
+	}
+	crl::on_main([&]
 	{
-		return data->status == FileDownloadFailed || fileSize(item) == data->size;
-	}) | rpl::start_with_next([&]() mutable
-							  {
-								  latch->countDown();
-								  base::take(lifetime)->destroy();
-							  },
-							  *lifetime);
+		data->save(Data::FileOriginMessage(item->fullId()), path);
 
-	latch->await(std::chrono::minutes(5));
+		rpl::single() | rpl::then(
+			session->downloaderTaskFinished()
+		) | rpl::filter([&]
+		{
+			return data->status == FileDownloadFailed || fileSize(item) == data->size;
+		}) | rpl::start_with_next([&]() mutable
+								  {
+									  latch->countDown();
+								  },
+								  *lifetime);
+	});
+
+
+	constexpr auto overall = std::chrono::minutes(15);
+	const auto startTime = std::chrono::steady_clock::now();
+
+
+	while (std::chrono::steady_clock::now() - startTime < overall) {
+		if (latch->await(std::chrono::minutes(5))) {
+			break;
+		}
+
+		if (!data->loading()) {
+			break;
+		}
+	}
+
+	base::take(lifetime)->destroy();
 }
 
 void forwardMessagesSync(not_null<Main::Session*> session,
@@ -207,19 +233,21 @@ void loadPhotoSync(not_null<Main::Session*> session, const std::pair<not_null<Ph
 	if (finalCheck()) {
 		saveToFiles();
 	} else {
-		session->downloaderTaskFinished() | rpl::filter([&]
+		crl::on_main([&]
 		{
-			return finalCheck();
-		}) | rpl::start_with_next([&]() mutable
-								  {
-									  saveToFiles();
-									  latch->countDown();
-									  base::take(lifetime)->destroy();
-								  },
-								  *lifetime);
+			session->downloaderTaskFinished() | rpl::filter([&]
+			{
+				return finalCheck();
+			}) | rpl::start_with_next([&]() mutable
+									  {
+										  saveToFiles();
+										  latch->countDown();
+									  },
+									  *lifetime);
+		});
+		latch->await(std::chrono::minutes(5));
+		base::take(lifetime)->destroy();
 	}
-
-	latch->await(std::chrono::minutes(5));
 }
 
 void sendMessageSync(not_null<Main::Session*> session, Api::MessageToSend &message) {
@@ -240,19 +268,21 @@ void waitForMsgSync(not_null<Main::Session*> session, const Api::SendAction &act
 	auto latch = std::make_shared<TimedCountDownLatch>(1);
 	auto lifetime = std::make_shared<rpl::lifetime>();
 
+	crl::on_main([&]
+	{
+		session->data().itemIdChanged()
+			| rpl::filter([&](const Data::Session::IdChange &update)
+			{
+				return action.history->peer->id == update.newId.peer;
+			}) | rpl::start_with_next([&]
+									  {
+										  latch->countDown();
+									  },
+									  *lifetime);
+	});
 
-	session->data().itemIdChanged()
-		| rpl::filter([&](const Data::Session::IdChange &update)
-		{
-			return action.history->peer->id == update.newId.peer;
-		}) | rpl::start_with_next([&]
-								  {
-									  latch->countDown();
-									  base::take(lifetime)->destroy();
-								  },
-								  *lifetime);
-
-	latch->await(std::chrono::minutes(2));
+	latch->await(std::chrono::minutes(5));
+	base::take(lifetime)->destroy();
 }
 
 void sendDocumentSync(not_null<Main::Session*> session,
@@ -260,9 +290,6 @@ void sendDocumentSync(not_null<Main::Session*> session,
 					  SendMediaType type,
 					  TextWithTags &&caption,
 					  const Api::SendAction &action) {
-	const auto size = group.list.files.size();
-	auto latch = std::make_shared<TimedCountDownLatch>(size);
-	auto lifetime = std::make_shared<rpl::lifetime>();
 
 	auto groupId = std::make_shared<SendingAlbum>();
 	groupId->groupId = base::RandomValue<uint64>();
@@ -272,27 +299,7 @@ void sendDocumentSync(not_null<Main::Session*> session,
 		session->api().sendFiles(std::move(lst), type, std::move(caption), groupId, action);
 	});
 
-
-	// probably need to handle
-	// session->uploader().photoFailed()
-	// and
-	// session->uploader().documentFailed()
-	// too
-
-	rpl::merge(
-		session->uploader().documentReady(),
-		session->uploader().photoReady()
-	) | rpl::filter([&](const Storage::UploadedMedia &docOrPhoto)
-	{
-		return docOrPhoto.fullId.peer == action.history->peer->id;
-	}) | rpl::start_with_next([&]
-							  {
-								  latch->countDown();
-							  },
-							  *lifetime);
-
-	latch->await(std::chrono::minutes(5 * size));
-	base::take(lifetime)->destroy();
+	waitForMsgSync(session, action);
 }
 
 void sendStickerSync(not_null<Main::Session*> session,

Telegram/SourceFiles/ayu/features/messageshot/message_shot.cpp

@@ -209,8 +209,7 @@ bool MessageShotDelegate::elementHideReply(not_null<const HistoryView::Element*>
 
 HistoryView::ElementChatMode MessageShotDelegate::elementChatMode() {
 	using Mode = HistoryView::ElementChatMode;
-	// Mode::Wide;
-	return Mode::Default;
+	return Mode::Wide;
 }
 
 QImage removeEmptySpaceAround(const QImage &original) {

Telegram/SourceFiles/ayu/libs/sqlite/sqlite3.c

@@ -1,6 +1,6 @@
 /******************************************************************************
 ** This file is an amalgamation of many separate C source files from SQLite
-** version 3.50.0.  By combining all the individual C code files into this
+** version 3.50.2.  By combining all the individual C code files into this
 ** single large file, the entire code can be compiled as a single translation
 ** unit.  This allows many compilers to do optimizations that would not be
 ** possible if the files were compiled separately.  Performance improvements
@@ -18,7 +18,7 @@
 ** separate file. This file contains only code for the core SQLite library.
 **
 ** The content in this amalgamation comes from Fossil check-in
-** dfc790f998f450d9c35e3ba1c8c89c17466c with changes in files:
+** 2af157d77fb1304a74176eaee7fbc7c7e932 with changes in files:
 **
 **    
 */
@@ -465,9 +465,9 @@ extern "C" {
 ** [sqlite3_libversion_number()], [sqlite3_sourceid()],
 ** [sqlite_version()] and [sqlite_source_id()].
 */
-#define SQLITE_VERSION        "3.50.0"
-#define SQLITE_VERSION_NUMBER 3050000
-#define SQLITE_SOURCE_ID      "2025-05-29 14:26:00 dfc790f998f450d9c35e3ba1c8c89c17466cb559f87b0239e4aab9d34e28f742"
+#define SQLITE_VERSION        "3.50.2"
+#define SQLITE_VERSION_NUMBER 3050002
+#define SQLITE_SOURCE_ID      "2025-06-28 14:00:48 2af157d77fb1304a74176eaee7fbc7c7e932d946bf25325e9c26c91db19e3079"
 
 /*
 ** CAPI3REF: Run-Time Library Version Numbers
@@ -4398,7 +4398,7 @@ SQLITE_API sqlite3_file *sqlite3_database_file_object(const char*);
 **
 ** The sqlite3_create_filename(D,J,W,N,P) allocates memory to hold a version of
 ** database filename D with corresponding journal file J and WAL file W and
-** with N URI parameters key/values pairs in the array P.  The result from
+** an array P of N URI Key/Value pairs.  The result from
 ** sqlite3_create_filename(D,J,W,N,P) is a pointer to a database filename that
 ** is safe to pass to routines like:
 ** <ul>
@@ -5079,7 +5079,7 @@ typedef struct sqlite3_context sqlite3_context;
 ** METHOD: sqlite3_stmt
 **
 ** ^(In the SQL statement text input to [sqlite3_prepare_v2()] and its variants,
-** literals may be replaced by a [parameter] that matches one of following
+** literals may be replaced by a [parameter] that matches one of the following
 ** templates:
 **
 ** <ul>
@@ -5124,7 +5124,7 @@ typedef struct sqlite3_context sqlite3_context;
 **
 ** [[byte-order determination rules]] ^The byte-order of
 ** UTF16 input text is determined by the byte-order mark (BOM, U+FEFF)
-** found in first character, which is removed, or in the absence of a BOM
+** found in the first character, which is removed, or in the absence of a BOM
 ** the byte order is the native byte order of the host
 ** machine for sqlite3_bind_text16() or the byte order specified in
 ** the 6th parameter for sqlite3_bind_text64().)^
@@ -5144,7 +5144,7 @@ typedef struct sqlite3_context sqlite3_context;
 ** or sqlite3_bind_text16() or sqlite3_bind_text64() then
 ** that parameter must be the byte offset
 ** where the NUL terminator would occur assuming the string were NUL
-** terminated.  If any NUL characters occurs at byte offsets less than
+** terminated.  If any NUL characters occur at byte offsets less than
 ** the value of the fourth parameter then the resulting string value will
 ** contain embedded NULs.  The result of expressions involving strings
 ** with embedded NULs is undefined.
@@ -5356,7 +5356,7 @@ SQLITE_API const void *sqlite3_column_name16(sqlite3_stmt*, int N);
 ** METHOD: sqlite3_stmt
 **
 ** ^These routines provide a means to determine the database, table, and
-** table column that is the origin of a particular result column in
+** table column that is the origin of a particular result column in a
 ** [SELECT] statement.
 ** ^The name of the database or table or column can be returned as
 ** either a UTF-8 or UTF-16 string.  ^The _database_ routines return
@@ -5925,8 +5925,8 @@ SQLITE_API int sqlite3_reset(sqlite3_stmt *pStmt);
 **
 ** For best security, the [SQLITE_DIRECTONLY] flag is recommended for
 ** all application-defined SQL functions that do not need to be
-** used inside of triggers, view, CHECK constraints, or other elements of
-** the database schema.  This flags is especially recommended for SQL
+** used inside of triggers, views, CHECK constraints, or other elements of
+** the database schema.  This flag is especially recommended for SQL
 ** functions that have side effects or reveal internal application state.
 ** Without this flag, an attacker might be able to modify the schema of
 ** a database file to include invocations of the function with parameters
@@ -5957,7 +5957,7 @@ SQLITE_API int sqlite3_reset(sqlite3_stmt *pStmt);
 ** [user-defined window functions|available here].
 **
 ** ^(If the final parameter to sqlite3_create_function_v2() or
-** sqlite3_create_window_function() is not NULL, then it is destructor for
+** sqlite3_create_window_function() is not NULL, then it is the destructor for
 ** the application data pointer. The destructor is invoked when the function
 ** is deleted, either by being overloaded or when the database connection
 ** closes.)^ ^The destructor is also invoked if the call to
@@ -6357,7 +6357,7 @@ SQLITE_API unsigned int sqlite3_value_subtype(sqlite3_value*);
 ** METHOD: sqlite3_value
 **
 ** ^The sqlite3_value_dup(V) interface makes a copy of the [sqlite3_value]
-** object D and returns a pointer to that copy.  ^The [sqlite3_value] returned
+** object V and returns a pointer to that copy.  ^The [sqlite3_value] returned
 ** is a [protected sqlite3_value] object even if the input is not.
 ** ^The sqlite3_value_dup(V) interface returns NULL if V is NULL or if a
 ** memory allocation fails. ^If V is a [pointer value], then the result
@@ -6395,7 +6395,7 @@ SQLITE_API void sqlite3_value_free(sqlite3_value*);
 ** allocation error occurs.
 **
 ** ^(The amount of space allocated by sqlite3_aggregate_context(C,N) is
-** determined by the N parameter on first successful call.  Changing the
+** determined by the N parameter on the first successful call.  Changing the
 ** value of N in any subsequent call to sqlite3_aggregate_context() within
 ** the same aggregate function instance will not resize the memory
 ** allocation.)^  Within the xFinal callback, it is customary to set
@@ -6557,7 +6557,7 @@ SQLITE_API void sqlite3_set_auxdata(sqlite3_context*, int N, void*, void (*)(voi
 **
 ** Security Warning:  These interfaces should not be exposed in scripting
 ** languages or in other circumstances where it might be possible for an
-** an attacker to invoke them.  Any agent that can invoke these interfaces
+** attacker to invoke them.  Any agent that can invoke these interfaces
 ** can probably also take control of the process.
 **
 ** Database connection client data is only available for SQLite
@@ -6671,7 +6671,7 @@ typedef void (*sqlite3_destructor_type)(void*);
 ** pointed to by the 2nd parameter are taken as the application-defined
 ** function result.  If the 3rd parameter is non-negative, then it
 ** must be the byte offset into the string where the NUL terminator would
-** appear if the string where NUL terminated.  If any NUL characters occur
+** appear if the string were NUL terminated.  If any NUL characters occur
 ** in the string at a byte offset that is less than the value of the 3rd
 ** parameter, then the resulting string will contain embedded NULs and the
 ** result of expressions operating on strings with embedded NULs is undefined.
@@ -6729,7 +6729,7 @@ typedef void (*sqlite3_destructor_type)(void*);
 ** string and preferably a string literal. The sqlite3_result_pointer()
 ** routine is part of the [pointer passing interface] added for SQLite 3.20.0.
 **
-** If these routines are called from within the different thread
+** If these routines are called from within a different thread
 ** than the one containing the application-defined function that received
 ** the [sqlite3_context] pointer, the results are undefined.
 */
@@ -7135,7 +7135,7 @@ SQLITE_API sqlite3 *sqlite3_db_handle(sqlite3_stmt*);
 ** METHOD: sqlite3
 **
 ** ^The sqlite3_db_name(D,N) interface returns a pointer to the schema name
-** for the N-th database on database connection D, or a NULL pointer of N is
+** for the N-th database on database connection D, or a NULL pointer if N is
 ** out of range.  An N value of 0 means the main database file.  An N of 1 is
 ** the "temp" schema.  Larger values of N correspond to various ATTACH-ed
 ** databases.
@@ -7230,7 +7230,7 @@ SQLITE_API int sqlite3_txn_state(sqlite3*,const char *zSchema);
 ** <dd>The SQLITE_TXN_READ state means that the database is currently
 ** in a read transaction.  Content has been read from the database file
 ** but nothing in the database file has changed.  The transaction state
-** will advanced to SQLITE_TXN_WRITE if any changes occur and there are
+** will be advanced to SQLITE_TXN_WRITE if any changes occur and there are
 ** no other conflicting concurrent write transactions.  The transaction
 ** state will revert to SQLITE_TXN_NONE following a [ROLLBACK] or
 ** [COMMIT].</dd>
@@ -7239,7 +7239,7 @@ SQLITE_API int sqlite3_txn_state(sqlite3*,const char *zSchema);
 ** <dd>The SQLITE_TXN_WRITE state means that the database is currently
 ** in a write transaction.  Content has been written to the database file
 ** but has not yet committed.  The transaction state will change to
-** to SQLITE_TXN_NONE at the next [ROLLBACK] or [COMMIT].</dd>
+** SQLITE_TXN_NONE at the next [ROLLBACK] or [COMMIT].</dd>
 */
 #define SQLITE_TXN_NONE  0
 #define SQLITE_TXN_READ  1
@@ -7520,7 +7520,7 @@ SQLITE_API int sqlite3_db_release_memory(sqlite3*);
 ** CAPI3REF: Impose A Limit On Heap Size
 **
 ** These interfaces impose limits on the amount of heap memory that will be
-** by all database connections within a single process.
+** used by all database connections within a single process.
 **
 ** ^The sqlite3_soft_heap_limit64() interface sets and/or queries the
 ** soft limit on the amount of heap memory that may be allocated by SQLite.
@@ -7578,7 +7578,7 @@ SQLITE_API int sqlite3_db_release_memory(sqlite3*);
 ** </ul>)^
 **
 ** The circumstances under which SQLite will enforce the heap limits may
-** changes in future releases of SQLite.
+** change in future releases of SQLite.
 */
 SQLITE_API sqlite3_int64 sqlite3_soft_heap_limit64(sqlite3_int64 N);
 SQLITE_API sqlite3_int64 sqlite3_hard_heap_limit64(sqlite3_int64 N);
@@ -7693,8 +7693,8 @@ SQLITE_API int sqlite3_table_column_metadata(
 ** ^The entry point is zProc.
 ** ^(zProc may be 0, in which case SQLite will try to come up with an
 ** entry point name on its own.  It first tries "sqlite3_extension_init".
-** If that does not work, it constructs a name "sqlite3_X_init" where the
-** X is consists of the lower-case equivalent of all ASCII alphabetic
+** If that does not work, it constructs a name "sqlite3_X_init" where
+** X consists of the lower-case equivalent of all ASCII alphabetic
 ** characters in the filename from the last "/" to the first following
 ** "." and omitting any initial "lib".)^
 ** ^The sqlite3_load_extension() interface returns
@@ -7765,7 +7765,7 @@ SQLITE_API int sqlite3_enable_load_extension(sqlite3 *db, int onoff);
 ** ^(Even though the function prototype shows that xEntryPoint() takes
 ** no arguments and returns void, SQLite invokes xEntryPoint() with three
 ** arguments and expects an integer result as if the signature of the
-** entry point where as follows:
+** entry point were as follows:
 **
 ** <blockquote><pre>
 ** &nbsp;  int xEntryPoint(
@@ -7929,7 +7929,7 @@ struct sqlite3_module {
 ** virtual table and might not be checked again by the byte code.)^ ^(The
 ** aConstraintUsage[].omit flag is an optimization hint. When the omit flag
 ** is left in its default setting of false, the constraint will always be
-** checked separately in byte code.  If the omit flag is change to true, then
+** checked separately in byte code.  If the omit flag is changed to true, then
 ** the constraint may or may not be checked in byte code.  In other words,
 ** when the omit flag is true there is no guarantee that the constraint will
 ** not be checked again using byte code.)^
@@ -7955,7 +7955,7 @@ struct sqlite3_module {
 ** The xBestIndex method may optionally populate the idxFlags field with a
 ** mask of SQLITE_INDEX_SCAN_* flags. One such flag is
 ** [SQLITE_INDEX_SCAN_HEX], which if set causes the [EXPLAIN QUERY PLAN]
-** output to show the idxNum has hex instead of as decimal.  Another flag is
+** output to show the idxNum as hex instead of as decimal.  Another flag is
 ** SQLITE_INDEX_SCAN_UNIQUE, which if set indicates that the query plan will
 ** return at most one row.
 **
@@ -8096,7 +8096,7 @@ struct sqlite3_index_info {
 ** the implementation of the [virtual table module].   ^The fourth
 ** parameter is an arbitrary client data pointer that is passed through
 ** into the [xCreate] and [xConnect] methods of the virtual table module
-** when a new virtual table is be being created or reinitialized.
+** when a new virtual table is being created or reinitialized.
 **
 ** ^The sqlite3_create_module_v2() interface has a fifth parameter which
 ** is a pointer to a destructor for the pClientData.  ^SQLite will
@@ -8261,7 +8261,7 @@ typedef struct sqlite3_blob sqlite3_blob;
 ** in *ppBlob. Otherwise an [error code] is returned and, unless the error
 ** code is SQLITE_MISUSE, *ppBlob is set to NULL.)^ ^This means that, provided
 ** the API is not misused, it is always safe to call [sqlite3_blob_close()]
-** on *ppBlob after this function it returns.
+** on *ppBlob after this function returns.
 **
 ** This function fails with SQLITE_ERROR if any of the following are true:
 ** <ul>
@@ -8381,7 +8381,7 @@ SQLITE_API int sqlite3_blob_close(sqlite3_blob *);
 **
 ** ^Returns the size in bytes of the BLOB accessible via the
 ** successfully opened [BLOB handle] in its only argument.  ^The
-** incremental blob I/O routines can only read or overwriting existing
+** incremental blob I/O routines can only read or overwrite existing
 ** blob content; they cannot change the size of a blob.
 **
 ** This routine only works on a [BLOB handle] which has been created
@@ -8531,7 +8531,7 @@ SQLITE_API int sqlite3_vfs_unregister(sqlite3_vfs*);
 ** ^The sqlite3_mutex_alloc() routine allocates a new
 ** mutex and returns a pointer to it. ^The sqlite3_mutex_alloc()
 ** routine returns NULL if it is unable to allocate the requested
-** mutex.  The argument to sqlite3_mutex_alloc() must one of these
+** mutex.  The argument to sqlite3_mutex_alloc() must be one of these
 ** integer constants:
 **
 ** <ul>
@@ -8764,7 +8764,7 @@ SQLITE_API int sqlite3_mutex_notheld(sqlite3_mutex*);
 ** CAPI3REF: Retrieve the mutex for a database connection
 ** METHOD: sqlite3
 **
-** ^This interface returns a pointer the [sqlite3_mutex] object that
+** ^This interface returns a pointer to the [sqlite3_mutex] object that
 ** serializes access to the [database connection] given in the argument
 ** when the [threading mode] is Serialized.
 ** ^If the [threading mode] is Single-thread or Multi-thread then this
@@ -8887,7 +8887,7 @@ SQLITE_API int sqlite3_test_control(int op, ...);
 ** CAPI3REF: SQL Keyword Checking
 **
 ** These routines provide access to the set of SQL language keywords
-** recognized by SQLite.  Applications can uses these routines to determine
+** recognized by SQLite.  Applications can use these routines to determine
 ** whether or not a specific identifier needs to be escaped (for example,
 ** by enclosing in double-quotes) so as not to confuse the parser.
 **
@@ -9055,7 +9055,7 @@ SQLITE_API void sqlite3_str_reset(sqlite3_str*);
 ** content of the dynamic string under construction in X.  The value
 ** returned by [sqlite3_str_value(X)] is managed by the sqlite3_str object X
 ** and might be freed or altered by any subsequent method on the same
-** [sqlite3_str] object.  Applications must not used the pointer returned
+** [sqlite3_str] object.  Applications must not use the pointer returned by
 ** [sqlite3_str_value(X)] after any subsequent method call on the same
 ** object.  ^Applications may change the content of the string returned
 ** by [sqlite3_str_value(X)] as long as they do not write into any bytes
@@ -9141,7 +9141,7 @@ SQLITE_API int sqlite3_status64(
 ** allocation which could not be satisfied by the [SQLITE_CONFIG_PAGECACHE]
 ** buffer and where forced to overflow to [sqlite3_malloc()].  The
 ** returned value includes allocations that overflowed because they
-** where too large (they were larger than the "sz" parameter to
+** were too large (they were larger than the "sz" parameter to
 ** [SQLITE_CONFIG_PAGECACHE]) and allocations that overflowed because
 ** no space was left in the page cache.</dd>)^
 **
@@ -9225,28 +9225,29 @@ SQLITE_API int sqlite3_db_status(sqlite3*, int op, int *pCur, int *pHiwtr, int r
 ** [[SQLITE_DBSTATUS_LOOKASIDE_HIT]] ^(<dt>SQLITE_DBSTATUS_LOOKASIDE_HIT</dt>
 ** <dd>This parameter returns the number of malloc attempts that were
 ** satisfied using lookaside memory. Only the high-water value is meaningful;
-** the current value is always zero.)^
+** the current value is always zero.</dd>)^
 **
 ** [[SQLITE_DBSTATUS_LOOKASIDE_MISS_SIZE]]
 ** ^(<dt>SQLITE_DBSTATUS_LOOKASIDE_MISS_SIZE</dt>
-** <dd>This parameter returns the number malloc attempts that might have
+** <dd>This parameter returns the number of malloc attempts that might have
 ** been satisfied using lookaside memory but failed due to the amount of
 ** memory requested being larger than the lookaside slot size.
 ** Only the high-water value is meaningful;
-** the current value is always zero.)^
+** the current value is always zero.</dd>)^
 **
 ** [[SQLITE_DBSTATUS_LOOKASIDE_MISS_FULL]]
 ** ^(<dt>SQLITE_DBSTATUS_LOOKASIDE_MISS_FULL</dt>
-** <dd>This parameter returns the number malloc attempts that might have
+** <dd>This parameter returns the number of malloc attempts that might have
 ** been satisfied using lookaside memory but failed due to all lookaside
 ** memory already being in use.
 ** Only the high-water value is meaningful;
-** the current value is always zero.)^
+** the current value is always zero.</dd>)^
 **
 ** [[SQLITE_DBSTATUS_CACHE_USED]] ^(<dt>SQLITE_DBSTATUS_CACHE_USED</dt>
 ** <dd>This parameter returns the approximate number of bytes of heap
 ** memory used by all pager caches associated with the database connection.)^
 ** ^The highwater mark associated with SQLITE_DBSTATUS_CACHE_USED is always 0.
+** </dd>
 **
 ** [[SQLITE_DBSTATUS_CACHE_USED_SHARED]]
 ** ^(<dt>SQLITE_DBSTATUS_CACHE_USED_SHARED</dt>
@@ -9255,10 +9256,10 @@ SQLITE_API int sqlite3_db_status(sqlite3*, int op, int *pCur, int *pHiwtr, int r
 ** memory used by that pager cache is divided evenly between the attached
 ** connections.)^  In other words, if none of the pager caches associated
 ** with the database connection are shared, this request returns the same
-** value as DBSTATUS_CACHE_USED. Or, if one or more or the pager caches are
+** value as DBSTATUS_CACHE_USED. Or, if one or more of the pager caches are
 ** shared, the value returned by this call will be smaller than that returned
 ** by DBSTATUS_CACHE_USED. ^The highwater mark associated with
-** SQLITE_DBSTATUS_CACHE_USED_SHARED is always 0.
+** SQLITE_DBSTATUS_CACHE_USED_SHARED is always 0.</dd>
 **
 ** [[SQLITE_DBSTATUS_SCHEMA_USED]] ^(<dt>SQLITE_DBSTATUS_SCHEMA_USED</dt>
 ** <dd>This parameter returns the approximate number of bytes of heap
@@ -9268,6 +9269,7 @@ SQLITE_API int sqlite3_db_status(sqlite3*, int op, int *pCur, int *pHiwtr, int r
 ** schema memory is shared with other database connections due to
 ** [shared cache mode] being enabled.
 ** ^The highwater mark associated with SQLITE_DBSTATUS_SCHEMA_USED is always 0.
+** </dd>
 **
 ** [[SQLITE_DBSTATUS_STMT_USED]] ^(<dt>SQLITE_DBSTATUS_STMT_USED</dt>
 ** <dd>This parameter returns the approximate number of bytes of heap
@@ -9304,7 +9306,7 @@ SQLITE_API int sqlite3_db_status(sqlite3*, int op, int *pCur, int *pHiwtr, int r
 ** been written to disk in the middle of a transaction due to the page
 ** cache overflowing. Transactions are more efficient if they are written
 ** to disk all at once. When pages spill mid-transaction, that introduces
-** additional overhead. This parameter can be used help identify
+** additional overhead. This parameter can be used to help identify
 ** inefficiencies that can be resolved by increasing the cache size.
 ** </dd>
 **
@@ -9784,7 +9786,7 @@ typedef struct sqlite3_backup sqlite3_backup;
 ** external process or via a database connection other than the one being
 ** used by the backup operation, then the backup will be automatically
 ** restarted by the next call to sqlite3_backup_step(). ^If the source
-** database is modified by the using the same database connection as is used
+** database is modified by using the same database connection as is used
 ** by the backup operation, then the backup database is automatically
 ** updated at the same time.
 **
@@ -9801,7 +9803,7 @@ typedef struct sqlite3_backup sqlite3_backup;
 ** and may not be used following a call to sqlite3_backup_finish().
 **
 ** ^The value returned by sqlite3_backup_finish is [SQLITE_OK] if no
-** sqlite3_backup_step() errors occurred, regardless or whether or not
+** sqlite3_backup_step() errors occurred, regardless of whether or not
 ** sqlite3_backup_step() completed.
 ** ^If an out-of-memory condition or IO error occurred during any prior
 ** sqlite3_backup_step() call on the same [sqlite3_backup] object, then
@@ -10871,7 +10873,7 @@ SQLITE_API void sqlite3_stmt_scanstatus_reset(sqlite3_stmt*);
 ** METHOD: sqlite3
 **
 ** ^If a write-transaction is open on [database connection] D when the
-** [sqlite3_db_cacheflush(D)] interface invoked, any dirty
+** [sqlite3_db_cacheflush(D)] interface is invoked, any dirty
 ** pages in the pager-cache that are not currently in use are written out
 ** to disk. A dirty page may be in use if a database cursor created by an
 ** active SQL statement is reading from it, or if it is page 1 of a database
@@ -15442,8 +15444,8 @@ typedef INT16_TYPE LogEst;
 ** assuming n is a signed integer type.  UMXV(n) is similar for unsigned
 ** integer types.
 */
-#define SMXV(n) ((((i64)1)<<(sizeof(n)-1))-1)
-#define UMXV(n) ((((i64)1)<<(sizeof(n)))-1)
+#define SMXV(n) ((((i64)1)<<(sizeof(n)*8-1))-1)
+#define UMXV(n) ((((i64)1)<<(sizeof(n)*8))-1)
 
 /*
 ** Round up a number to the next larger multiple of 8.  This is used
@@ -18703,6 +18705,7 @@ struct CollSeq {
 #define SQLITE_AFF_INTEGER  0x44  /* 'D' */
 #define SQLITE_AFF_REAL     0x45  /* 'E' */
 #define SQLITE_AFF_FLEXNUM  0x46  /* 'F' */
+#define SQLITE_AFF_DEFER    0x58  /* 'X'  - defer computation until later */
 
 #define sqlite3IsNumericAffinity(X)  ((X)>=SQLITE_AFF_NUMERIC)
 
@@ -19253,7 +19256,7 @@ struct AggInfo {
                           ** from source tables rather than from accumulators */
   u8 useSortingIdx;       /* In direct mode, reference the sorting index rather
                           ** than the source table */
-  u16 nSortingColumn;     /* Number of columns in the sorting index */
+  u32 nSortingColumn;     /* Number of columns in the sorting index */
   int sortingIdx;         /* Cursor number of the sorting index */
   int sortingIdxPTab;     /* Cursor number of pseudo-table */
   int iFirstReg;          /* First register in range for aCol[] and aFunc[] */
@@ -19262,8 +19265,8 @@ struct AggInfo {
     Table *pTab;             /* Source table */
     Expr *pCExpr;            /* The original expression */
     int iTable;              /* Cursor number of the source table */
-    i16 iColumn;             /* Column number within the source table */
-    i16 iSorterColumn;       /* Column number in the sorting index */
+    int iColumn;             /* Column number within the source table */
+    int iSorterColumn;       /* Column number in the sorting index */
   } *aCol;
   int nColumn;            /* Number of used entries in aCol[] */
   int nAccumulator;       /* Number of columns that show through to the output.
@@ -43874,21 +43877,20 @@ static int unixShmLock(
   /* Check that, if this to be a blocking lock, no locks that occur later
   ** in the following list than the lock being obtained are already held:
   **
-  **   1. Checkpointer lock (ofst==1).
-  **   2. Write lock (ofst==0).
-  **   3. Read locks (ofst>=3 && ofst<SQLITE_SHM_NLOCK).
+  **   1. Recovery lock (ofst==2).
+  **   2. Checkpointer lock (ofst==1).
+  **   3. Write lock (ofst==0).
+  **   4. Read locks (ofst>=3 && ofst<SQLITE_SHM_NLOCK).
   **
   ** In other words, if this is a blocking lock, none of the locks that
   ** occur later in the above list than the lock being obtained may be
   ** held.
-  **
-  ** It is not permitted to block on the RECOVER lock.
   */
 #if defined(SQLITE_ENABLE_SETLK_TIMEOUT) && defined(SQLITE_DEBUG)
   {
     u16 lockMask = (p->exclMask|p->sharedMask);
     assert( (flags & SQLITE_SHM_UNLOCK) || pDbFd->iBusyTimeout==0 || (
-          (ofst!=2)                                   /* not RECOVER */
+          (ofst!=2 || lockMask==0)
        && (ofst!=1 || lockMask==0 || lockMask==2)
        && (ofst!=0 || lockMask<3)
        && (ofst<3  || lockMask<(1<<ofst))
@@ -49849,7 +49851,11 @@ static int winHandleLockTimeout(
       if( res==WAIT_OBJECT_0 ){
         ret = TRUE;
       }else if( res==WAIT_TIMEOUT ){
+#if SQLITE_ENABLE_SETLK_TIMEOUT==1
         rc = SQLITE_BUSY_TIMEOUT;
+#else
+        rc = SQLITE_BUSY;
+#endif
       }else{
         /* Some other error has occurred */
         rc = SQLITE_IOERR_LOCK;
@@ -51660,21 +51666,20 @@ static int winShmLock(
   /* Check that, if this to be a blocking lock, no locks that occur later
   ** in the following list than the lock being obtained are already held:
   **
-  **   1. Checkpointer lock (ofst==1).
-  **   2. Write lock (ofst==0).
-  **   3. Read locks (ofst>=3 && ofst<SQLITE_SHM_NLOCK).
+  **   1. Recovery lock (ofst==2).
+  **   2. Checkpointer lock (ofst==1).
+  **   3. Write lock (ofst==0).
+  **   4. Read locks (ofst>=3 && ofst<SQLITE_SHM_NLOCK).
   **
   ** In other words, if this is a blocking lock, none of the locks that
   ** occur later in the above list than the lock being obtained may be
   ** held.
-  **
-  ** It is not permitted to block on the RECOVER lock.
   */
 #if defined(SQLITE_ENABLE_SETLK_TIMEOUT) && defined(SQLITE_DEBUG)
   {
     u16 lockMask = (p->exclMask|p->sharedMask);
     assert( (flags & SQLITE_SHM_UNLOCK) || pDbFd->iBusyTimeout==0 || (
-          (ofst!=2)                                   /* not RECOVER */
+          (ofst!=2 || lockMask==0)
        && (ofst!=1 || lockMask==0 || lockMask==2)
        && (ofst!=0 || lockMask<3)
        && (ofst<3  || lockMask<(1<<ofst))
@@ -54963,7 +54968,9 @@ bitvec_set_rehash:
     }else{
       memcpy(aiValues, p->u.aHash, sizeof(p->u.aHash));
       memset(p->u.apSub, 0, sizeof(p->u.apSub));
-      p->iDivisor = (p->iSize + BITVEC_NPTR - 1)/BITVEC_NPTR;
+      p->iDivisor = p->iSize/BITVEC_NPTR;
+      if( (p->iSize%BITVEC_NPTR)!=0 ) p->iDivisor++;
+      if( p->iDivisor<BITVEC_NBIT ) p->iDivisor = BITVEC_NBIT;
       rc = sqlite3BitvecSet(p, i);
       for(j=0; j<BITVEC_NINT; j++){
         if( aiValues[j] ) rc |= sqlite3BitvecSet(p, aiValues[j]);
@@ -58750,6 +58757,9 @@ struct Pager {
   Wal *pWal;                  /* Write-ahead log used by "journal_mode=wal" */
   char *zWal;                 /* File name for write-ahead log */
 #endif
+#ifdef SQLITE_ENABLE_SETLK_TIMEOUT
+  sqlite3 *dbWal;
+#endif
 };
 
 /*
@@ -65631,6 +65641,11 @@ static int pagerOpenWal(Pager *pPager){
         pPager->fd, pPager->zWal, pPager->exclusiveMode,
         pPager->journalSizeLimit, &pPager->pWal
     );
+#ifdef SQLITE_ENABLE_SETLK_TIMEOUT
+    if( rc==SQLITE_OK ){
+      sqlite3WalDb(pPager->pWal, pPager->dbWal);
+    }
+#endif
   }
   pagerFixMaplimit(pPager);
 
@@ -65750,6 +65765,7 @@ SQLITE_PRIVATE int sqlite3PagerWalWriteLock(Pager *pPager, int bLock){
 ** blocking locks are required.
 */
 SQLITE_PRIVATE void sqlite3PagerWalDb(Pager *pPager, sqlite3 *db){
+  pPager->dbWal = db;
   if( pagerUseWal(pPager) ){
     sqlite3WalDb(pPager->pWal, db);
   }
@@ -68923,7 +68939,6 @@ static int walTryBeginRead(Wal *pWal, int *pChanged, int useWal, int *pCnt){
       rc = walIndexReadHdr(pWal, pChanged);
     }
 #ifdef SQLITE_ENABLE_SETLK_TIMEOUT
-    walDisableBlocking(pWal);
     if( rc==SQLITE_BUSY_TIMEOUT ){
       rc = SQLITE_BUSY;
       *pCnt |= WAL_RETRY_BLOCKED_MASK;
@@ -68938,6 +68953,7 @@ static int walTryBeginRead(Wal *pWal, int *pChanged, int useWal, int *pCnt){
       ** WAL_RETRY this routine will be called again and will probably be
       ** right on the second iteration.
       */
+      (void)walEnableBlocking(pWal);
       if( pWal->apWiData[0]==0 ){
         /* This branch is taken when the xShmMap() method returns SQLITE_BUSY.
         ** We assume this is a transient condition, so return WAL_RETRY. The
@@ -68954,6 +68970,7 @@ static int walTryBeginRead(Wal *pWal, int *pChanged, int useWal, int *pCnt){
         rc = SQLITE_BUSY_RECOVERY;
       }
     }
+    walDisableBlocking(pWal);
     if( rc!=SQLITE_OK ){
       return rc;
     }
@@ -69641,6 +69658,7 @@ SQLITE_PRIVATE int sqlite3WalUndo(Wal *pWal, int (*xUndo)(void *, Pgno), void *p
       if( iMax!=pWal->hdr.mxFrame ) walCleanupHash(pWal);
     }
     SEH_EXCEPT( rc = SQLITE_IOERR_IN_PAGE; )
+    pWal->iReCksum = 0;
   }
   return rc;
 }
@@ -69688,6 +69706,9 @@ SQLITE_PRIVATE int sqlite3WalSavepointUndo(Wal *pWal, u32 *aWalData){
       walCleanupHash(pWal);
     }
     SEH_EXCEPT( rc = SQLITE_IOERR_IN_PAGE; )
+    if( pWal->iReCksum>pWal->hdr.mxFrame ){
+      pWal->iReCksum = 0;
+    }
   }
 
   return rc;
@@ -75228,6 +75249,13 @@ static SQLITE_NOINLINE int btreeBeginTrans(
       (void)sqlite3PagerWalWriteLock(pPager, 0);
       unlockBtreeIfUnused(pBt);
     }
+#if defined(SQLITE_ENABLE_SETLK_TIMEOUT)
+    if( rc==SQLITE_BUSY_TIMEOUT ){
+      /* If a blocking lock timed out, break out of the loop here so that
+      ** the busy-handler is not invoked.  */
+      break;
+    }
+#endif
   }while( (rc&0xFF)==SQLITE_BUSY && pBt->inTransaction==TRANS_NONE &&
           btreeInvokeBusyHandler(pBt) );
   sqlite3PagerWalDb(pPager, 0);
@@ -105039,7 +105067,7 @@ SQLITE_PRIVATE int sqlite3VdbeSorterInit(
   assert( pCsr->eCurType==CURTYPE_SORTER );
   assert( sizeof(KeyInfo) + UMXV(pCsr->pKeyInfo->nKeyField)*sizeof(CollSeq*)
                < 0x7fffffff );
-  szKeyInfo = SZ_KEYINFO(pCsr->pKeyInfo->nKeyField+1);
+  szKeyInfo = SZ_KEYINFO(pCsr->pKeyInfo->nKeyField);
   sz = SZ_VDBESORTER(nWorker+1);
 
   pSorter = (VdbeSorter*)sqlite3DbMallocZero(db, sz + szKeyInfo);
@@ -110389,7 +110417,9 @@ SQLITE_PRIVATE char sqlite3ExprAffinity(const Expr *pExpr){
           pExpr->pLeft->x.pSelect->pEList->a[pExpr->iColumn].pExpr
       );
     }
-    if( op==TK_VECTOR ){
+    if( op==TK_VECTOR
+     || (op==TK_FUNCTION && pExpr->affExpr==SQLITE_AFF_DEFER)
+    ){
       assert( ExprUseXList(pExpr) );
       return sqlite3ExprAffinity(pExpr->x.pList->a[0].pExpr);
     }
@@ -110582,7 +110612,9 @@ SQLITE_PRIVATE CollSeq *sqlite3ExprCollSeq(Parse *pParse, const Expr *pExpr){
       p = p->pLeft;
       continue;
     }
-    if( op==TK_VECTOR ){
+    if( op==TK_VECTOR
+     || (op==TK_FUNCTION && p->affExpr==SQLITE_AFF_DEFER)
+    ){
       assert( ExprUseXList(p) );
       p = p->x.pList->a[0].pExpr;
       continue;
@@ -117322,7 +117354,9 @@ static void findOrCreateAggInfoColumn(
 ){
   struct AggInfo_col *pCol;
   int k;
+  int mxTerm = pParse->db->aLimit[SQLITE_LIMIT_COLUMN];
 
+  assert( mxTerm <= SMXV(i16) );
   assert( pAggInfo->iFirstReg==0 );
   pCol = pAggInfo->aCol;
   for(k=0; k<pAggInfo->nColumn; k++, pCol++){
@@ -117340,6 +117374,10 @@ static void findOrCreateAggInfoColumn(
     assert( pParse->db->mallocFailed );
     return;
   }
+  if( k>mxTerm ){
+    sqlite3ErrorMsg(pParse, "more than %d aggregate terms", mxTerm);
+    k = mxTerm;
+  }
   pCol = &pAggInfo->aCol[k];
   assert( ExprUseYTab(pExpr) );
   pCol->pTab = pExpr->y.pTab;
@@ -117373,6 +117411,7 @@ fix_up_expr:
   if( pExpr->op==TK_COLUMN ){
     pExpr->op = TK_AGG_COLUMN;
   }
+  assert( k <= SMXV(pExpr->iAgg) );
   pExpr->iAgg = (i16)k;
 }
 
@@ -117457,13 +117496,19 @@ static int analyzeAggregate(Walker *pWalker, Expr *pExpr){
         ** function that is already in the pAggInfo structure
         */
         struct AggInfo_func *pItem = pAggInfo->aFunc;
+        int mxTerm = pParse->db->aLimit[SQLITE_LIMIT_COLUMN];
+        assert( mxTerm <= SMXV(i16) );
         for(i=0; i<pAggInfo->nFunc; i++, pItem++){
           if( NEVER(pItem->pFExpr==pExpr) ) break;
           if( sqlite3ExprCompare(0, pItem->pFExpr, pExpr, -1)==0 ){
             break;
           }
         }
-        if( i>=pAggInfo->nFunc ){
+        if( i>mxTerm ){
+          sqlite3ErrorMsg(pParse, "more than %d aggregate terms", mxTerm);
+          i = mxTerm;
+          assert( i<pAggInfo->nFunc );
+        }else if( i>=pAggInfo->nFunc ){
           /* pExpr is original.  Make a new entry in pAggInfo->aFunc[]
           */
           u8 enc = ENC(pParse->db);
@@ -117517,6 +117562,7 @@ static int analyzeAggregate(Walker *pWalker, Expr *pExpr){
         */
         assert( !ExprHasProperty(pExpr, EP_TokenOnly|EP_Reduced) );
         ExprSetVVAProperty(pExpr, EP_NoReduce);
+        assert( i <= SMXV(pExpr->iAgg) );
         pExpr->iAgg = (i16)i;
         pExpr->pAggInfo = pAggInfo;
         return WRC_Prune;
@@ -131975,7 +132021,7 @@ static void concatFuncCore(
   int nSep,
   const char *zSep
 ){
-  i64 j, k, n = 0;
+  i64 j, n = 0;
   int i;
   char *z;
   for(i=0; i<argc; i++){
@@ -131989,8 +132035,8 @@ static void concatFuncCore(
   }
   j = 0;
   for(i=0; i<argc; i++){
-    k = sqlite3_value_bytes(argv[i]);
-    if( k>0 ){
+    if( sqlite3_value_type(argv[i])!=SQLITE_NULL ){
+      int k = sqlite3_value_bytes(argv[i]);
       const char *v = (const char*)sqlite3_value_text(argv[i]);
       if( v!=0 ){
         if( j>0 && nSep>0 ){
@@ -145364,7 +145410,7 @@ static int sqlite3ProcessJoin(Parse *pParse, Select *p){
         }
         pE1 = sqlite3CreateColumnExpr(db, pSrc, iLeft, iLeftCol);
         sqlite3SrcItemColumnUsed(&pSrc->a[iLeft], iLeftCol);
-        if( (pSrc->a[0].fg.jointype & JT_LTORJ)!=0 ){
+        if( (pSrc->a[0].fg.jointype & JT_LTORJ)!=0 && pParse->nErr==0 ){
           /* This branch runs if the query contains one or more RIGHT or FULL
           ** JOINs.  If only a single table on the left side of this join
           ** contains the zName column, then this branch is a no-op.
@@ -145380,6 +145426,8 @@ static int sqlite3ProcessJoin(Parse *pParse, Select *p){
           */
           ExprList *pFuncArgs = 0;   /* Arguments to the coalesce() */
           static const Token tkCoalesce = { "coalesce", 8 };
+          assert( pE1!=0 );
+          ExprSetProperty(pE1, EP_CanBeNull);
           while( tableAndColumnIndex(pSrc, iLeft+1, i, zName, &iLeft, &iLeftCol,
                                      pRight->fg.isSynthUsing)!=0 ){
             if( pSrc->a[iLeft].fg.isUsing==0
@@ -145396,7 +145444,13 @@ static int sqlite3ProcessJoin(Parse *pParse, Select *p){
           if( pFuncArgs ){
             pFuncArgs = sqlite3ExprListAppend(pParse, pFuncArgs, pE1);
             pE1 = sqlite3ExprFunction(pParse, pFuncArgs, &tkCoalesce, 0);
+            if( pE1 ){
+              pE1->affExpr = SQLITE_AFF_DEFER;
+            }
           }
+        }else if( (pSrc->a[i+1].fg.jointype & JT_LEFT)!=0 && pParse->nErr==0 ){
+          assert( pE1!=0 );
+          ExprSetProperty(pE1, EP_CanBeNull);
         }
         pE2 = sqlite3CreateColumnExpr(db, pSrc, i+1, iRightCol);
         sqlite3SrcItemColumnUsed(pRight, iRightCol);
@@ -149004,9 +149058,9 @@ static int compoundHasDifferentAffinities(Select *p){
 **             from 2015-02-09.)
 **
 **   (3)  If the subquery is the right operand of a LEFT JOIN then
-**        (3a) the subquery may not be a join and
-**        (3b) the FROM clause of the subquery may not contain a virtual
-**             table and
+**        (3a) the subquery may not be a join
+**        (**) Was (3b): "the FROM clause of the subquery may not contain
+**             a virtual table"
 **        (**) Was: "The outer query may not have a GROUP BY." This case
 **             is now managed correctly
 **        (3d) the outer query may not be DISTINCT.
@@ -149222,7 +149276,7 @@ static int flattenSubquery(
   */
   if( (pSubitem->fg.jointype & (JT_OUTER|JT_LTORJ))!=0 ){
     if( pSubSrc->nSrc>1                        /* (3a) */
-     || IsVirtual(pSubSrc->a[0].pSTab)         /* (3b) */
+     /**** || IsVirtual(pSubSrc->a[0].pSTab)      (3b)-omitted */
      || (p->selFlags & SF_Distinct)!=0         /* (3d) */
      || (pSubitem->fg.jointype & JT_RIGHT)!=0  /* (26) */
     ){
@@ -161722,12 +161776,13 @@ SQLITE_PRIVATE Bitmask sqlite3WhereCodeOneLoopStart(
     if( pLevel->iLeftJoin==0 ){
       /* If a partial index is driving the loop, try to eliminate WHERE clause
       ** terms from the query that must be true due to the WHERE clause of
-      ** the partial index.
+      ** the partial index.  This optimization does not work on an outer join,
+      ** as shown by:
       **
-      ** 2019-11-02 ticket 623eff57e76d45f6: This optimization does not work
-      ** for a LEFT JOIN.
+      ** 2019-11-02 ticket 623eff57e76d45f6      (LEFT JOIN)
+      ** 2025-05-29 forum post 7dee41d32506c4ae  (RIGHT JOIN)
       */
-      if( pIdx->pPartIdxWhere ){
+      if( pIdx->pPartIdxWhere && pLevel->pRJ==0 ){
         whereApplyPartialIndexConstraints(pIdx->pPartIdxWhere, iCur, pWC);
       }
     }else{
@@ -163400,30 +163455,42 @@ static void exprAnalyzeOrTerm(
 **   1.  The SQLITE_Transitive optimization must be enabled
 **   2.  Must be either an == or an IS operator
 **   3.  Not originating in the ON clause of an OUTER JOIN
-**   4.  The affinities of A and B must be compatible
-**   5a. Both operands use the same collating sequence OR
-**   5b. The overall collating sequence is BINARY
+**   4.  The operator is not IS or else the query does not contain RIGHT JOIN
+**   5.  The affinities of A and B must be compatible
+**   6a. Both operands use the same collating sequence OR
+**   6b. The overall collating sequence is BINARY
 ** If this routine returns TRUE, that means that the RHS can be substituted
 ** for the LHS anyplace else in the WHERE clause where the LHS column occurs.
 ** This is an optimization.  No harm comes from returning 0.  But if 1 is
 ** returned when it should not be, then incorrect answers might result.
 */
-static int termIsEquivalence(Parse *pParse, Expr *pExpr){
+static int termIsEquivalence(Parse *pParse, Expr *pExpr, SrcList *pSrc){
   char aff1, aff2;
   CollSeq *pColl;
-  if( !OptimizationEnabled(pParse->db, SQLITE_Transitive) ) return 0;
-  if( pExpr->op!=TK_EQ && pExpr->op!=TK_IS ) return 0;
-  if( ExprHasProperty(pExpr, EP_OuterON) ) return 0;
+  if( !OptimizationEnabled(pParse->db, SQLITE_Transitive) ) return 0;  /* (1) */
+  if( pExpr->op!=TK_EQ && pExpr->op!=TK_IS ) return 0;                 /* (2) */
+  if( ExprHasProperty(pExpr, EP_OuterON) ) return 0;                   /* (3) */
+  assert( pSrc!=0 );
+  if( pExpr->op==TK_IS
+   && pSrc->nSrc
+   && (pSrc->a[0].fg.jointype & JT_LTORJ)!=0
+  ){
+    return 0;                                                          /* (4) */
+  }
   aff1 = sqlite3ExprAffinity(pExpr->pLeft);
   aff2 = sqlite3ExprAffinity(pExpr->pRight);
   if( aff1!=aff2
    && (!sqlite3IsNumericAffinity(aff1) || !sqlite3IsNumericAffinity(aff2))
   ){
-    return 0;
+    return 0;                                                          /* (5) */
   }
   pColl = sqlite3ExprCompareCollSeq(pParse, pExpr);
-  if( sqlite3IsBinary(pColl) ) return 1;
-  return sqlite3ExprCollSeqMatch(pParse, pExpr->pLeft, pExpr->pRight);
+  if( !sqlite3IsBinary(pColl)
+   && !sqlite3ExprCollSeqMatch(pParse, pExpr->pLeft, pExpr->pRight)
+  ){
+    return 0;                                                          /* (6) */
+  }
+  return 1;
 }
 
 /*
@@ -163688,8 +163755,8 @@ static void exprAnalyze(
         if( op==TK_IS ) pNew->wtFlags |= TERM_IS;
         pTerm = &pWC->a[idxTerm];
         pTerm->wtFlags |= TERM_COPIED;
-
-        if( termIsEquivalence(pParse, pDup) ){
+        assert( pWInfo->pTabList!=0 );
+        if( termIsEquivalence(pParse, pDup, pWInfo->pTabList) ){
           pTerm->eOperator |= WO_EQUIV;
           eExtraOp = WO_EQUIV;
         }
@@ -184391,6 +184458,7 @@ SQLITE_API int sqlite3_setlk_timeout(sqlite3 *db, int ms, int flags){
 #endif
   if( ms<-1 ) return SQLITE_RANGE;
 #ifdef SQLITE_ENABLE_SETLK_TIMEOUT
+  sqlite3_mutex_enter(db->mutex);
   db->setlkTimeout = ms;
   db->setlkFlags = flags;
   sqlite3BtreeEnterAll(db);
@@ -184402,6 +184470,7 @@ SQLITE_API int sqlite3_setlk_timeout(sqlite3 *db, int ms, int flags){
     }
   }
   sqlite3BtreeLeaveAll(db);
+  sqlite3_mutex_leave(db->mutex);
 #endif
 #if !defined(SQLITE_ENABLE_API_ARMOR) && !defined(SQLITE_ENABLE_SETLK_TIMEOUT)
   UNUSED_PARAMETER(db);
@@ -209021,8 +209090,10 @@ static int jsonBlobChangePayloadSize(
     nExtra = 1;
   }else if( szType==13 ){
     nExtra = 2;
-  }else{
+  }else if( szType==14 ){
     nExtra = 4;
+  }else{
+    nExtra = 8;
   }
   if( szPayload<=11 ){
     nNeeded = 0;
@@ -213407,6 +213478,8 @@ SQLITE_PRIVATE int sqlite3JsonTableFunctions(sqlite3 *db){
 #endif
 SQLITE_PRIVATE int sqlite3GetToken(const unsigned char*,int*); /* In the SQLite core */
 
+/* #include <stddef.h> */
+
 /*
 ** If building separately, we will need some setup that is normally
 ** found in sqliteInt.h
@@ -235449,6 +235522,7 @@ SQLITE_EXTENSION_INIT1
 
 /* #include <string.h> */
 /* #include <assert.h> */
+/* #include <stddef.h> */
 
 #ifndef SQLITE_AMALGAMATION
 
@@ -257192,7 +257266,7 @@ static void fts5SourceIdFunc(
 ){
   assert( nArg==0 );
   UNUSED_PARAM2(nArg, apUnused);
-  sqlite3_result_text(pCtx, "fts5: 2025-05-29 14:26:00 dfc790f998f450d9c35e3ba1c8c89c17466cb559f87b0239e4aab9d34e28f742", -1, SQLITE_TRANSIENT);
+  sqlite3_result_text(pCtx, "fts5: 2025-06-28 14:00:48 2af157d77fb1304a74176eaee7fbc7c7e932d946bf25325e9c26c91db19e3079", -1, SQLITE_TRANSIENT);
 }
 
 /*
@@ -258007,6 +258081,7 @@ static int fts5StorageDeleteFromIndex(
   for(iCol=1; rc==SQLITE_OK && iCol<=pConfig->nCol; iCol++){
     if( pConfig->abUnindexed[iCol-1]==0 ){
       sqlite3_value *pVal = 0;
+      sqlite3_value *pFree = 0;
       const char *pText = 0;
       int nText = 0;
       const char *pLoc = 0;
@@ -258023,11 +258098,22 @@ static int fts5StorageDeleteFromIndex(
       if( pConfig->bLocale && sqlite3Fts5IsLocaleValue(pConfig, pVal) ){
         rc = sqlite3Fts5DecodeLocaleValue(pVal, &pText, &nText, &pLoc, &nLoc);
       }else{
-        pText = (const char*)sqlite3_value_text(pVal);
-        nText = sqlite3_value_bytes(pVal);
-        if( pConfig->bLocale && pSeek ){
-          pLoc = (const char*)sqlite3_column_text(pSeek, iCol + pConfig->nCol);
-          nLoc = sqlite3_column_bytes(pSeek, iCol + pConfig->nCol);
+        if( sqlite3_value_type(pVal)!=SQLITE_TEXT ){
+          /* Make a copy of the value to work with. This is because the call
+          ** to sqlite3_value_text() below forces the type of the value to
+          ** SQLITE_TEXT, and we may need to use it again later. */
+          pFree = pVal = sqlite3_value_dup(pVal);
+          if( pVal==0 ){
+            rc = SQLITE_NOMEM;
+          }
+        }
+        if( rc==SQLITE_OK ){
+          pText = (const char*)sqlite3_value_text(pVal);
+          nText = sqlite3_value_bytes(pVal);
+          if( pConfig->bLocale && pSeek ){
+            pLoc = (const char*)sqlite3_column_text(pSeek, iCol+pConfig->nCol);
+            nLoc = sqlite3_column_bytes(pSeek, iCol + pConfig->nCol);
+          }
         }
       }
 
@@ -258043,6 +258129,7 @@ static int fts5StorageDeleteFromIndex(
         }
         sqlite3Fts5ClearLocale(pConfig);
       }
+      sqlite3_value_free(pFree);
     }
   }
   if( rc==SQLITE_OK && p->nTotalRow<1 ){

Telegram/SourceFiles/ayu/libs/sqlite/sqlite3.h

@@ -146,9 +146,9 @@ extern "C" {
 ** [sqlite3_libversion_number()], [sqlite3_sourceid()],
 ** [sqlite_version()] and [sqlite_source_id()].
 */
-#define SQLITE_VERSION        "3.50.0"
-#define SQLITE_VERSION_NUMBER 3050000
-#define SQLITE_SOURCE_ID      "2025-05-29 14:26:00 dfc790f998f450d9c35e3ba1c8c89c17466cb559f87b0239e4aab9d34e28f742"
+#define SQLITE_VERSION        "3.50.2"
+#define SQLITE_VERSION_NUMBER 3050002
+#define SQLITE_SOURCE_ID      "2025-06-28 14:00:48 2af157d77fb1304a74176eaee7fbc7c7e932d946bf25325e9c26c91db19e3079"
 
 /*
 ** CAPI3REF: Run-Time Library Version Numbers
@@ -4079,7 +4079,7 @@ SQLITE_API sqlite3_file *sqlite3_database_file_object(const char*);
 **
 ** The sqlite3_create_filename(D,J,W,N,P) allocates memory to hold a version of
 ** database filename D with corresponding journal file J and WAL file W and
-** with N URI parameters key/values pairs in the array P.  The result from
+** an array P of N URI Key/Value pairs.  The result from
 ** sqlite3_create_filename(D,J,W,N,P) is a pointer to a database filename that
 ** is safe to pass to routines like:
 ** <ul>
@@ -4760,7 +4760,7 @@ typedef struct sqlite3_context sqlite3_context;
 ** METHOD: sqlite3_stmt
 **
 ** ^(In the SQL statement text input to [sqlite3_prepare_v2()] and its variants,
-** literals may be replaced by a [parameter] that matches one of following
+** literals may be replaced by a [parameter] that matches one of the following
 ** templates:
 **
 ** <ul>
@@ -4805,7 +4805,7 @@ typedef struct sqlite3_context sqlite3_context;
 **
 ** [[byte-order determination rules]] ^The byte-order of
 ** UTF16 input text is determined by the byte-order mark (BOM, U+FEFF)
-** found in first character, which is removed, or in the absence of a BOM
+** found in the first character, which is removed, or in the absence of a BOM
 ** the byte order is the native byte order of the host
 ** machine for sqlite3_bind_text16() or the byte order specified in
 ** the 6th parameter for sqlite3_bind_text64().)^
@@ -4825,7 +4825,7 @@ typedef struct sqlite3_context sqlite3_context;
 ** or sqlite3_bind_text16() or sqlite3_bind_text64() then
 ** that parameter must be the byte offset
 ** where the NUL terminator would occur assuming the string were NUL
-** terminated.  If any NUL characters occurs at byte offsets less than
+** terminated.  If any NUL characters occur at byte offsets less than
 ** the value of the fourth parameter then the resulting string value will
 ** contain embedded NULs.  The result of expressions involving strings
 ** with embedded NULs is undefined.
@@ -5037,7 +5037,7 @@ SQLITE_API const void *sqlite3_column_name16(sqlite3_stmt*, int N);
 ** METHOD: sqlite3_stmt
 **
 ** ^These routines provide a means to determine the database, table, and
-** table column that is the origin of a particular result column in
+** table column that is the origin of a particular result column in a
 ** [SELECT] statement.
 ** ^The name of the database or table or column can be returned as
 ** either a UTF-8 or UTF-16 string.  ^The _database_ routines return
@@ -5606,8 +5606,8 @@ SQLITE_API int sqlite3_reset(sqlite3_stmt *pStmt);
 **
 ** For best security, the [SQLITE_DIRECTONLY] flag is recommended for
 ** all application-defined SQL functions that do not need to be
-** used inside of triggers, view, CHECK constraints, or other elements of
-** the database schema.  This flags is especially recommended for SQL
+** used inside of triggers, views, CHECK constraints, or other elements of
+** the database schema.  This flag is especially recommended for SQL
 ** functions that have side effects or reveal internal application state.
 ** Without this flag, an attacker might be able to modify the schema of
 ** a database file to include invocations of the function with parameters
@@ -5638,7 +5638,7 @@ SQLITE_API int sqlite3_reset(sqlite3_stmt *pStmt);
 ** [user-defined window functions|available here].
 **
 ** ^(If the final parameter to sqlite3_create_function_v2() or
-** sqlite3_create_window_function() is not NULL, then it is destructor for
+** sqlite3_create_window_function() is not NULL, then it is the destructor for
 ** the application data pointer. The destructor is invoked when the function
 ** is deleted, either by being overloaded or when the database connection
 ** closes.)^ ^The destructor is also invoked if the call to
@@ -6038,7 +6038,7 @@ SQLITE_API unsigned int sqlite3_value_subtype(sqlite3_value*);
 ** METHOD: sqlite3_value
 **
 ** ^The sqlite3_value_dup(V) interface makes a copy of the [sqlite3_value]
-** object D and returns a pointer to that copy.  ^The [sqlite3_value] returned
+** object V and returns a pointer to that copy.  ^The [sqlite3_value] returned
 ** is a [protected sqlite3_value] object even if the input is not.
 ** ^The sqlite3_value_dup(V) interface returns NULL if V is NULL or if a
 ** memory allocation fails. ^If V is a [pointer value], then the result
@@ -6076,7 +6076,7 @@ SQLITE_API void sqlite3_value_free(sqlite3_value*);
 ** allocation error occurs.
 **
 ** ^(The amount of space allocated by sqlite3_aggregate_context(C,N) is
-** determined by the N parameter on first successful call.  Changing the
+** determined by the N parameter on the first successful call.  Changing the
 ** value of N in any subsequent call to sqlite3_aggregate_context() within
 ** the same aggregate function instance will not resize the memory
 ** allocation.)^  Within the xFinal callback, it is customary to set
@@ -6238,7 +6238,7 @@ SQLITE_API void sqlite3_set_auxdata(sqlite3_context*, int N, void*, void (*)(voi
 **
 ** Security Warning:  These interfaces should not be exposed in scripting
 ** languages or in other circumstances where it might be possible for an
-** an attacker to invoke them.  Any agent that can invoke these interfaces
+** attacker to invoke them.  Any agent that can invoke these interfaces
 ** can probably also take control of the process.
 **
 ** Database connection client data is only available for SQLite
@@ -6352,7 +6352,7 @@ typedef void (*sqlite3_destructor_type)(void*);
 ** pointed to by the 2nd parameter are taken as the application-defined
 ** function result.  If the 3rd parameter is non-negative, then it
 ** must be the byte offset into the string where the NUL terminator would
-** appear if the string where NUL terminated.  If any NUL characters occur
+** appear if the string were NUL terminated.  If any NUL characters occur
 ** in the string at a byte offset that is less than the value of the 3rd
 ** parameter, then the resulting string will contain embedded NULs and the
 ** result of expressions operating on strings with embedded NULs is undefined.
@@ -6410,7 +6410,7 @@ typedef void (*sqlite3_destructor_type)(void*);
 ** string and preferably a string literal. The sqlite3_result_pointer()
 ** routine is part of the [pointer passing interface] added for SQLite 3.20.0.
 **
-** If these routines are called from within the different thread
+** If these routines are called from within a different thread
 ** than the one containing the application-defined function that received
 ** the [sqlite3_context] pointer, the results are undefined.
 */
@@ -6816,7 +6816,7 @@ SQLITE_API sqlite3 *sqlite3_db_handle(sqlite3_stmt*);
 ** METHOD: sqlite3
 **
 ** ^The sqlite3_db_name(D,N) interface returns a pointer to the schema name
-** for the N-th database on database connection D, or a NULL pointer of N is
+** for the N-th database on database connection D, or a NULL pointer if N is
 ** out of range.  An N value of 0 means the main database file.  An N of 1 is
 ** the "temp" schema.  Larger values of N correspond to various ATTACH-ed
 ** databases.
@@ -6911,7 +6911,7 @@ SQLITE_API int sqlite3_txn_state(sqlite3*,const char *zSchema);
 ** <dd>The SQLITE_TXN_READ state means that the database is currently
 ** in a read transaction.  Content has been read from the database file
 ** but nothing in the database file has changed.  The transaction state
-** will advanced to SQLITE_TXN_WRITE if any changes occur and there are
+** will be advanced to SQLITE_TXN_WRITE if any changes occur and there are
 ** no other conflicting concurrent write transactions.  The transaction
 ** state will revert to SQLITE_TXN_NONE following a [ROLLBACK] or
 ** [COMMIT].</dd>
@@ -6920,7 +6920,7 @@ SQLITE_API int sqlite3_txn_state(sqlite3*,const char *zSchema);
 ** <dd>The SQLITE_TXN_WRITE state means that the database is currently
 ** in a write transaction.  Content has been written to the database file
 ** but has not yet committed.  The transaction state will change to
-** to SQLITE_TXN_NONE at the next [ROLLBACK] or [COMMIT].</dd>
+** SQLITE_TXN_NONE at the next [ROLLBACK] or [COMMIT].</dd>
 */
 #define SQLITE_TXN_NONE  0
 #define SQLITE_TXN_READ  1
@@ -7201,7 +7201,7 @@ SQLITE_API int sqlite3_db_release_memory(sqlite3*);
 ** CAPI3REF: Impose A Limit On Heap Size
 **
 ** These interfaces impose limits on the amount of heap memory that will be
-** by all database connections within a single process.
+** used by all database connections within a single process.
 **
 ** ^The sqlite3_soft_heap_limit64() interface sets and/or queries the
 ** soft limit on the amount of heap memory that may be allocated by SQLite.
@@ -7259,7 +7259,7 @@ SQLITE_API int sqlite3_db_release_memory(sqlite3*);
 ** </ul>)^
 **
 ** The circumstances under which SQLite will enforce the heap limits may
-** changes in future releases of SQLite.
+** change in future releases of SQLite.
 */
 SQLITE_API sqlite3_int64 sqlite3_soft_heap_limit64(sqlite3_int64 N);
 SQLITE_API sqlite3_int64 sqlite3_hard_heap_limit64(sqlite3_int64 N);
@@ -7374,8 +7374,8 @@ SQLITE_API int sqlite3_table_column_metadata(
 ** ^The entry point is zProc.
 ** ^(zProc may be 0, in which case SQLite will try to come up with an
 ** entry point name on its own.  It first tries "sqlite3_extension_init".
-** If that does not work, it constructs a name "sqlite3_X_init" where the
-** X is consists of the lower-case equivalent of all ASCII alphabetic
+** If that does not work, it constructs a name "sqlite3_X_init" where
+** X consists of the lower-case equivalent of all ASCII alphabetic
 ** characters in the filename from the last "/" to the first following
 ** "." and omitting any initial "lib".)^
 ** ^The sqlite3_load_extension() interface returns
@@ -7446,7 +7446,7 @@ SQLITE_API int sqlite3_enable_load_extension(sqlite3 *db, int onoff);
 ** ^(Even though the function prototype shows that xEntryPoint() takes
 ** no arguments and returns void, SQLite invokes xEntryPoint() with three
 ** arguments and expects an integer result as if the signature of the
-** entry point where as follows:
+** entry point were as follows:
 **
 ** <blockquote><pre>
 ** &nbsp;  int xEntryPoint(
@@ -7610,7 +7610,7 @@ struct sqlite3_module {
 ** virtual table and might not be checked again by the byte code.)^ ^(The
 ** aConstraintUsage[].omit flag is an optimization hint. When the omit flag
 ** is left in its default setting of false, the constraint will always be
-** checked separately in byte code.  If the omit flag is change to true, then
+** checked separately in byte code.  If the omit flag is changed to true, then
 ** the constraint may or may not be checked in byte code.  In other words,
 ** when the omit flag is true there is no guarantee that the constraint will
 ** not be checked again using byte code.)^
@@ -7636,7 +7636,7 @@ struct sqlite3_module {
 ** The xBestIndex method may optionally populate the idxFlags field with a
 ** mask of SQLITE_INDEX_SCAN_* flags. One such flag is
 ** [SQLITE_INDEX_SCAN_HEX], which if set causes the [EXPLAIN QUERY PLAN]
-** output to show the idxNum has hex instead of as decimal.  Another flag is
+** output to show the idxNum as hex instead of as decimal.  Another flag is
 ** SQLITE_INDEX_SCAN_UNIQUE, which if set indicates that the query plan will
 ** return at most one row.
 **
@@ -7777,7 +7777,7 @@ struct sqlite3_index_info {
 ** the implementation of the [virtual table module].   ^The fourth
 ** parameter is an arbitrary client data pointer that is passed through
 ** into the [xCreate] and [xConnect] methods of the virtual table module
-** when a new virtual table is be being created or reinitialized.
+** when a new virtual table is being created or reinitialized.
 **
 ** ^The sqlite3_create_module_v2() interface has a fifth parameter which
 ** is a pointer to a destructor for the pClientData.  ^SQLite will
@@ -7942,7 +7942,7 @@ typedef struct sqlite3_blob sqlite3_blob;
 ** in *ppBlob. Otherwise an [error code] is returned and, unless the error
 ** code is SQLITE_MISUSE, *ppBlob is set to NULL.)^ ^This means that, provided
 ** the API is not misused, it is always safe to call [sqlite3_blob_close()]
-** on *ppBlob after this function it returns.
+** on *ppBlob after this function returns.
 **
 ** This function fails with SQLITE_ERROR if any of the following are true:
 ** <ul>
@@ -8062,7 +8062,7 @@ SQLITE_API int sqlite3_blob_close(sqlite3_blob *);
 **
 ** ^Returns the size in bytes of the BLOB accessible via the
 ** successfully opened [BLOB handle] in its only argument.  ^The
-** incremental blob I/O routines can only read or overwriting existing
+** incremental blob I/O routines can only read or overwrite existing
 ** blob content; they cannot change the size of a blob.
 **
 ** This routine only works on a [BLOB handle] which has been created
@@ -8212,7 +8212,7 @@ SQLITE_API int sqlite3_vfs_unregister(sqlite3_vfs*);
 ** ^The sqlite3_mutex_alloc() routine allocates a new
 ** mutex and returns a pointer to it. ^The sqlite3_mutex_alloc()
 ** routine returns NULL if it is unable to allocate the requested
-** mutex.  The argument to sqlite3_mutex_alloc() must one of these
+** mutex.  The argument to sqlite3_mutex_alloc() must be one of these
 ** integer constants:
 **
 ** <ul>
@@ -8445,7 +8445,7 @@ SQLITE_API int sqlite3_mutex_notheld(sqlite3_mutex*);
 ** CAPI3REF: Retrieve the mutex for a database connection
 ** METHOD: sqlite3
 **
-** ^This interface returns a pointer the [sqlite3_mutex] object that
+** ^This interface returns a pointer to the [sqlite3_mutex] object that
 ** serializes access to the [database connection] given in the argument
 ** when the [threading mode] is Serialized.
 ** ^If the [threading mode] is Single-thread or Multi-thread then this
@@ -8568,7 +8568,7 @@ SQLITE_API int sqlite3_test_control(int op, ...);
 ** CAPI3REF: SQL Keyword Checking
 **
 ** These routines provide access to the set of SQL language keywords
-** recognized by SQLite.  Applications can uses these routines to determine
+** recognized by SQLite.  Applications can use these routines to determine
 ** whether or not a specific identifier needs to be escaped (for example,
 ** by enclosing in double-quotes) so as not to confuse the parser.
 **
@@ -8736,7 +8736,7 @@ SQLITE_API void sqlite3_str_reset(sqlite3_str*);
 ** content of the dynamic string under construction in X.  The value
 ** returned by [sqlite3_str_value(X)] is managed by the sqlite3_str object X
 ** and might be freed or altered by any subsequent method on the same
-** [sqlite3_str] object.  Applications must not used the pointer returned
+** [sqlite3_str] object.  Applications must not use the pointer returned by
 ** [sqlite3_str_value(X)] after any subsequent method call on the same
 ** object.  ^Applications may change the content of the string returned
 ** by [sqlite3_str_value(X)] as long as they do not write into any bytes
@@ -8822,7 +8822,7 @@ SQLITE_API int sqlite3_status64(
 ** allocation which could not be satisfied by the [SQLITE_CONFIG_PAGECACHE]
 ** buffer and where forced to overflow to [sqlite3_malloc()].  The
 ** returned value includes allocations that overflowed because they
-** where too large (they were larger than the "sz" parameter to
+** were too large (they were larger than the "sz" parameter to
 ** [SQLITE_CONFIG_PAGECACHE]) and allocations that overflowed because
 ** no space was left in the page cache.</dd>)^
 **
@@ -8906,28 +8906,29 @@ SQLITE_API int sqlite3_db_status(sqlite3*, int op, int *pCur, int *pHiwtr, int r
 ** [[SQLITE_DBSTATUS_LOOKASIDE_HIT]] ^(<dt>SQLITE_DBSTATUS_LOOKASIDE_HIT</dt>
 ** <dd>This parameter returns the number of malloc attempts that were
 ** satisfied using lookaside memory. Only the high-water value is meaningful;
-** the current value is always zero.)^
+** the current value is always zero.</dd>)^
 **
 ** [[SQLITE_DBSTATUS_LOOKASIDE_MISS_SIZE]]
 ** ^(<dt>SQLITE_DBSTATUS_LOOKASIDE_MISS_SIZE</dt>
-** <dd>This parameter returns the number malloc attempts that might have
+** <dd>This parameter returns the number of malloc attempts that might have
 ** been satisfied using lookaside memory but failed due to the amount of
 ** memory requested being larger than the lookaside slot size.
 ** Only the high-water value is meaningful;
-** the current value is always zero.)^
+** the current value is always zero.</dd>)^
 **
 ** [[SQLITE_DBSTATUS_LOOKASIDE_MISS_FULL]]
 ** ^(<dt>SQLITE_DBSTATUS_LOOKASIDE_MISS_FULL</dt>
-** <dd>This parameter returns the number malloc attempts that might have
+** <dd>This parameter returns the number of malloc attempts that might have
 ** been satisfied using lookaside memory but failed due to all lookaside
 ** memory already being in use.
 ** Only the high-water value is meaningful;
-** the current value is always zero.)^
+** the current value is always zero.</dd>)^
 **
 ** [[SQLITE_DBSTATUS_CACHE_USED]] ^(<dt>SQLITE_DBSTATUS_CACHE_USED</dt>
 ** <dd>This parameter returns the approximate number of bytes of heap
 ** memory used by all pager caches associated with the database connection.)^
 ** ^The highwater mark associated with SQLITE_DBSTATUS_CACHE_USED is always 0.
+** </dd>
 **
 ** [[SQLITE_DBSTATUS_CACHE_USED_SHARED]]
 ** ^(<dt>SQLITE_DBSTATUS_CACHE_USED_SHARED</dt>
@@ -8936,10 +8937,10 @@ SQLITE_API int sqlite3_db_status(sqlite3*, int op, int *pCur, int *pHiwtr, int r
 ** memory used by that pager cache is divided evenly between the attached
 ** connections.)^  In other words, if none of the pager caches associated
 ** with the database connection are shared, this request returns the same
-** value as DBSTATUS_CACHE_USED. Or, if one or more or the pager caches are
+** value as DBSTATUS_CACHE_USED. Or, if one or more of the pager caches are
 ** shared, the value returned by this call will be smaller than that returned
 ** by DBSTATUS_CACHE_USED. ^The highwater mark associated with
-** SQLITE_DBSTATUS_CACHE_USED_SHARED is always 0.
+** SQLITE_DBSTATUS_CACHE_USED_SHARED is always 0.</dd>
 **
 ** [[SQLITE_DBSTATUS_SCHEMA_USED]] ^(<dt>SQLITE_DBSTATUS_SCHEMA_USED</dt>
 ** <dd>This parameter returns the approximate number of bytes of heap
@@ -8949,6 +8950,7 @@ SQLITE_API int sqlite3_db_status(sqlite3*, int op, int *pCur, int *pHiwtr, int r
 ** schema memory is shared with other database connections due to
 ** [shared cache mode] being enabled.
 ** ^The highwater mark associated with SQLITE_DBSTATUS_SCHEMA_USED is always 0.
+** </dd>
 **
 ** [[SQLITE_DBSTATUS_STMT_USED]] ^(<dt>SQLITE_DBSTATUS_STMT_USED</dt>
 ** <dd>This parameter returns the approximate number of bytes of heap
@@ -8985,7 +8987,7 @@ SQLITE_API int sqlite3_db_status(sqlite3*, int op, int *pCur, int *pHiwtr, int r
 ** been written to disk in the middle of a transaction due to the page
 ** cache overflowing. Transactions are more efficient if they are written
 ** to disk all at once. When pages spill mid-transaction, that introduces
-** additional overhead. This parameter can be used help identify
+** additional overhead. This parameter can be used to help identify
 ** inefficiencies that can be resolved by increasing the cache size.
 ** </dd>
 **
@@ -9465,7 +9467,7 @@ typedef struct sqlite3_backup sqlite3_backup;
 ** external process or via a database connection other than the one being
 ** used by the backup operation, then the backup will be automatically
 ** restarted by the next call to sqlite3_backup_step(). ^If the source
-** database is modified by the using the same database connection as is used
+** database is modified by using the same database connection as is used
 ** by the backup operation, then the backup database is automatically
 ** updated at the same time.
 **
@@ -9482,7 +9484,7 @@ typedef struct sqlite3_backup sqlite3_backup;
 ** and may not be used following a call to sqlite3_backup_finish().
 **
 ** ^The value returned by sqlite3_backup_finish is [SQLITE_OK] if no
-** sqlite3_backup_step() errors occurred, regardless or whether or not
+** sqlite3_backup_step() errors occurred, regardless of whether or not
 ** sqlite3_backup_step() completed.
 ** ^If an out-of-memory condition or IO error occurred during any prior
 ** sqlite3_backup_step() call on the same [sqlite3_backup] object, then
@@ -10552,7 +10554,7 @@ SQLITE_API void sqlite3_stmt_scanstatus_reset(sqlite3_stmt*);
 ** METHOD: sqlite3
 **
 ** ^If a write-transaction is open on [database connection] D when the
-** [sqlite3_db_cacheflush(D)] interface invoked, any dirty
+** [sqlite3_db_cacheflush(D)] interface is invoked, any dirty
 ** pages in the pager-cache that are not currently in use are written out
 ** to disk. A dirty page may be in use if a database cursor created by an
 ** active SQL statement is reading from it, or if it is page 1 of a database

Telegram/SourceFiles/ayu/ui/components/icon_picker.cpp

@@ -37,6 +37,7 @@ const QVector<QString> icons{
 	AyuAssets::CHIBI2_ICON,
 	AyuAssets::EXTERA2_ICON,
 };
+std::unordered_map<QString, QImage> cachedIcons;
 
 const auto rows = static_cast<int>(icons.size()) / 4 + std::min(1, static_cast<int>(icons.size()) % 4);
 
@@ -83,6 +84,9 @@ IconPicker::IconPicker(QWidget *parent)
 	setMinimumSize(st::boxWidth, (st::cpIconSize + st::cpPadding) * rows - st::cpPadding);
 }
 
+IconPicker::~IconPicker() {
+	cachedIcons.clear();
+}
 void IconPicker::paintEvent(QPaintEvent *e) {
 	Painter p(this);
 	PainterHighQualityEnabler hq(p);
@@ -98,10 +102,16 @@ void IconPicker::paintEvent(QPaintEvent *e) {
 			if (iconName.isEmpty()) {
 				continue;
 			}
-
-			auto icon = AyuAssets::loadPreview(iconName)
-				.scaled(st::cpIconSize, st::cpIconSize, Qt::KeepAspectRatio, Qt::SmoothTransformation);
-
+			QImage icon;
+			if (const auto cached = cachedIcons.find(iconName); cached != cachedIcons.end()) {
+				icon = cached->second;
+			} else {
+				icon = cachedIcons[iconName] = AyuAssets::loadPreview(iconName).scaled(
+					st::cpIconSize,
+					st::cpIconSize,
+					Qt::KeepAspectRatio,
+					Qt::SmoothTransformation);
+			}
 			auto opacity = 0.0f;
 			if (iconName == wasSelected) {
 				opacity = 1.0f - animation.value(1.0f);

Telegram/SourceFiles/ayu/ui/components/icon_picker.h

@@ -13,6 +13,7 @@ class IconPicker : public Ui::RpWidget
 {
 public:
 	IconPicker(QWidget *parent);
+	~IconPicker();
 
 protected:
 	void paintEvent(QPaintEvent *e) override;

Telegram/SourceFiles/ayu/ui/message_history/history_item.cpp

@@ -9,6 +9,7 @@
 
 #include "api/api_chat_participants.h"
 #include "api/api_text_entities.h"
+#include "ayu/utils/ayu_mapper.h"
 #include "ayu/ui/message_history/history_inner.h"
 #include "base/unixtime.h"
 #include "core/application.h"
@@ -118,7 +119,10 @@ void GenerateItems(
 	};
 
 	const auto text = QString::fromStdString(message.text);
-	addSimpleTextMessage(Ui::Text::WithEntities(text));
+	auto textAndEntities = Ui::Text::WithEntities(text);
+	const auto entities = AyuMapper::deserializeTextWithEntities(message.textEntities);
+	textAndEntities.entities = Api::EntitiesFromMTP(&history->session(), entities.v);
+	addSimpleTextMessage(std::move(textAndEntities));
 }
 
 } // namespace MessageHistory

Telegram/SourceFiles/ayu/ui/settings/settings_ayu.cpp

@@ -855,12 +855,12 @@ void SetupQoLToggles(not_null<Ui::VerticalLayout*> container) {
 		tr::ayu_HideChannelReactions(),
 		st::settingsButtonNoIcon
 	)->toggleOn(
-		rpl::single(!settings->hideChannelReactions)
+		rpl::single(!settings->showChannelReactions)
 	)->toggledValue(
 	) | rpl::filter(
 		[=](bool enabled)
 		{
-			return (!enabled != settings->hideChannelReactions);
+			return (!enabled != settings->showChannelReactions);
 		}) | start_with_next(
 		[=](bool enabled)
 		{
@@ -874,12 +874,12 @@ void SetupQoLToggles(not_null<Ui::VerticalLayout*> container) {
 		tr::ayu_HideGroupReactions(),
 		st::settingsButtonNoIcon
 	)->toggleOn(
-		rpl::single(!settings->hideGroupReactions)
+		rpl::single(!settings->showGroupReactions)
 	)->toggledValue(
 	) | rpl::filter(
 		[=](bool enabled)
 		{
-			return (!enabled != settings->hideGroupReactions);
+			return (!enabled != settings->showGroupReactions);
 		}) | start_with_next(
 		[=](bool enabled)
 		{

Telegram/SourceFiles/ayu/utils/ayu_mapper.cpp

@@ -6,9 +6,14 @@
 // Copyright @Radolyn, 2025
 #include "ayu_mapper.h"
 
+#include "apiwrap.h"
+#include "api/api_text_entities.h"
 #include "history/history.h"
 #include "history/history_item.h"
 #include "history/history_item_components.h"
+#include "main/main_session.h"
+#include "mtproto/connection_abstract.h"
+#include "mtproto/details/mtproto_dump_to_text.h"
 
 namespace AyuMapper {
 
@@ -39,17 +44,56 @@ constexpr auto kMessageFlagHasTTL = 0x02000000;
 constexpr auto kMessageFlagInvertMedia = 0x08000000;
 constexpr auto kMessageFlagHasSavedPeer = 0x10000000;
 
+template<typename MTPObject>
+std::vector<char> serializeObject(MTPObject object) {
+	mtpBuffer buffer;
+	object.write(buffer);
+
+	const auto from = reinterpret_cast<char*>(buffer.data());
+	const auto end = from + buffer.size() * sizeof(mtpPrime);
+
+	std::vector<char> entities(from, end);
+	return entities;
+}
+
+template<typename MTPObject>
+MTPObject deserializeObject(std::vector<char> serialized) {
+	gsl::span<char> span(serialized.data(), serialized.size());
+
+	auto from = reinterpret_cast<const mtpPrime*>(span.data());
+	const auto end = from + span.size() / sizeof(mtpPrime);
+
+	MTPObject data;
+	if (!data.read(from, end)) {
+		LOG(("AyuMapper: Failed to deserialize object"));
+	}
+	return data;
+}
+
 std::pair<std::string, std::vector<char>> serializeTextWithEntities(not_null<HistoryItem*> item) {
 	if (item->emptyText()) {
 		return std::make_pair("", std::vector<char>());
 	}
-
 	auto textWithEntities = item->originalText();
-	std::vector<char> entities; // todo: implement writing to buffer
+
+
+	std::vector<char> entities;
+	if (!textWithEntities.entities.empty()) {
+		const auto mtpEntities = Api::EntitiesToMTP(
+			&item->history()->session(),
+			textWithEntities.entities,
+			Api::ConvertOption::WithLocal);
+
+		entities = serializeObject(mtpEntities);
+	}
 
 	return std::make_pair(textWithEntities.text.toStdString(), entities);
 }
 
+MTPVector<MTPMessageEntity> deserializeTextWithEntities(std::vector<char> serialized) {
+	return deserializeObject<MTPVector<MTPMessageEntity>>(serialized);
+}
+
 int mapItemFlagsToMTPFlags(not_null<HistoryItem*> item) {
 	int flags = 0;
 

Telegram/SourceFiles/ayu/utils/ayu_mapper.h

@@ -8,7 +8,14 @@
 
 namespace AyuMapper {
 
+template<typename MTPObject>
+[[nodiscard]] MTPObject deserializeObject(std::vector<char> serialized);
+
+template<typename MTPObject>
+[[nodiscard]] std::vector<char> serializeObject(MTPObject object);
+
 std::pair<std::string, std::vector<char>> serializeTextWithEntities(not_null<HistoryItem*> item);
+[[nodiscard]] MTPVector<MTPMessageEntity> deserializeTextWithEntities(std::vector<char> serialized);
 int mapItemFlagsToMTPFlags(not_null<HistoryItem*> item);
 
 } // namespace AyuMapper

Telegram/SourceFiles/ayu/utils/rc_manager.cpp

@@ -14,19 +14,21 @@
 
 std::unordered_set<ID> default_developers = {
 	963080346, 1282540315, 1374434073, 168769611,
-	1773117711, 5330087923, 666154369, 139303278,
+	1773117711, 5330087923, 139303278, 1752394339,
 	668557709, 1348136086, 6288255532, 7453676178,
+	880708503, 2135966128, 7818249287,
 	// -------------------------------------------
 	778327202, 238292700, 1795176335, 6247153446,
-	1752394339, 7745305003, 1183312839, 497855299,
-	623054735
+	1183312839, 497855299
 };
 
 std::unordered_set<ID> default_channels = {
 	1233768168, 1524581881, 1571726392, 1632728092,
 	1172503281, 1877362358, 1905581924, 1794457129,
 	1434550607, 1947958814, 1815864846, 2130395384,
-	1976430343, 1754537498, 1725670701,
+	1976430343, 1754537498, 1725670701, 2401498637,
+	2685666919, 2562664432, 2564770112, 2331068091,
+	1559501352, 2641258043
 };
 
 void RCManager::start() {

Telegram/SourceFiles/ayu/utils/telegram_helpers.cpp

@@ -320,6 +320,22 @@ QString formatDateTime(const QDateTime &date) {
 	return datePart + getLocalizedAt() + timePart;
 }
 
+QString formatMessageTime(const QTime &time) {
+	const auto &settings = AyuSettings::getInstance();
+
+	const auto format =
+		settings.showMessageSeconds
+			? (QLocale().timeFormat(QLocale::ShortFormat).contains("AP")
+				   ? "h:mm:ss AP"
+				   : "HH:mm:ss")
+			: QLocale().timeFormat(QLocale::ShortFormat);
+
+	return QLocale().toString(
+		time,
+		format
+	);
+}
+
 int getMediaSizeBytes(not_null<HistoryItem*> message) {
 	if (!message->media()) {
 		return -1;

Telegram/SourceFiles/ayu/utils/telegram_helpers.h

@@ -37,6 +37,7 @@ void readHistory(not_null<HistoryItem*> message);
 
 QString formatTTL(int time);
 QString formatDateTime(const QDateTime &date);
+QString formatMessageTime(const QTime &time);
 
 QString getDCName(int dc);
 

Telegram/SourceFiles/boxes/connection_box.cpp

@@ -111,6 +111,13 @@ void AddProxyFromClipboard(
 		QGuiApplication::clipboard()->text());
 	const auto isSingle = maybeUrls.size() == 1;
 
+	enum class Result {
+		Success,
+		Failed,
+		Unsupported,
+		Invalid,
+	};
+
 	const auto proceedUrl = [=](const auto &local) {
 		const auto command = base::StringViewMid(
 			local,
@@ -146,6 +153,11 @@ void AddProxyFromClipboard(
 					match->captured(1),
 					qthelp::UrlParamNameTransform::ToLower);
 				const auto proxy = ProxyDataFromFields(type, fields);
+				if (!proxy) {
+					return (proxy.status() == ProxyData::Status::Unsupported)
+						? Result::Unsupported
+						: Result::Invalid;
+				}
 				const auto contains = controller->contains(proxy);
 				const auto toast = (contains
 					? tr::lng_proxy_add_from_clipboard_existing_toast
@@ -158,19 +170,29 @@ void AddProxyFromClipboard(
 				}
 				break;
 			}
-			return true;
+			return Result::Success;
 		}
-		return false;
+		return Result::Failed;
 	};
 
-	auto success = false;
+	auto success = Result::Failed;
 	for (const auto &maybeUrl : maybeUrls) {
-		success |= proceedUrl(Core::TryConvertUrlToLocal(maybeUrl));
+		const auto result = proceedUrl(Core::TryConvertUrlToLocal(maybeUrl));
+		if (success != Result::Success) {
+			success = result;
+		}
 	}
 
-	if (!success) {
-		show->showToast(
-			tr::lng_proxy_add_from_clipboard_failed_toast(tr::now));
+	if (success != Result::Success) {
+		if (success == Result::Failed) {
+			show->showToast(
+				tr::lng_proxy_add_from_clipboard_failed_toast(tr::now));
+		} else {
+			show->showBox(Ui::MakeInformBox(
+				(success == Result::Unsupported
+					? tr::lng_proxy_unsupported(tr::now)
+					: tr::lng_proxy_invalid(tr::now))));
+		}
 	}
 }
 

Telegram/SourceFiles/boxes/moderate_messages_box.cpp

@@ -361,9 +361,14 @@ void CreateModerateMessagesBox(
 		});
 	}
 	if (allCanBan) {
-		auto ownedWrap = object_ptr<Ui::SlideWrap<Ui::VerticalLayout>>(
-			inner,
-			object_ptr<Ui::VerticalLayout>(inner));
+		const auto peer = items.front()->history()->peer;
+		auto ownedWrap = peer->isMonoforum()
+			? nullptr
+			: object_ptr<Ui::SlideWrap<Ui::VerticalLayout>>(
+				inner,
+				object_ptr<Ui::VerticalLayout>(inner));
+		auto computeRestrictions = Fn<ChatRestrictions()>();
+		const auto wrap = ownedWrap.data();
 
 		Ui::AddSkip(inner);
 		Ui::AddSkip(inner);
@@ -371,7 +376,9 @@ void CreateModerateMessagesBox(
 			object_ptr<Ui::Checkbox>(
 				box,
 				rpl::conditional(
-					ownedWrap->toggledValue(),
+					(ownedWrap
+						? ownedWrap->toggledValue()
+						: rpl::single(false) | rpl::type_erased()),
 					tr::lng_restrict_user(
 						lt_count,
 						rpl::single(participants.size()) | tr::to_count()),
@@ -390,136 +397,141 @@ void CreateModerateMessagesBox(
 		Ui::AddSkip(inner);
 		Ui::AddSkip(inner);
 
-		const auto wrap = inner->add(std::move(ownedWrap));
-		const auto container = wrap->entity();
-		wrap->toggle(false, anim::type::instant);
+		if (ownedWrap) {
+			inner->add(std::move(ownedWrap));
 
-		const auto session = &participants.front()->session();
-		const auto emojiMargin = QMargins(
-			-st::moderateBoxExpandInnerSkip,
-			-st::moderateBoxExpandInnerSkip / 2,
-			0,
-			0);
-		const auto emojiUp = Ui::Text::SingleCustomEmoji(
-			session->data().customEmojiManager().registerInternalEmoji(
-				st::moderateBoxExpandIcon,
-				emojiMargin,
-				false));
-		const auto emojiDown = Ui::Text::SingleCustomEmoji(
-			session->data().customEmojiManager().registerInternalEmoji(
-				st::moderateBoxExpandIconDown,
-				emojiMargin,
-				false));
+			const auto container = wrap->entity();
+			wrap->toggle(false, anim::type::instant);
 
-		auto label = object_ptr<Ui::FlatLabel>(
-			inner,
-			QString(),
-			st::moderateBoxDividerLabel);
-		const auto raw = label.data();
+			const auto session = &participants.front()->session();
+			const auto emojiMargin = QMargins(
+				-st::moderateBoxExpandInnerSkip,
+				-st::moderateBoxExpandInnerSkip / 2,
+				0,
+				0);
+			const auto emojiUp = Ui::Text::SingleCustomEmoji(
+				session->data().customEmojiManager().registerInternalEmoji(
+					st::moderateBoxExpandIcon,
+					emojiMargin,
+					false));
+			const auto emojiDown = Ui::Text::SingleCustomEmoji(
+				session->data().customEmojiManager().registerInternalEmoji(
+					st::moderateBoxExpandIconDown,
+					emojiMargin,
+					false));
 
-		auto &lifetime = wrap->lifetime();
-		const auto scrollLifetime = lifetime.make_state<rpl::lifetime>();
-		label->setClickHandlerFilter([=](
-				const ClickHandlerPtr &handler,
-				Qt::MouseButton button) {
-			if (button != Qt::LeftButton) {
-				return false;
-			}
-			wrap->toggle(!wrap->toggled(), anim::type::normal);
-			{
-				inner->heightValue() | rpl::start_with_next([=] {
-					if (!wrap->animating()) {
-						scrollLifetime->destroy();
-						Ui::PostponeCall(crl::guard(box, [=] {
+			auto label = object_ptr<Ui::FlatLabel>(
+				inner,
+				QString(),
+				st::moderateBoxDividerLabel);
+			const auto raw = label.data();
+
+			auto &lifetime = wrap->lifetime();
+			const auto scrollLifetime = lifetime.make_state<rpl::lifetime>();
+			label->setClickHandlerFilter([=](
+					const ClickHandlerPtr &handler,
+					Qt::MouseButton button) {
+				if (button != Qt::LeftButton) {
+					return false;
+				}
+				wrap->toggle(!wrap->toggled(), anim::type::normal);
+				{
+					inner->heightValue() | rpl::start_with_next([=] {
+						if (!wrap->animating()) {
+							scrollLifetime->destroy();
+							Ui::PostponeCall(crl::guard(box, [=] {
+								box->scrollToY(std::numeric_limits<int>::max());
+							}));
+						} else {
 							box->scrollToY(std::numeric_limits<int>::max());
-						}));
-					} else {
-						box->scrollToY(std::numeric_limits<int>::max());
-					}
-				}, *scrollLifetime);
-			}
-			return true;
-		});
-		wrap->toggledValue(
-		) | rpl::map([isSingle, emojiUp, emojiDown](bool toggled) {
-			return ((toggled && isSingle)
-				? tr::lng_restrict_user_part
-				: (toggled && !isSingle)
-				? tr::lng_restrict_users_part
-				: isSingle
-				? tr::lng_restrict_user_full
-				: tr::lng_restrict_users_full)(
-					lt_emoji,
-					rpl::single(toggled ? emojiUp : emojiDown),
-					Ui::Text::WithEntities);
-		}) | rpl::flatten_latest(
-		) | rpl::start_with_next([=](const TextWithEntities &text) {
-			raw->setMarkedText(
-				Ui::Text::Link(text, u"internal:"_q),
-				Core::TextContext({ .session = session }));
-		}, label->lifetime());
+						}
+					}, *scrollLifetime);
+				}
+				return true;
+			});
+			wrap->toggledValue(
+			) | rpl::map([isSingle, emojiUp, emojiDown](bool toggled) {
+				return ((toggled && isSingle)
+					? tr::lng_restrict_user_part
+					: (toggled && !isSingle)
+					? tr::lng_restrict_users_part
+					: isSingle
+					? tr::lng_restrict_user_full
+					: tr::lng_restrict_users_full)(
+						lt_emoji,
+						rpl::single(toggled ? emojiUp : emojiDown),
+						Ui::Text::WithEntities);
+			}) | rpl::flatten_latest(
+			) | rpl::start_with_next([=](const TextWithEntities &text) {
+				raw->setMarkedText(
+					Ui::Text::Link(text, u"internal:"_q),
+					Core::TextContext({ .session = session }));
+			}, label->lifetime());
 
-		Ui::AddSkip(inner);
-		inner->add(object_ptr<Ui::DividerLabel>(
-			inner,
-			std::move(label),
-			st::defaultBoxDividerLabelPadding,
-			RectPart::Top | RectPart::Bottom));
+			Ui::AddSkip(inner);
+			inner->add(object_ptr<Ui::DividerLabel>(
+				inner,
+				std::move(label),
+				st::defaultBoxDividerLabelPadding,
+				RectPart::Top | RectPart::Bottom));
 
-		using Flag = ChatRestriction;
-		using Flags = ChatRestrictions;
-		const auto peer = items.front()->history()->peer;
-		const auto chat = peer->asChat();
-		const auto channel = peer->asChannel();
-		const auto defaultRestrictions = chat
-			? chat->defaultRestrictions()
-			: channel->defaultRestrictions();
-		const auto prepareFlags = FixDependentRestrictions(
-			defaultRestrictions
-			| ((channel && channel->isPublic())
-				? (Flag::ChangeInfo | Flag::PinMessages)
-				: Flags(0)));
-		const auto disabledMessages = [&] {
-			auto result = base::flat_map<Flags, QString>();
-			{
-				const auto disabled = FixDependentRestrictions(
-					defaultRestrictions
-					| ((channel && channel->isPublic())
-						? (Flag::ChangeInfo | Flag::PinMessages)
-						: Flags(0)));
-				result.emplace(
-					disabled,
-					tr::lng_rights_restriction_for_all(tr::now));
-			}
-			return result;
-		}();
+			using Flag = ChatRestriction;
+			using Flags = ChatRestrictions;
+			const auto chat = peer->asChat();
+			const auto channel = peer->asChannel();
+			const auto defaultRestrictions = chat
+				? chat->defaultRestrictions()
+				: channel->defaultRestrictions();
+			const auto prepareFlags = FixDependentRestrictions(
+				defaultRestrictions
+				| ((channel && channel->isPublic())
+					? (Flag::ChangeInfo | Flag::PinMessages)
+					: Flags(0)));
+			const auto disabledMessages = [&] {
+				auto result = base::flat_map<Flags, QString>();
+				{
+					const auto disabled = FixDependentRestrictions(
+						defaultRestrictions
+						| ((channel && channel->isPublic())
+							? (Flag::ChangeInfo | Flag::PinMessages)
+							: Flags(0)));
+					result.emplace(
+						disabled,
+						tr::lng_rights_restriction_for_all(tr::now));
+				}
+				return result;
+			}();
 
-		Ui::AddSubsectionTitle(
-			inner,
-			rpl::conditional(
-				rpl::single(isSingle),
-				tr::lng_restrict_users_part_single_header(),
-				tr::lng_restrict_users_part_header(
-					lt_count,
-					rpl::single(participants.size()) | tr::to_count())));
-		auto [checkboxes, getRestrictions, changes] = CreateEditRestrictions(
-			box,
-			prepareFlags,
-			disabledMessages,
-			{ .isForum = peer->isForum() });
-		std::move(changes) | rpl::start_with_next([=] {
-			ban->setChecked(true);
-		}, ban->lifetime());
-		Ui::AddSkip(container);
-		Ui::AddDivider(container);
-		Ui::AddSkip(container);
-		container->add(std::move(checkboxes));
+			Ui::AddSubsectionTitle(
+				inner,
+				rpl::conditional(
+					rpl::single(isSingle),
+					tr::lng_restrict_users_part_single_header(),
+					tr::lng_restrict_users_part_header(
+						lt_count,
+						rpl::single(participants.size()) | tr::to_count())));
+			auto [checkboxes, getRestrictions, changes] = CreateEditRestrictions(
+				box,
+				prepareFlags,
+				disabledMessages,
+				{ .isForum = peer->isForum() });
+			computeRestrictions = getRestrictions;
+			std::move(changes) | rpl::start_with_next([=] {
+				ban->setChecked(true);
+			}, ban->lifetime());
+			Ui::AddSkip(container);
+			Ui::AddDivider(container);
+			Ui::AddSkip(container);
+			container->add(std::move(checkboxes));
+		}
 
 		// Handle confirmation manually.
 		confirms->events() | rpl::start_with_next([=] {
 			if (ban->checked() && controller->collectRequests) {
-				const auto kick = !wrap->toggled();
-				const auto restrictions = getRestrictions();
+				const auto kick = !wrap || !wrap->toggled();
+				const auto restrictions = computeRestrictions
+					? computeRestrictions()
+					: ChatRestrictions();
 				const auto request = [=](
 						not_null<PeerData*> peer,
 						not_null<ChannelData*> channel) {
@@ -532,10 +544,15 @@ void CreateModerateMessagesBox(
 							nullptr,
 							nullptr);
 					} else {
-						channel->session().api().chatParticipants().kick(
-							channel,
-							peer,
-							{ channel->restrictions(), 0 });
+						const auto block = channel->isMonoforum()
+							? channel->monoforumBroadcast()
+							: channel.get();
+						if (block) {
+							block->session().api().chatParticipants().kick(
+								block,
+								peer,
+								{ block->restrictions(), 0 });
+						}
 					}
 				};
 				sequentiallyRequest(request, controller->collectRequests());

Telegram/SourceFiles/boxes/star_gift_box.cpp

@@ -127,6 +127,7 @@ constexpr auto kUpgradeDoneToastDuration = 4 * crl::time(1000);
 constexpr auto kGiftsPreloadTimeout = 3 * crl::time(1000);
 constexpr auto kResaleGiftsPerPage = 50;
 constexpr auto kFiltersCount = 4;
+constexpr auto kResellPriceCacheLifetime = 60 * crl::time(1000);
 
 using namespace HistoryView;
 using namespace Info::PeerGifts;
@@ -220,6 +221,33 @@ struct GiftDetails {
 	bool byStars = false;
 };
 
+struct SessionResalePrices {
+	explicit SessionResalePrices(not_null<Main::Session*> session)
+	: api(std::make_unique<Api::PremiumGiftCodeOptions>(session->user())) {
+	}
+
+	std::unique_ptr<Api::PremiumGiftCodeOptions> api;
+	base::flat_map<QString, int> prices;
+	std::vector<Fn<void()>> waiting;
+	rpl::lifetime requestLifetime;
+	crl::time lastReceived = 0;
+};
+
+[[nodiscard]] not_null<SessionResalePrices*> ResalePrices(
+		not_null<Main::Session*> session) {
+	static auto result = base::flat_map<
+		not_null<Main::Session*>,
+		std::unique_ptr<SessionResalePrices>>();
+	if (const auto i = result.find(session); i != end(result)) {
+		return i->second.get();
+	}
+	const auto i = result.emplace(
+		session,
+		std::make_unique<SessionResalePrices>(session)).first;
+	session->lifetime().add([session] { result.remove(session); });
+	return i->second.get();
+}
+
 class PeerRow final : public PeerListRow {
 public:
 	using PeerListRow::PeerListRow;
@@ -4381,6 +4409,55 @@ void ShowUniqueGiftWearBox(
 	}));
 }
 
+void PreloadUniqueGiftResellPrices(not_null<Main::Session*> session) {
+	const auto entry = ResalePrices(session);
+	const auto now = crl::now();
+	const auto makeRequest = entry->prices.empty()
+		|| (now - entry->lastReceived >= kResellPriceCacheLifetime);
+	if (!makeRequest || entry->requestLifetime) {
+		return;
+	}
+	const auto finish = [=] {
+		entry->requestLifetime.destroy();
+		entry->lastReceived = crl::now();
+		for (const auto &callback : base::take(entry->waiting)) {
+			callback();
+		}
+	};
+	entry->requestLifetime = entry->api->requestStarGifts(
+	) | rpl::start_with_error_done(finish, [=] {
+		const auto &gifts = entry->api->starGifts();
+		entry->prices.reserve(gifts.size());
+		for (auto &gift : gifts) {
+			if (!gift.resellTitle.isEmpty() && gift.starsResellMin > 0) {
+				entry->prices[gift.resellTitle] = gift.starsResellMin;
+			}
+		}
+		finish();
+	});
+}
+
+void InvokeWithUniqueGiftResellPrice(
+		not_null<Main::Session*> session,
+		const QString &title,
+		Fn<void(int)> callback) {
+	PreloadUniqueGiftResellPrices(session);
+
+	const auto finish = [=] {
+		const auto entry = ResalePrices(session);
+		Assert(entry->lastReceived != 0);
+
+		const auto i = entry->prices.find(title);
+		callback((i != end(entry->prices)) ? i->second : 0);
+	};
+	const auto entry = ResalePrices(session);
+	if (entry->lastReceived) {
+		finish();
+	} else {
+		entry->waiting.push_back(finish);
+	}
+}
+
 void UpdateGiftSellPrice(
 		std::shared_ptr<ChatHelpers::Show> show,
 		std::shared_ptr<Data::UniqueGift> unique,
@@ -4422,6 +4499,132 @@ void UpdateGiftSellPrice(
 	}).send();
 }
 
+void UniqueGiftSellBox(
+		not_null<Ui::GenericBox*> box,
+		std::shared_ptr<ChatHelpers::Show> show,
+		std::shared_ptr<Data::UniqueGift> unique,
+		Data::SavedStarGiftId savedId,
+		int price,
+		Settings::GiftWearBoxStyleOverride st) {
+	box->setTitle(tr::lng_gift_sell_title());
+	box->setStyle(st.box ? *st.box : st::upgradeGiftBox);
+	box->setWidth(st::boxWideWidth);
+
+	box->addTopButton(st.close ? *st.close : st::boxTitleClose, [=] {
+		box->closeBox();
+	});
+	const auto priceNow = unique->starsForResale;
+	const auto name = Data::UniqueGiftName(*unique);
+	const auto slug = unique->slug;
+
+	const auto session = &show->session();
+	AddSubsectionTitle(
+		box->verticalLayout(),
+		tr::lng_gift_sell_placeholder(),
+		(st::boxRowPadding - QMargins(
+			st::defaultSubsectionTitlePadding.left(),
+			0,
+			st::defaultSubsectionTitlePadding.right(),
+			st::defaultSubsectionTitlePadding.bottom())));
+	const auto &appConfig = session->appConfig();
+	const auto limit = appConfig.giftResalePriceMax();
+	const auto minimal = appConfig.giftResalePriceMin();
+	const auto thousandths = appConfig.giftResaleReceiveThousandths();
+	const auto wrap = box->addRow(object_ptr<Ui::FixedHeightWidget>(
+		box,
+		st::editTagField.heightMin));
+	auto owned = object_ptr<Ui::NumberInput>(
+		wrap,
+		st::editTagField,
+		rpl::single(QString()),
+		QString::number(priceNow ? priceNow : price ? price : minimal),
+		limit);
+	const auto field = owned.data();
+	wrap->widthValue() | rpl::start_with_next([=](int width) {
+		field->move(0, 0);
+		field->resize(width, field->height());
+		wrap->resize(width, field->height());
+	}, wrap->lifetime());
+	field->paintRequest() | rpl::start_with_next([=](QRect clip) {
+		auto p = QPainter(field);
+		st::paidStarIcon.paint(p, 0, st::paidStarIconTop, field->width());
+	}, field->lifetime());
+	field->selectAll();
+	box->setFocusCallback([=] {
+		field->setFocusFast();
+	});
+
+	const auto errors = box->lifetime().make_state<
+		rpl::event_stream<>
+	>();
+	auto goods = rpl::merge(
+		rpl::single(rpl::empty) | rpl::map_to(true),
+		base::qt_signal_producer(
+			field,
+			&Ui::NumberInput::changed
+		) | rpl::map_to(true),
+		errors->events() | rpl::map_to(false)
+	) | rpl::start_spawning(box->lifetime());
+	auto text = rpl::duplicate(goods) | rpl::map([=](bool good) {
+		const auto value = field->getLastText().toInt();
+		const auto receive = (int64(value) * thousandths) / 1000;
+		return !good
+			? tr::lng_gift_sell_min_price(
+				tr::now,
+				lt_count,
+				minimal,
+				Ui::Text::RichLangValue)
+			: (value >= minimal)
+			? tr::lng_gift_sell_amount(
+				tr::now,
+				lt_count,
+				receive,
+				Ui::Text::RichLangValue)
+			: tr::lng_gift_sell_about(
+				tr::now,
+				lt_percent,
+				TextWithEntities{ u"%1%"_q.arg(thousandths / 10.) },
+				Ui::Text::RichLangValue);
+	});
+	const auto details = box->addRow(object_ptr<Ui::FlatLabel>(
+		box,
+		std::move(text) | rpl::after_next([=] {
+			box->verticalLayout()->resizeToWidth(box->width());
+		}),
+		st::boxLabel));
+	Ui::AddSkip(box->verticalLayout());
+
+	rpl::duplicate(goods) | rpl::start_with_next([=](bool good) {
+		details->setTextColorOverride(
+			good ? st::windowSubTextFg->c : st::boxTextFgError->c);
+	}, details->lifetime());
+
+	QObject::connect(field, &NumberInput::submitted, [=] {
+		const auto count = field->getLastText().toInt();
+		if (count < minimal) {
+			field->showError();
+			errors->fire({});
+			return;
+		}
+		box->closeBox();
+		UpdateGiftSellPrice(show, unique, savedId, count);
+	});
+	const auto button = box->addButton(priceNow
+		? tr::lng_gift_sell_update()
+		: tr::lng_gift_sell_put(), [=] { field->submitted({}); });
+	rpl::combine(
+		box->widthValue(),
+		button->widthValue()
+	) | rpl::start_with_next([=](int outer, int inner) {
+		const auto padding = st::giftBox.buttonPadding;
+		const auto wanted = outer - padding.left() - padding.right();
+		if (inner != wanted) {
+			button->resizeToWidth(wanted);
+			button->moveToLeft(padding.left(), padding.top());
+		}
+	}, box->lifetime());
+}
+
 void ShowUniqueGiftSellBox(
 		std::shared_ptr<ChatHelpers::Show> show,
 		std::shared_ptr<Data::UniqueGift> unique,
@@ -4430,125 +4633,11 @@ void ShowUniqueGiftSellBox(
 	if (ShowResaleGiftLater(show, unique)) {
 		return;
 	}
-	show->show(Box([=](not_null<Ui::GenericBox*> box) {
-		box->setTitle(tr::lng_gift_sell_title());
-		box->setStyle(st.box ? *st.box : st::upgradeGiftBox);
-		box->setWidth(st::boxWideWidth);
-
-		box->addTopButton(st.close ? *st.close : st::boxTitleClose, [=] {
-			box->closeBox();
-		});
-		const auto priceNow = unique->starsForResale;
-		const auto name = Data::UniqueGiftName(*unique);
-		const auto slug = unique->slug;
-
-		const auto session = &show->session();
-		AddSubsectionTitle(
-			box->verticalLayout(),
-			tr::lng_gift_sell_placeholder(),
-			(st::boxRowPadding - QMargins(
-				st::defaultSubsectionTitlePadding.left(),
-				0,
-				st::defaultSubsectionTitlePadding.right(),
-				st::defaultSubsectionTitlePadding.bottom())));
-		const auto &appConfig = session->appConfig();
-		const auto limit = appConfig.giftResalePriceMax();
-		const auto minimal = appConfig.giftResalePriceMin();
-		const auto thousandths = appConfig.giftResaleReceiveThousandths();
-		const auto wrap = box->addRow(object_ptr<Ui::FixedHeightWidget>(
-			box,
-			st::editTagField.heightMin));
-		auto owned = object_ptr<Ui::NumberInput>(
-			wrap,
-			st::editTagField,
-			rpl::single(QString()),
-			QString::number(priceNow ? priceNow : minimal),
-			limit);
-		const auto field = owned.data();
-		wrap->widthValue() | rpl::start_with_next([=](int width) {
-			field->move(0, 0);
-			field->resize(width, field->height());
-			wrap->resize(width, field->height());
-		}, wrap->lifetime());
-		field->paintRequest() | rpl::start_with_next([=](QRect clip) {
-			auto p = QPainter(field);
-			st::paidStarIcon.paint(p, 0, st::paidStarIconTop, field->width());
-		}, field->lifetime());
-		field->selectAll();
-		box->setFocusCallback([=] {
-			field->setFocusFast();
-		});
-
-		const auto errors = box->lifetime().make_state<
-			rpl::event_stream<>
-		>();
-		auto goods = rpl::merge(
-			rpl::single(rpl::empty) | rpl::map_to(true),
-			base::qt_signal_producer(
-				field,
-				&Ui::NumberInput::changed
-			) | rpl::map_to(true),
-			errors->events() | rpl::map_to(false)
-		) | rpl::start_spawning(box->lifetime());
-		auto text = rpl::duplicate(goods) | rpl::map([=](bool good) {
-			const auto value = field->getLastText().toInt();
-			const auto receive = (int64(value) * thousandths) / 1000;
-			return !good
-				? tr::lng_gift_sell_min_price(
-					tr::now,
-					lt_count,
-					minimal,
-					Ui::Text::RichLangValue)
-				: (value >= minimal)
-				? tr::lng_gift_sell_amount(
-					tr::now,
-					lt_count,
-					receive,
-					Ui::Text::RichLangValue)
-				: tr::lng_gift_sell_about(
-					tr::now,
-					lt_percent,
-					TextWithEntities{ u"%1%"_q.arg(thousandths / 10.) },
-					Ui::Text::RichLangValue);
-		});
-		const auto details = box->addRow(object_ptr<Ui::FlatLabel>(
-			box,
-			std::move(text) | rpl::after_next([=] {
-				box->verticalLayout()->resizeToWidth(box->width());
-			}),
-			st::boxLabel));
-		Ui::AddSkip(box->verticalLayout());
-
-		rpl::duplicate(goods) | rpl::start_with_next([=](bool good) {
-			details->setTextColorOverride(
-				good ? st::windowSubTextFg->c : st::boxTextFgError->c);
-		}, details->lifetime());
-
-		QObject::connect(field, &NumberInput::submitted, [=] {
-			const auto count = field->getLastText().toInt();
-			if (count < minimal) {
-				field->showError();
-				errors->fire({});
-				return;
-			}
-			box->closeBox();
-			UpdateGiftSellPrice(show, unique, savedId, count);
-		});
-		const auto button = box->addButton(priceNow
-			? tr::lng_gift_sell_update()
-			: tr::lng_gift_sell_put(), [=] { field->submitted({}); });
-		rpl::combine(
-			box->widthValue(),
-			button->widthValue()
-		) | rpl::start_with_next([=](int outer, int inner) {
-			const auto padding = st::giftBox.buttonPadding;
-			const auto wanted = outer - padding.left() - padding.right();
-			if (inner != wanted) {
-				button->resizeToWidth(wanted);
-				button->moveToLeft(padding.left(), padding.top());
-			}
-		}, box->lifetime());
-	}));
+	const auto session = &show->session();
+	const auto &title = unique->title;
+	InvokeWithUniqueGiftResellPrice(session, title, [=](int price) {
+		show->show(Box(UniqueGiftSellBox, show, unique, savedId, price, st));
+	});
 }
 
 void GiftReleasedByHandler(not_null<PeerData*> peer) {

Telegram/SourceFiles/boxes/star_gift_box.h

@@ -21,6 +21,7 @@ class SavedStarGiftId;
 } // namespace Data
 
 namespace Main {
+class Session;
 class SessionShow;
 } // namespace Main
 
@@ -71,6 +72,8 @@ void ShowUniqueGiftWearBox(
 	const Data::UniqueGift &gift,
 	Settings::GiftWearBoxStyleOverride st);
 
+void PreloadUniqueGiftResellPrices(not_null<Main::Session*> session);
+
 void UpdateGiftSellPrice(
 	std::shared_ptr<ChatHelpers::Show> show,
 	std::shared_ptr<Data::UniqueGift> unique,

Telegram/SourceFiles/boxes/sticker_set_box.cpp

@@ -768,12 +768,14 @@ void StickerSetBox::updateButtons() {
 					&st::menuIconManage);
 			});
 		}();
-		const auto addPackOwner = [=](const std::shared_ptr<base::unique_qptr<Ui::PopupMenu>> &menu)
+		const auto addPackIdActions = [=](const std::shared_ptr<base::unique_qptr<Ui::PopupMenu>> &menu)
 		{
 			if (type == Data::StickersType::Stickers || type == Data::StickersType::Emoji) {
+				const auto &settings = AyuSettings::getInstance();
 				const auto weak = Ui::MakeWeak(this);
 				const auto session = _session;
-				const auto innerId = _inner->setId() >> 32;
+				const auto setId = _inner->setId();
+				const auto innerId = setId >> 32;
 
 				(*menu)->addAction(
 					tr::ayu_MessageDetailsPackOwnerPC(tr::now),
@@ -816,6 +818,26 @@ void StickerSetBox::updateButtons() {
 							});
 					},
 					&st::menuIconProfile);
+
+				if (settings.showPeerId != 0) {
+					(*menu)->addAction(
+						tr::ayu_ContextCopyID(tr::now),
+						[weak, session, setId]
+						{
+							if (!weak) {
+								return;
+							}
+
+							const auto strongInner = weak.data();
+							if (!strongInner) {
+								return;
+							}
+
+							QGuiApplication::clipboard()->setText(QString::number(setId));
+							strongInner->showToast(tr::ayu_IDCopiedToast(tr::now));
+						},
+						&st::menuIconCopy);
+				}
 			}
 		};
 		if (_inner->notInstalled()) {
@@ -865,7 +887,7 @@ void StickerSetBox::updateButtons() {
 							: tr::lng_stickers_share_pack)(tr::now),
 						[=] { share(); closeBox(); },
 						&st::menuIconShare);
-					addPackOwner(menu);
+					addPackIdActions(menu);
 					(*menu)->popup(QCursor::pos());
 					return true;
 				});
@@ -918,7 +940,7 @@ void StickerSetBox::updateButtons() {
 							archive,
 							&st::menuIconArchive);
 					}
-					addPackOwner(menu);
+					addPackIdActions(menu);
 					(*menu)->popup(QCursor::pos());
 					return true;
 				});
@@ -1486,6 +1508,16 @@ void StickerSetBox::Inner::contextMenuEvent(QContextMenuEvent *e) {
 					QGuiApplication::clipboard()->setMimeData(data.release());
 				}
 			}, &st::menuIconCopy);
+
+			const auto &settings = AyuSettings::getInstance();
+			if (settings.showPeerId != 0) {
+				_menu->addAction(tr::ayu_ContextCopyID(tr::now),
+								 [=]
+								 {
+									 QGuiApplication::clipboard()->setText(QString::number(_pack[index]->id));
+								 },
+								 &st::menuIconCopy);
+			}
 		}
 	} else if (details.type != SendMenu::Type::Disabled) {
 		const auto document = _pack[index];

Telegram/SourceFiles/boxes/transfer_gift_box.cpp

@@ -425,8 +425,6 @@ void TransferGift(
 		Data::SavedStarGiftId savedId,
 		Fn<void(Payments::CheckoutResult)> done,
 		bool skipPaymentForm = false) {
-	Expects(to->isUser());
-
 	const auto session = &window->session();
 	const auto weak = base::make_weak(window);
 	auto formDone = [=](

Telegram/SourceFiles/core/click_handler_types.h

@@ -17,6 +17,7 @@ constexpr auto kSendReactionEmojiProperty = 0x04;
 constexpr auto kReactionsCountEmojiProperty = 0x05;
 constexpr auto kDocumentFilenameTooltipProperty = 0x06;
 constexpr auto kPhoneNumberLinkProperty = 0x07;
+constexpr auto kTodoListItemIdProperty = 0x08;
 
 namespace Ui {
 class Show;

Telegram/SourceFiles/core/version.h

@@ -22,7 +22,7 @@ constexpr auto AppId = "{53F49750-6209-4FBF-9CA8-7A333C87D666}"_cs;
 constexpr auto AppNameOld = "AyuGram for Windows"_cs;
 constexpr auto AppName = "AyuGram Desktop"_cs;
 constexpr auto AppFile = "AyuGram"_cs;
-constexpr auto AppVersion = 5016003;
-constexpr auto AppVersionStr = "5.16.3";
+constexpr auto AppVersion = 5016004;
+constexpr auto AppVersionStr = "5.16.4";
 constexpr auto AppBetaVersion = false;
 constexpr auto AppAlphaVersion = TDESKTOP_ALPHA_VERSION;

Telegram/SourceFiles/data/components/sponsored_messages.cpp

@@ -32,8 +32,11 @@ https://github.com/telegramdesktop/tdesktop/blob/master/LEGAL
 namespace Data {
 namespace {
 
+constexpr auto kMs = crl::time(1000);
 constexpr auto kRequestTimeLimit = 5 * 60 * crl::time(1000);
 
+const auto kFlaggedPreload = ((MediaPreload*)quintptr(0x01));
+
 [[nodiscard]] bool TooEarlyForRequest(crl::time received) {
 	return (received > 0) && (received + kRequestTimeLimit > crl::now());
 }
@@ -77,17 +80,21 @@ void SponsoredMessages::clear() {
 
 void SponsoredMessages::clearOldRequests() {
 	const auto now = crl::now();
-	while (true) {
-		const auto i = ranges::find_if(_requests, [&](const auto &value) {
-			const auto &request = value.second;
-			return !request.requestId
-				&& (request.lastReceived + kRequestTimeLimit <= now);
-		});
-		if (i == end(_requests)) {
-			break;
+	const auto clear = [&](auto &requests) {
+		while (true) {
+			const auto i = ranges::find_if(requests, [&](const auto &value) {
+				const auto &request = value.second;
+				return !request.requestId
+					&& (request.lastReceived + kRequestTimeLimit <= now);
+			});
+			if (i == end(requests)) {
+				break;
+			}
+			requests.erase(i);
 		}
-		_requests.erase(i);
-	}
+	};
+	clear(_requests);
+	clear(_requestsForVideo);
 }
 
 SponsoredMessages::AppendResult SponsoredMessages::append(
@@ -241,6 +248,16 @@ bool SponsoredMessages::canHaveFor(not_null<History*> history) const {
 	return false;
 }
 
+bool SponsoredMessages::canHaveFor(not_null<HistoryItem*> item) const {
+	const auto &settings = AyuSettings::getInstance();
+	if (settings.disableAds) {
+		return false;
+	}
+
+	return item->history()->peer->isBroadcast()
+		&& item->isRegular();
+}
+
 bool SponsoredMessages::isTopBarFor(not_null<History*> history) const {
 	const auto &settings = AyuSettings::getInstance();
 	if (settings.disableAds) {
@@ -291,6 +308,78 @@ void SponsoredMessages::request(not_null<History*> history, Fn<void()> done) {
 	}).send();
 }
 
+void SponsoredMessages::requestForVideo(
+		not_null<HistoryItem*> item,
+		Fn<void(SponsoredForVideo)> done) {
+	Expects(done != nullptr);
+
+	if (!canHaveFor(item)) {
+		done({});
+		return;
+	}
+	const auto peer = item->history()->peer;
+	auto &request = _requestsForVideo[peer];
+	if (TooEarlyForRequest(request.lastReceived)) {
+		auto prepared = prepareForVideo(peer);
+		if (prepared.list.empty()
+			|| prepared.state.itemIndex < prepared.list.size()
+			|| prepared.state.leftTillShow > 0) {
+			done(std::move(prepared));
+			return;
+		}
+	}
+	request.callbacks.push_back(std::move(done));
+	if (request.requestId) {
+		return;
+	}
+	{
+		const auto it = _dataForVideo.find(peer);
+		if (it != end(_dataForVideo)) {
+			auto &list = it->second;
+			// Don't rebuild currently displayed messages.
+			const auto proj = [](const Entry &e) {
+				return e.item != nullptr;
+			};
+			if (ranges::any_of(list.entries, proj)) {
+				return;
+			}
+		}
+	}
+	const auto finish = [=] {
+		const auto i = _requestsForVideo.find(peer);
+		if (i != end(_requestsForVideo)) {
+			for (const auto &callback : base::take(i->second.callbacks)) {
+				callback(prepareForVideo(peer));
+			}
+		}
+	};
+	using Flag = MTPmessages_GetSponsoredMessages::Flag;
+	request.requestId = _session->api().request(
+		MTPmessages_GetSponsoredMessages(
+			MTP_flags(Flag::f_msg_id),
+			peer->input,
+			MTP_int(item->id.bare))
+	).done([=](const MTPmessages_sponsoredMessages &result) {
+		parseForVideo(peer, result);
+		finish();
+	}).fail([=] {
+		_requestsForVideo.remove(peer);
+		finish();
+	}).send();
+}
+
+void SponsoredMessages::updateForVideo(
+		FullMsgId itemId,
+		SponsoredForVideoState state) {
+	if (state.initial()) {
+		return;
+	}
+	const auto i = _dataForVideo.find(_session->data().peer(itemId.peer));
+	if (i != end(_dataForVideo)) {
+		i->second.state = state;
+	}
+}
+
 void SponsoredMessages::parse(
 		not_null<History*> history,
 		const MTPmessages_sponsoredMessages &list) {
@@ -306,12 +395,9 @@ void SponsoredMessages::parse(
 		_session->data().processChats(data.vchats());
 
 		const auto &messages = data.vmessages().v;
-		auto &list = _data.emplace(history, List()).first->second;
+		auto &list = _data.emplace(history).first->second;
 		list.entries.clear();
 		list.received = crl::now();
-		for (const auto &message : messages) {
-			append(history, list, message);
-		}
 		if (const auto postsBetween = data.vposts_between()) {
 			list.postsBetween = postsBetween->v;
 			list.state = State::InjectToMiddle;
@@ -320,10 +406,66 @@ void SponsoredMessages::parse(
 				? State::AppendToEnd
 				: State::AppendToTopBar;
 		}
+		for (const auto &message : messages) {
+			append([=] {
+				return &_data[history].entries;
+			}, history, message);
+		}
 	}, [](const MTPDmessages_sponsoredMessagesEmpty &) {
 	});
 }
 
+void SponsoredMessages::parseForVideo(
+		not_null<PeerData*> peer,
+		const MTPmessages_sponsoredMessages &list) {
+	auto &request = _requestsForVideo[peer];
+	request.lastReceived = crl::now();
+	request.requestId = 0;
+	if (!_clearTimer.isActive()) {
+		_clearTimer.callOnce(kRequestTimeLimit * 2);
+	}
+
+	list.match([&](const MTPDmessages_sponsoredMessages &data) {
+		_session->data().processUsers(data.vusers());
+		_session->data().processChats(data.vchats());
+
+		const auto history = _session->data().history(peer);
+		const auto &messages = data.vmessages().v;
+		auto &list = _dataForVideo.emplace(peer).first->second;
+		list.entries.clear();
+		list.received = crl::now();
+		list.startDelay = data.vstart_delay().value_or_empty() * kMs;
+		list.betweenDelay = data.vbetween_delay().value_or_empty() * kMs;
+		for (const auto &message : messages) {
+			append([=] {
+				return &_dataForVideo[peer].entries;
+			}, history, message);
+		}
+	}, [](const MTPDmessages_sponsoredMessagesEmpty &) {
+	});
+}
+
+SponsoredForVideo SponsoredMessages::prepareForVideo(
+		not_null<PeerData*> peer) {
+	const auto &settings = AyuSettings::getInstance();
+	if (settings.disableAds) {
+		return {};
+	}
+
+	const auto i = _dataForVideo.find(peer);
+	if (i == end(_dataForVideo) || i->second.entries.empty()) {
+		return {};
+	}
+	return SponsoredForVideo{
+		.list = i->second.entries | ranges::views::transform(
+			&Entry::sponsored
+		) | ranges::to_vector,
+		.startDelay = i->second.startDelay,
+		.betweenDelay = i->second.betweenDelay,
+		.state = i->second.state,
+	};
+}
+
 FullMsgId SponsoredMessages::fillTopBar(
 		not_null<History*> history,
 		not_null<Ui::RpWidget*> widget) {
@@ -373,8 +515,8 @@ rpl::producer<> SponsoredMessages::itemRemoved(const FullMsgId &fullId) {
 }
 
 void SponsoredMessages::append(
+		Fn<not_null<std::vector<Entry>*>()> entries,
 		not_null<History*> history,
-		List &list,
 		const MTPSponsoredMessage &message) {
 	const auto &data = message.data();
 	const auto randomId = data.vrandom_id().v;
@@ -385,14 +527,14 @@ void SponsoredMessages::append(
 			data.vmedia()->match([&](const MTPDmessageMediaPhoto &media) {
 				if (const auto tlPhoto = media.vphoto()) {
 					tlPhoto->match([&](const MTPDphoto &data) {
-						mediaPhoto = history->owner().processPhoto(data);
+						mediaPhoto = _session->data().processPhoto(data);
 					}, [](const MTPDphotoEmpty &) {
 					});
 				}
 			}, [&](const MTPDmessageMediaDocument &media) {
 				if (const auto tlDocument = media.vdocument()) {
 					tlDocument->match([&](const MTPDdocument &data) {
-						const auto d = history->owner().processDocument(
+						const auto d = _session->data().processDocument(
 							data,
 							media.valt_documents());
 						if (d->isVideoFile()
@@ -413,7 +555,7 @@ void SponsoredMessages::append(
 		.link = qs(data.vurl()),
 		.buttonText = qs(data.vbutton_text()),
 		.photoId = data.vphoto()
-			? history->session().data().processPhoto(*data.vphoto())->id
+			? _session->data().processPhoto(*data.vphoto())->id
 			: PhotoId(0),
 		.mediaPhotoId = (mediaPhoto ? mediaPhoto->id : 0),
 		.mediaDocumentId = (mediaDocument ? mediaDocument->id : 0),
@@ -449,25 +591,24 @@ void SponsoredMessages::append(
 		.link = from.link,
 		.sponsorInfo = std::move(sponsorInfo),
 		.additionalInfo = std::move(additionalInfo),
+		.durationMin = data.vmin_display_duration().value_or_empty() * kMs,
+		.durationMax = data.vmax_display_duration().value_or_empty() * kMs,
 	};
-	list.entries.push_back({
-		.sponsored = std::move(sharedMessage),
-	});
-	auto &entry = list.entries.back();
-	const auto itemId = entry.itemFullId = FullMsgId(
+	const auto itemId = FullMsgId(
 		history->peer->id,
 		_session->data().nextLocalMessageId());
+	const auto list = entries();
+	list->push_back({
+		.itemFullId = itemId,
+		.sponsored = std::move(sharedMessage),
+	});
+	auto &entry = list->back();
 	const auto fileOrigin = FileOrigin(); // No way to refresh in ads.
 
-	static const auto kFlaggedPreload = ((MediaPreload*)quintptr(0x01));
 	const auto preloaded = [=] {
-		const auto i = _data.find(history);
-		if (i == end(_data)) {
-			return;
-		}
-		auto &entries = i->second.entries;
-		const auto j = ranges::find(entries, itemId, &Entry::itemFullId);
-		if (j == end(entries)) {
+		const auto list = entries();
+		const auto j = ranges::find(*list, itemId, &Entry::itemFullId);
+		if (j == end(*list)) {
 			return;
 		}
 		auto &entry = *j;
@@ -565,7 +706,11 @@ SponsoredMessages::Details SponsoredMessages::lookupDetails(
 	if (!entryPtr) {
 		return {};
 	}
-	const auto &data = entryPtr->sponsored;
+	return lookupDetails(entryPtr->sponsored);
+}
+
+SponsoredMessages::Details SponsoredMessages::lookupDetails(
+		const SponsoredMessage &data) const {
 	return {
 		.info = Prepare(data),
 		.link = data.link,

Telegram/SourceFiles/data/components/sponsored_messages.h

@@ -67,10 +67,12 @@ struct SponsoredMessage {
 	QByteArray randomId;
 	SponsoredFrom from;
 	TextWithEntities textWithEntities;
-	History *history = nullptr;
+	not_null<History*> history;
 	QString link;
 	TextWithEntities sponsorInfo;
 	TextWithEntities additionalInfo;
+	crl::time durationMin = 0;
+	crl::time durationMax = 0;
 };
 
 struct SponsoredMessageDetails {
@@ -92,6 +94,23 @@ struct SponsoredReportAction {
 		Fn<void(Data::SponsoredReportResult)>)> callback;
 };
 
+struct SponsoredForVideoState {
+	int itemIndex = 0;
+	crl::time leftTillShow = 0;
+
+	[[nodiscard]] bool initial() const {
+		return !itemIndex && !leftTillShow;
+	}
+};
+
+struct SponsoredForVideo {
+	std::vector<SponsoredMessage> list;
+	crl::time startDelay = 0;
+	crl::time betweenDelay = 0;
+
+	SponsoredForVideoState state;
+};
+
 class SponsoredMessages final {
 public:
 	enum class AppendResult {
@@ -111,10 +130,18 @@ public:
 	~SponsoredMessages();
 
 	[[nodiscard]] bool canHaveFor(not_null<History*> history) const;
+	[[nodiscard]] bool canHaveFor(not_null<HistoryItem*> item) const;
 	[[nodiscard]] bool isTopBarFor(not_null<History*> history) const;
 	void request(not_null<History*> history, Fn<void()> done);
+	void requestForVideo(
+		not_null<HistoryItem*> item,
+		Fn<void(SponsoredForVideo)> done);
+	void updateForVideo(
+		FullMsgId itemId,
+		SponsoredForVideoState state);
 	void clearItems(not_null<History*> history);
 	[[nodiscard]] Details lookupDetails(const FullMsgId &fullId) const;
+	[[nodiscard]] Details lookupDetails(const SponsoredMessage &data) const;
 	[[nodiscard]] Details lookupDetails(
 		const Api::SponsoredSearchResult &data) const;
 	void clicked(const FullMsgId &fullId, bool isMedia, bool isFullscreen);
@@ -166,18 +193,35 @@ private:
 		int postsBetween = 0;
 		State state = State::None;
 	};
+	struct ListForVideo {
+		std::vector<Entry> entries;
+		crl::time received = 0;
+		crl::time startDelay = 0;
+		crl::time betweenDelay = 0;
+		SponsoredForVideoState state;
+	};
 	struct Request {
 		mtpRequestId requestId = 0;
 		crl::time lastReceived = 0;
 	};
+	struct RequestForVideo {
+		std::vector<Fn<void(SponsoredForVideo)>> callbacks;
+		mtpRequestId requestId = 0;
+		crl::time lastReceived = 0;
+	};
 
 	void parse(
 		not_null<History*> history,
 		const MTPmessages_sponsoredMessages &list);
+	void parseForVideo(
+		not_null<PeerData*> peer,
+		const MTPmessages_sponsoredMessages &list);
 	void append(
+		Fn<not_null<std::vector<Entry>*>()> entries,
 		not_null<History*> history,
-		List &list,
 		const MTPSponsoredMessage &message);
+	[[nodiscard]] SponsoredForVideo prepareForVideo(
+		not_null<PeerData*> peer);
 	void clearOldRequests();
 
 	const Entry *find(const FullMsgId &fullId) const;
@@ -189,6 +233,9 @@ private:
 	base::flat_map<not_null<History*>, Request> _requests;
 	base::flat_map<RandomId, Request> _viewRequests;
 
+	base::flat_map<not_null<PeerData*>, ListForVideo> _dataForVideo;
+	base::flat_map<not_null<PeerData*>, RequestForVideo> _requestsForVideo;
+
 	rpl::event_stream<FullMsgId> _itemRemoved;
 
 	rpl::lifetime _lifetime;

Telegram/SourceFiles/data/data_chat_participant_status.cpp

@@ -72,7 +72,7 @@ namespace {
 			| (data.is_send_audios() ? Flag::SendMusic : Flag())
 			| (data.is_send_voices() ? Flag::SendVoiceMessages : Flag())
 			| (data.is_send_docs() ? Flag::SendFiles : Flag())
-			| (data.is_send_messages() ? Flag::SendOther : Flag())
+			| (data.is_send_plain() ? Flag::SendOther : Flag())
 			| (data.is_embed_links() ? Flag::EmbedLinks : Flag())
 			| (data.is_change_info() ? Flag::ChangeInfo : Flag())
 			| (data.is_invite_users() ? Flag::AddParticipants : Flag())
@@ -142,7 +142,7 @@ MTPChatBannedRights RestrictionsToMTP(ChatRestrictionsInfo info) {
 			| ((flags & R::SendMusic) ? Flag::f_send_audios : Flag())
 			| ((flags & R::SendVoiceMessages) ? Flag::f_send_voices : Flag())
 			| ((flags & R::SendFiles) ? Flag::f_send_docs : Flag())
-			| ((flags & R::SendOther) ? Flag::f_send_messages : Flag())
+			| ((flags & R::SendOther) ? Flag::f_send_plain : Flag())
 			| ((flags & R::EmbedLinks) ? Flag::f_embed_links : Flag())
 			| ((flags & R::ChangeInfo) ? Flag::f_change_info : Flag())
 			| ((flags & R::AddParticipants) ? Flag::f_invite_users : Flag())

Telegram/SourceFiles/data/data_histories.cpp

@@ -92,7 +92,8 @@ MTPInputReplyTo ReplyToForMTP(
 					: Flag())
 				| (quoteEntities.v.isEmpty()
 					? Flag()
-					: Flag::f_quote_entities)),
+					: Flag::f_quote_entities)
+				| (replyTo.todoItemId ? Flag::f_todo_item_id : Flag())),
 			MTP_int(replyTo.messageId ? replyTo.messageId.msg : 0),
 			MTP_int(replyTo.topicRootId),
 			(external
@@ -103,7 +104,8 @@ MTPInputReplyTo ReplyToForMTP(
 			MTP_int(replyTo.quoteOffset),
 			(replyToMonoforumPeerId
 				? history->owner().peer(replyToMonoforumPeerId)->input
-				: MTPInputPeer()));
+				: MTPInputPeer()),
+			MTP_int(replyTo.todoItemId));
 	} else if (history->peer->amMonoforumAdmin()
 		&& replyTo.monoforumPeerId) {
 		const auto replyToMonoforumPeer = replyTo.monoforumPeerId

Telegram/SourceFiles/data/data_msg_id.h

@@ -172,6 +172,19 @@ inline QDebug operator<<(QDebug debug, const FullMsgId &fullMsgId) {
 
 Q_DECLARE_METATYPE(FullMsgId);
 
+struct MessageHighlightId {
+	TextWithEntities quote;
+	int quoteOffset = 0;
+	int todoItemId = 0;
+
+	[[nodiscard]] bool empty() const {
+		return quote.empty() && !todoItemId;
+	}
+	[[nodiscard]] friend inline bool operator==(
+		const MessageHighlightId &a,
+		const MessageHighlightId &b) = default;
+};
+
 struct FullReplyTo {
 	FullMsgId messageId;
 	TextWithEntities quote;
@@ -179,7 +192,11 @@ struct FullReplyTo {
 	MsgId topicRootId = 0;
 	PeerId monoforumPeerId = 0;
 	int quoteOffset = 0;
+	int todoItemId = 0;
 
+	[[nodiscard]] MessageHighlightId highlight() const {
+		return { quote, quoteOffset, todoItemId };
+	}
 	[[nodiscard]] bool replying() const {
 		return messageId || (storyId && storyId.peer);
 	}

Telegram/SourceFiles/data/data_saved_messages.cpp

@@ -96,17 +96,6 @@ Thread *SavedMessages::activeSubsectionThread() const {
 	return _activeSubsectionSublist;
 }
 
-Dialogs::UnreadState SavedMessages::unreadStateWithParentMuted() const {
-	auto result = _chatsList.unreadState();
-	if (_owningHistory->muted()) {
-		result.chatsMuted = result.chats;
-		result.marksMuted = result.marks;
-		result.messagesMuted = result.messages;
-		result.reactionsMuted = result.reactions;
-	}
-	return result;
-}
-
 SavedMessages::~SavedMessages() {
 	clear();
 }
@@ -458,6 +447,9 @@ void SavedMessages::applySublistDeleted(not_null<PeerData*> sublistPeer) {
 	if (ranges::contains(_lastSublists, not_null(raw))) {
 		reorderLastSublists();
 	}
+	if (_activeSubsectionSublist == raw) {
+		_activeSubsectionSublist = nullptr;
+	}
 
 	_sublistDestroyed.fire(raw);
 	session().changes().sublistUpdated(

Telegram/SourceFiles/data/data_saved_messages.h

@@ -84,8 +84,6 @@ public:
 	void saveActiveSubsectionThread(not_null<Thread*> thread);
 	Thread *activeSubsectionThread() const;
 
-	[[nodiscard]] Dialogs::UnreadState unreadStateWithParentMuted() const;
-
 	[[nodiscard]] rpl::lifetime &lifetime();
 
 private:

Telegram/SourceFiles/data/data_saved_sublist.cpp

@@ -217,7 +217,28 @@ void SavedSublist::applyItemRemoved(MsgId id) {
 	if (const auto chatListItem = _chatListMessage.value_or(nullptr)) {
 		if (chatListItem->id == id) {
 			_chatListMessage = std::nullopt;
-			requestChatListMessage();
+			crl::on_main(this, [=] {
+				// We didn't yet update _list here.
+				if (_chatListMessage.has_value()) {
+					return;
+				} else if (_skippedAfter == 0) {
+					if (!_list.empty()) {
+						applyMaybeLast(owner().message(
+							owningHistory()->peer,
+							_list.front()));
+						return;
+					} else if (_skippedBefore == 0) {
+						setLastServerMessage(nullptr);
+						updateChatListExistence();
+						return;
+					}
+				}
+				if (_parent->parentChat()) {
+					requestChatListMessage();
+				} else {
+					loadAround(0);
+				}
+			});
 		}
 	}
 }
@@ -1110,6 +1131,10 @@ void SavedSublist::loadAround(MsgId id) {
 			_list.clear();
 			if (processMessagesIsEmpty(result)) {
 				_fullCount = _skippedBefore = _skippedAfter = 0;
+				if (!_parent->parentChat() && !_chatListMessage) {
+					setLastServerMessage(nullptr);
+					updateChatListExistence();
+				}
 			} else if (id) {
 				Assert(!_list.empty());
 				if (_list.front() <= id) {
@@ -1117,6 +1142,11 @@ void SavedSublist::loadAround(MsgId id) {
 				} else if (_list.back() >= id) {
 					_skippedBefore = 0;
 				}
+			} else if (!_parent->parentChat() && !_chatListMessage) {
+				Assert(!_list.empty());
+				applyMaybeLast(owner().message(
+					owningHistory()->peer,
+					_list.front()));
 			}
 			checkReadTillEnd();
 		}).fail([=](const MTP::Error &error) {

Telegram/SourceFiles/data/data_stories.cpp

@@ -10,6 +10,7 @@ https://github.com/telegramdesktop/tdesktop/blob/master/LEGAL
 #include "base/unixtime.h"
 #include "apiwrap.h"
 #include "core/application.h"
+#include "data/components/top_peers.h"
 #include "data/data_changes.h"
 #include "data/data_channel.h"
 #include "data/data_document.h"
@@ -425,10 +426,7 @@ void Stories::parseAndApply(const MTPPeerStories &stories) {
 	};
 	if (result.peer->isSelf()
 		|| (result.peer->isChannel() && result.peer->asChannel()->amIn())
-		|| (result.peer->isUser()
-			&& (result.peer->asUser()->isBot()
-				|| result.peer->asUser()->isContact()))
-		|| result.peer->isServiceUser()) {
+		|| result.peer->isUser()) {
 		const auto hidden = result.peer->hasStoriesHidden();
 		using List = StorySourcesList;
 		add(hidden ? List::Hidden : List::NotHidden);
@@ -1197,7 +1195,11 @@ void Stories::toggleHidden(
 		bool hidden,
 		std::shared_ptr<Ui::Show> show) {
 	const auto peer = _owner->peer(peerId);
-	const auto justRemove = peer->isServiceUser() && hidden;
+	const auto byHints = peer->isUser()
+		&& !peer->asUser()->isBot()
+		&& !peer->asUser()->isContact()
+		&& !peer->asUser()->isServiceUser();
+	const auto justRemove = (byHints || peer->isServiceUser()) && hidden;
 	if (peer->hasStoriesHidden() != hidden) {
 		if (!justRemove) {
 			peer->setStoriesHidden(hidden);
@@ -1206,6 +1208,9 @@ void Stories::toggleHidden(
 			peer->input,
 			MTP_bool(hidden)
 		)).send();
+		if (byHints) {
+			peer->session().topPeers().remove(peer);
+		}
 	}
 
 	const auto name = peer->shortName();

Telegram/SourceFiles/dialogs/dialogs.style

@@ -244,6 +244,17 @@ dialogsEmptyLabel: FlatLabel(defaultFlatLabel) {
 	align: align(top);
 	textFg: windowSubTextFg;
 }
+dialogEmptyButton: RoundButton(defaultActiveButton) {
+}
+dialogEmptyButtonSkip: 12px;
+dialogEmptyButtonLabel: FlatLabel(defaultFlatLabel) {
+	style: TextStyle(defaultTextStyle) {
+		font: font(boxFontSize semibold);
+	}
+	minWidth: 32px;
+	align: align(top);
+	textFg: windowFg;
+}
 
 dialogsMenuToggle: IconButton {
 	width: 40px;

Telegram/SourceFiles/dialogs/dialogs_inner_widget.cpp

@@ -31,6 +31,7 @@ https://github.com/telegramdesktop/tdesktop/blob/master/LEGAL
 #include "ui/text/text_utilities.h"
 #include "ui/text/text_options.h"
 #include "ui/dynamic_thumbnails.h"
+#include "ui/vertical_list.h"
 #include "ui/painter.h"
 #include "ui/rect.h"
 #include "ui/ui_utility.h"
@@ -58,8 +59,7 @@ https://github.com/telegramdesktop/tdesktop/blob/master/LEGAL
 #include "base/options.h"
 #include "lang/lang_keys.h"
 #include "lottie/lottie_icon.h"
-#include "mainwindow.h"
-#include "mainwidget.h"
+#include "settings/settings_common.h"
 #include "storage/storage_account.h"
 #include "apiwrap.h"
 #include "main/main_session.h"
@@ -80,6 +80,7 @@ https://github.com/telegramdesktop/tdesktop/blob/master/LEGAL
 #include "api/api_chat_filters.h"
 #include "base/qt/qt_common_adapters.h"
 #include "styles/style_dialogs.h"
+#include "styles/style_boxes.h"
 #include "styles/style_chat.h" // popupMenuExpandedSeparator
 #include "styles/style_chat_helpers.h"
 #include "styles/style_color_indices.h"
@@ -3081,6 +3082,11 @@ void InnerWidget::clearSelection() {
 }
 
 void InnerWidget::fillSupportSearchMenu(not_null<Ui::PopupMenu*> menu) {
+	const auto globalSearch = (_searchState.tab == ChatSearchTab::MyMessages)
+		|| (_searchState.tab == ChatSearchTab::PublicPosts);
+	if (!globalSearch && _searchState.inChat) {
+		return;
+	}
 	const auto all = session().settings().supportAllSearchResults();
 	const auto text = all ? "Only one from chat" : "Show all messages";
 	menu->addAction(text, [=] {
@@ -3091,9 +3097,11 @@ void InnerWidget::fillSupportSearchMenu(not_null<Ui::PopupMenu*> menu) {
 
 void InnerWidget::fillArchiveSearchMenu(not_null<Ui::PopupMenu*> menu) {
 	const auto folder = session().data().folderLoaded(Data::Folder::kId);
+	const auto globalSearch = (_searchState.tab == ChatSearchTab::MyMessages)
+		|| (_searchState.tab == ChatSearchTab::PublicPosts);
 	if (!folder
 		|| !folder->chatsList()->fullSize().current()
-		|| _searchState.inChat) {
+		|| (!globalSearch && _searchState.inChat)) {
 		return;
 	}
 	const auto skip = session().settings().skipArchiveInSearch();
@@ -3263,16 +3271,13 @@ void InnerWidget::showSponsoredMenu(int peerSearchIndex, QPoint globalPos) {
 		refresh();
 	});
 	Menu::FillSponsored(
-		this,
 		Ui::Menu::CreateAddActionCallback(_menu),
 		_controller->uiShow(),
 		Menu::SponsoredPhrases::Search,
 		session().sponsoredMessages().lookupDetails(entry->sponsored->data),
 		session().sponsoredMessages().createReportCallback(
 			entry->sponsored->data.randomId,
-			remove),
-		false,
-		false);
+			remove));
 	QObject::connect(_menu.get(), &QObject::destroyed, [=] {
 		if (_peerSearchMenu >= 0
 			&& _peerSearchMenu < _peerSearchResults.size()) {
@@ -3811,7 +3816,7 @@ void InnerWidget::itemRemoved(not_null<const HistoryItem*> item) {
 }
 
 bool InnerWidget::uniqueSearchResults() const {
-	return _controller->uniqueChatsInSearchResults();
+	return _controller->uniqueChatsInSearchResults(_searchState);
 }
 
 bool InnerWidget::hasHistoryInResults(not_null<History*> history) const {
@@ -3869,7 +3874,8 @@ void InnerWidget::searchReceived(
 		? _searchState.inChat
 		: Key(_openedForum->history());
 	if (inject
-		&& (!_searchState.inChat
+		&& (globalSearch
+			|| !_searchState.inChat
 			|| inject->history() == _searchState.inChat.history())) {
 		Assert(_searchResults.empty());
 		Assert(!toPreview);
@@ -4082,9 +4088,18 @@ void InnerWidget::refreshEmpty() {
 	if (state == EmptyState::None) {
 		_emptyState = state;
 		_empty.destroy();
+		_emptyList.destroy();
+		_emptyButton.destroy();
 		return;
 	} else if (_emptyState == state) {
 		_empty->setVisible(_state == WidgetState::Default);
+		if (_emptyList) {
+			_emptyList->setVisible(_state == WidgetState::Default);
+			_empty->setVisible(!_emptyList->isVisible());
+		}
+		if (_emptyButton) {
+			_emptyButton->setVisible(_state == WidgetState::Default);
+		}
 		return;
 	}
 	_emptyState = state;
@@ -4115,7 +4130,6 @@ void InnerWidget::refreshEmpty() {
 		return result;
 	});
 	_empty.create(this, std::move(full), st::dialogsEmptyLabel);
-	resizeEmpty();
 	_empty->overrideLinkClickHandler([=] {
 		if (_emptyState == EmptyState::NoContacts) {
 			_controller->showAddContact();
@@ -4127,6 +4141,58 @@ void InnerWidget::refreshEmpty() {
 		}
 	});
 	_empty->setVisible(_state == WidgetState::Default);
+
+	if (state == EmptyState::NoContacts) {
+		const auto isListVisible = _state == WidgetState::Default;
+		_emptyList.create(this);
+		_emptyList->setVisible(isListVisible);
+
+		auto icon = ::Settings::CreateLottieIcon(
+			_emptyList,
+			{
+				.name = u"no_chats"_q,
+				.sizeOverride = Size(st::changePhoneIconSize),
+			});
+		_emptyList->add(
+			object_ptr<Ui::CenterWrap<>>(_emptyList, std::move(icon.widget)));
+		Ui::AddSkip(_emptyList);
+		_emptyList->add(
+			object_ptr<Ui::FlatLabel>(
+				_emptyList,
+				tr::lng_no_conversations(),
+				st::dialogEmptyButtonLabel));
+		if (_state == WidgetState::Default) {
+			icon.animate(anim::repeat::once);
+		}
+		_emptyButton.create(
+			this,
+			tr::lng_no_conversations_button(),
+			st::dialogEmptyButton);
+		_emptyButton->setTextTransform(
+			Ui::RoundButton::TextTransform::NoTransform);
+		_emptyButton->setVisible(isListVisible);
+		_emptyButton->setClickedCallback([=, window = _controller] {
+			window->show(PrepareContactsBox(window));
+		});
+		geometryValue() | rpl::start_with_next([=](const QRect &r) {
+			const auto top = r.height()
+				- _emptyButton->height()
+				- st::dialogEmptyButtonSkip;
+			_emptyButton->moveToLeft(st::dialogEmptyButtonSkip, top);
+		}, _emptyButton->lifetime());
+		geometryValue() | rpl::start_with_next([=](const QRect &r) {
+			const auto bottom = _emptyButton
+				? (_emptyButton->height() + st::dialogEmptyButtonSkip)
+				: 0;
+			_emptyList->moveToLeft(
+				0,
+				((r.height() - bottom) - _emptyList->height()) / 2);
+		}, _emptyList->lifetime());
+
+		_empty->setVisible(!_emptyList->isVisible());
+	}
+
+	resizeEmpty();
 }
 
 void InnerWidget::resizeEmpty() {
@@ -4135,6 +4201,13 @@ void InnerWidget::resizeEmpty() {
 		_empty->resizeToWidth(width() - 2 * skip);
 		_empty->move(skip, (st::dialogsEmptyHeight - _empty->height()) / 2);
 	}
+	if (_emptyList) {
+		_emptyList->resizeToWidth(width());
+	}
+	if (_emptyButton) {
+		const auto skip = st::dialogEmptyButtonSkip;
+		_emptyButton->resizeToWidth(width() - 2 * skip);
+	}
 	if (_searchEmpty) {
 		_searchEmpty->resizeToWidth(width());
 		_searchEmpty->move(0, searchedOffset());

Telegram/SourceFiles/dialogs/dialogs_inner_widget.h

@@ -43,6 +43,8 @@ namespace Ui {
 class IconButton;
 class PopupMenu;
 class FlatLabel;
+class VerticalLayout;
+class RoundButton;
 struct ScrollToRequest;
 namespace Controls {
 enum class QuickDialogAction;
@@ -619,6 +621,8 @@ private:
 	object_ptr<SearchEmpty> _searchEmpty = { nullptr };
 	SearchState _searchEmptyState;
 	object_ptr<Ui::FlatLabel> _empty = { nullptr };
+	object_ptr<Ui::VerticalLayout> _emptyList = { nullptr };
+	object_ptr<Ui::RoundButton> _emptyButton = { nullptr };
 
 	Ui::DraggingScrollManager _draggingScroll;
 

Telegram/SourceFiles/dialogs/dialogs_main_list.cpp

@@ -120,6 +120,10 @@ void MainList::unreadStateChanged(
 	const auto notify = !useClouded || wasState.known;
 	const auto notifier = unreadStateChangeNotifier(notify);
 	_unreadState += nowState - wasState;
+	if (_unreadState.chatsMuted > _unreadState.chats
+		|| _unreadState.messagesMuted > _unreadState.messages) {
+		[[maybe_unused]] int a = 0;
+	}
 	if (updateCloudUnread) {
 		// Assert(nowState.known);
 		_cloudUnreadState += nowState - wasState;
@@ -145,6 +149,10 @@ void MainList::unreadEntryChanged(
 	} else {
 		_unreadState -= state;
 	}
+	if (_unreadState.chatsMuted > _unreadState.chats
+		|| _unreadState.messagesMuted > _unreadState.messages) {
+		[[maybe_unused]] int a = 0;
+	}
 	if (updateCloudUnread) {
 		if (added) {
 			_cloudUnreadState += state;

Telegram/SourceFiles/dialogs/dialogs_widget.cpp

@@ -903,10 +903,7 @@ void Widget::chosenRow(const ChosenRow &row) {
 	} else if (const auto topic = row.key.topic()) {
 		auto params = Window::SectionShow(
 			Window::SectionShow::Way::ClearStack);
-		params.highlightPart.text = _searchState.query;
-		if (!params.highlightPart.empty()) {
-			params.highlightPartOffsetHint = kSearchQueryOffsetHint;
-		}
+		params.highlight = Window::SearchHighlightId(_searchState.query);
 		if (row.newWindow) {
 			controller()->showInNewWindow(
 				Window::SeparateId(topic),
@@ -973,15 +970,12 @@ void Widget::chosenRow(const ChosenRow &row) {
 		return;
 	} else if (history) {
 		const auto peer = history->peer;
-		const auto showAtMsgId = controller()->uniqueChatsInSearchResults()
-			? ShowAtUnreadMsgId
-			: row.message.fullId.msg;
+		const auto showAtMsgId = controller()->uniqueChatsInSearchResults(
+			_searchState
+		) ? ShowAtUnreadMsgId : row.message.fullId.msg;
 		auto params = Window::SectionShow(
 			Window::SectionShow::Way::ClearStack);
-		params.highlightPart.text = _searchState.query;
-		if (!params.highlightPart.empty()) {
-			params.highlightPartOffsetHint = kSearchQueryOffsetHint;
-		}
+		params.highlight = Window::SearchHighlightId(_searchState.query);
 		if (row.newWindow) {
 			controller()->showInNewWindow(peer, showAtMsgId);
 		} else {

Telegram/SourceFiles/export/data/export_data_types.cpp

@@ -1167,8 +1167,15 @@ Chat ParseChat(const MTPChat &data) {
 		result.colorIndex = (color && color->data().vcolor())
 			? color->data().vcolor()->v
 			: PeerColorIndex(result.bareId);
+		result.isMonoforum = data.is_monoforum();
 		result.isBroadcast = data.is_broadcast();
 		result.isSupergroup = data.is_megagroup();
+		result.hasMonoforumAdminRights = data.is_broadcast()
+			&& (data.is_creator()
+				|| (data.vadmin_rights()
+					&& data.vadmin_rights()->data().is_manage_direct_messages()));
+		result.monoforumLinkId
+			= data.vlinked_monoforum_id().value_or_empty();
 		result.title = ParseString(data.vtitle());
 		if (const auto username = data.vusername()) {
 			result.username = ParseString(*username);
@@ -1188,15 +1195,6 @@ Chat ParseChat(const MTPChat &data) {
 	return result;
 }
 
-std::map<PeerId, Chat> ParseChatsList(const MTPVector<MTPChat> &data) {
-	auto result = std::map<PeerId, Chat>();
-	for (const auto &chat : data.v) {
-		auto parsed = ParseChat(chat);
-		result.emplace(parsed.id(), std::move(parsed));
-	}
-	return result;
-}
-
 Utf8String ContactInfo::name() const {
 	return firstName.isEmpty()
 		? (lastName.isEmpty()
@@ -1273,6 +1271,20 @@ std::map<PeerId, Peer> ParsePeersLists(
 		auto parsed = ParseChat(chat);
 		result.emplace(parsed.id(), Peer{ std::move(parsed) });
 	}
+	for (auto &[peerId, parsed] : result) {
+		if (const auto chat = std::get_if<Chat>(&parsed.data)) {
+			if (chat->isMonoforum) {
+				const auto i = result.find(
+					PeerId(ChannelId(chat->monoforumLinkId)));
+				if (i != end(result)) {
+					chat->isMonoforumAdmin
+						= i->second.chat()->hasMonoforumAdminRights;
+					chat->isMonoforumOfPublicBroadcast
+						= !i->second.chat()->username.isEmpty();
+				}
+			}
+		}
+	}
 	return result;
 }
 
@@ -2191,7 +2203,13 @@ const DialogInfo *DialogsInfo::item(int index) const {
 
 DialogInfo::Type DialogTypeFromChat(const Chat &chat) {
 	using Type = DialogInfo::Type;
-	return chat.username.isEmpty()
+	return (chat.isMonoforum && !chat.isMonoforumAdmin)
+		? Type::Personal
+		: (chat.isMonoforumAdmin && chat.isMonoforumOfPublicBroadcast)
+		? Type::PublicSupergroup
+		: chat.isMonoforumAdmin
+		? Type::PrivateSupergroup
+		: chat.username.isEmpty()
 		? (chat.isBroadcast
 			? Type::PrivateChannel
 			: chat.isSupergroup
@@ -2252,6 +2270,11 @@ DialogsInfo ParseDialogsInfo(const MTPmessages_Dialogs &data) {
 				info.migratedToChannelId = peer.chat()
 					? peer.chat()->migratedToChannelId
 					: 0;
+				info.isMonoforum = peer.chat()
+					&& peer.chat()->isMonoforum;
+				info.monoforumBroadcastInput = peer.chat()
+					? peer.chat()->monoforumBroadcastInput
+					: MTPInputPeer(MTP_inputPeerEmpty());
 			}
 			info.topMessageId = fields.vtop_message().v;
 			const auto messageIt = messages.find(MessageId{
@@ -2290,6 +2313,10 @@ DialogInfo DialogInfoFromChat(const Chat &data) {
 	result.topMessageId = 0;
 	result.type = DialogTypeFromChat(data);
 	result.migratedToChannelId = data.migratedToChannelId;
+	result.isMonoforum = data.isMonoforum;
+	if (data.isMonoforumAdmin) {
+		result.monoforumBroadcastInput = data.monoforumBroadcastInput;
+	}
 	return result;
 }
 
@@ -2424,7 +2451,8 @@ void FinalizeDialogsInfo(DialogsInfo &info, const Settings &settings) {
 			}
 			Unexpected("Type in ApiWrap::onlyMyMessages.");
 		}();
-		dialog.onlyMyMessages = ((settings.fullChats & setting) != setting);
+		dialog.onlyMyMessages = (dialog.type != DialogType::Personal)
+			&& ((settings.fullChats & setting) != setting);
 
 		ranges::sort(dialog.splits);
 	}

Telegram/SourceFiles/export/data/export_data_types.h

@@ -319,14 +319,19 @@ struct Chat {
 	Utf8String title;
 	Utf8String username;
 	uint8 colorIndex = 0;
+	bool isMonoforum = false;
 	bool isBroadcast = false;
 	bool isSupergroup = false;
+	bool isMonoforumAdmin = false;
+	bool hasMonoforumAdminRights = false;
+	bool isMonoforumOfPublicBroadcast = false;
+	BareId monoforumLinkId = 0;
 
 	MTPInputPeer input = MTP_inputPeerEmpty();
+	MTPInputPeer monoforumBroadcastInput = MTP_inputPeerEmpty();
 };
 
 Chat ParseChat(const MTPChat &data);
-std::map<PeerId, Chat> ParseChatsList(const MTPVector<MTPChat> &data);
 
 struct Peer {
 	PeerId id() const;
@@ -952,12 +957,15 @@ struct DialogInfo {
 	MTPInputPeer migratedFromInput = MTP_inputPeerEmpty();
 	ChannelId migratedToChannelId = 0;
 
+	MTPInputPeer monoforumBroadcastInput = MTP_inputPeerEmpty();
+
 	// User messages splits which contained that dialog.
 	std::vector<int> splits;
 
 	// Filled after the whole dialogs list is accumulated.
 	bool onlyMyMessages = false;
 	bool isLeftChannel = false;
+	bool isMonoforum = false;
 	QString relativePath;
 
 	// Filled when requesting dialog messages.

Telegram/SourceFiles/export/export_api_wrap.cpp

@@ -1370,7 +1370,7 @@ void ApiWrap::appendSinglePeerDialogs(Data::DialogsInfo &&info) {
 		if (isSupergroupType(info.type) && !migratedRequestId) {
 			migratedRequestId = requestSinglePeerMigrated(info);
 			continue;
-		} else if (isChannelType(info.type)) {
+		} else if (isChannelType(info.type) || info.isMonoforum) {
 			continue;
 		}
 		for (auto i = last; i != 0; --i) {
@@ -1642,6 +1642,9 @@ void ApiWrap::requestChatMessages(
 	const auto realPeerInput = (splitIndex >= 0)
 		? _chatProcess->info.input
 		: _chatProcess->info.migratedFromInput;
+	const auto outgoingInput = _chatProcess->info.isMonoforum
+		? _chatProcess->info.monoforumBroadcastInput
+		: MTP_inputPeerSelf();
 	const auto realSplitIndex = (splitIndex >= 0)
 		? splitIndex
 		: (splitsCount + splitIndex);
@@ -1650,7 +1653,7 @@ void ApiWrap::requestChatMessages(
 			MTP_flags(MTPmessages_Search::Flag::f_from_id),
 			realPeerInput,
 			MTP_string(), // query
-			MTP_inputPeerSelf(),
+			outgoingInput,
 			MTPInputPeer(), // saved_peer_id
 			MTPVector<MTPReaction>(), // saved_reaction
 			MTPint(), // top_msg_id

Telegram/SourceFiles/history/admin_log/history_admin_log_item.cpp

@@ -111,7 +111,8 @@ std::optional<MTPMessageReplyHeader> PrepareLogReply(
 					MTP_int(topId),
 					MTPstring(), // quote_text
 					MTPVector<MTPMessageEntity>(), // quote_entities
-					MTPint()); // quote_offset
+					MTPint(), // quote_offset
+					MTPint()); // todo_item_id
 			}
 		}
 		return {};

Telegram/SourceFiles/history/history.cpp

@@ -2380,7 +2380,7 @@ Dialogs::UnreadState History::chatListUnreadState() const {
 		return AdjustedForumUnreadState(forum->topicsList()->unreadState());
 	} else if (const auto monoforum = peer->monoforum()) {
 		return AdjustedForumUnreadState(
-			monoforum->unreadStateWithParentMuted());
+			withMyMuted(monoforum->chatsList()->unreadState()));;
 	}
 	return computeUnreadState();
 }
@@ -2395,7 +2395,7 @@ Dialogs::BadgesState History::chatListBadgesState() const {
 	} else if (const auto monoforum = peer->monoforum()) {
 		return adjustBadgesStateByFolder(
 			Dialogs::BadgesForUnread(
-				monoforum->unreadStateWithParentMuted(),
+				withMyMuted(monoforum->chatsList()->unreadState()),
 				Dialogs::CountInBadge::Chats,
 				Dialogs::IncludeInBadge::All));
 	}
@@ -2429,8 +2429,8 @@ Dialogs::UnreadState History::computeUnreadState() const {
 	result.mentions = unreadMentions().has() ? 1 : 0;
 	const auto peer = this->peer.get();
 	const auto &settings = AyuSettings::getInstance();
-	const auto hideReactions = (peer->isChannel() && !peer->isMegagroup() && !settings.hideChannelReactions)
-		|| (peer->isMegagroup() && !settings.hideGroupReactions);
+	const auto hideReactions = (peer->isChannel() && !peer->isMegagroup() && !settings.showChannelReactions)
+		|| (peer->isMegagroup() && !settings.showGroupReactions);
 	result.reactions = hideReactions ? 0 : (unreadReactions().has() ? 1 : 0);
 	result.messagesMuted = muted ? result.messages : 0;
 	result.chatsMuted = muted ? result.chats : 0;
@@ -2440,6 +2440,16 @@ Dialogs::UnreadState History::computeUnreadState() const {
 	return result;
 }
 
+Dialogs::UnreadState History::withMyMuted(Dialogs::UnreadState state) const {
+	if (muted()) {
+		state.chatsMuted = state.chats;
+		state.marksMuted = state.marks;
+		state.messagesMuted = state.messages;
+		state.reactionsMuted = state.reactions;
+	}
+	return state;
+}
+
 void History::allowChatListMessageResolve() {
 	if (_flags & Flag::ResolveChatListMessage) {
 		return;
@@ -3368,7 +3378,8 @@ bool History::isForum() const {
 void History::monoforumChanged(Data::SavedMessages *old) {
 	if (inChatList()) {
 		notifyUnreadStateChange(old
-			? AdjustedForumUnreadState(old->chatsList()->unreadState())
+			? AdjustedForumUnreadState(
+				withMyMuted(old->chatsList()->unreadState()))
 			: computeUnreadState());
 	}
 
@@ -3378,9 +3389,9 @@ void History::monoforumChanged(Data::SavedMessages *old) {
 		monoforum->chatsList()->unreadStateChanges(
 		) | rpl::filter([=] {
 			return (_flags & Flag::IsMonoforumAdmin) && inChatList();
-		}) | rpl::map(
-			AdjustedForumUnreadState
-		) | rpl::start_with_next([=](const Dialogs::UnreadState &old) {
+		}) | rpl::map([=](const Dialogs::UnreadState &was) {
+			return AdjustedForumUnreadState(withMyMuted(was));
+		}) | rpl::start_with_next([=](const Dialogs::UnreadState &old) {
 			notifyUnreadStateChange(old);
 		}, monoforum->lifetime());
 

Telegram/SourceFiles/history/history.h

@@ -602,6 +602,8 @@ private:
 	[[nodiscard]] Dialogs::BadgesState adjustBadgesStateByFolder(
 		Dialogs::BadgesState state) const;
 	[[nodiscard]] Dialogs::UnreadState computeUnreadState() const;
+	[[nodiscard]] Dialogs::UnreadState withMyMuted(
+		Dialogs::UnreadState state) const;
 	void setFolderPointer(Data::Folder *folder);
 
 	void hasUnreadMentionChanged(bool has) override;

Telegram/SourceFiles/history/history_inner_widget.cpp

@@ -674,10 +674,10 @@ void HistoryInner::setupSwipeReplyAndBack() {
 					: still)->fullId();
 				_widget->replyToMessage({
 					.messageId = replyToItemId,
-					.quote = selected.text,
-					.quoteOffset = selected.offset,
+					.quote = selected.highlight.quote,
+					.quoteOffset = selected.highlight.quoteOffset,
 				});
-				if (!selected.text.empty()) {
+				if (!selected.highlight.quote.empty()) {
 					_widget->clearSelected();
 				}
 			};
@@ -1221,8 +1221,8 @@ void HistoryInner::paintEvent(QPaintEvent *e) {
 			if (markingAsViewed && item->hasUnwatchedEffect()) {
 				const auto peer = item->history()->peer;
 				const auto &settings = AyuSettings::getInstance();
-				const auto hide = (!settings.hideChannelReactions && peer->isChannel() && !peer->isMegagroup()) ||
-					(!settings.hideGroupReactions && peer->isMegagroup());
+				const auto hide = (!settings.showChannelReactions && peer->isChannel() && !peer->isMegagroup()) ||
+					(!settings.showGroupReactions && peer->isMegagroup());
 				if (!hide) {
 					startEffects.emplace(view);
 				} else {
@@ -2409,6 +2409,9 @@ void HistoryInner::showContextMenu(QContextMenuEvent *e, bool showFromTouch) {
 	const auto linkUserpicPeerId = (link && _dragStateUserpic)
 		? link->property(kPeerLinkPeerIdProperty).toULongLong()
 		: 0;
+	const auto todoListTaskId = link
+		? link->property(kTodoListItemIdProperty).toInt()
+		: 0;
 	const auto session = &this->session();
 	_whoReactedMenuLifetime.destroy();
 	if (!clickedReaction.empty()
@@ -2777,20 +2780,21 @@ void HistoryInner::showContextMenu(QContextMenuEvent *e, bool showFromTouch) {
 			const auto selected = selectedQuote(item);
 			auto text = (selected
 				? tr::lng_context_quote_and_reply
+				: todoListTaskId
+				? tr::lng_context_reply_to_task
 				: tr::lng_context_reply_msg)(
 					tr::now,
 					Ui::Text::FixAmpersandInAction);
 			const auto replyToItem = selected.item ? selected.item : item;
 			const auto itemId = replyToItem->fullId();
-			const auto quote = selected.text;
-			const auto quoteOffset = selected.offset;
 			_menu->addAction(std::move(text), [=] {
 				_widget->replyToMessage({
 					.messageId = itemId,
-					.quote = quote,
-					.quoteOffset = quoteOffset,
+					.quote = selected.highlight.quote,
+					.quoteOffset = selected.highlight.quoteOffset,
+					.todoItemId = todoListTaskId,
 				});
-				if (!quote.empty()) {
+				if (!selected.highlight.quote.empty()) {
 					_widget->clearSelected();
 				}
 			}, &st::menuIconReply);
@@ -2809,7 +2813,7 @@ void HistoryInner::showContextMenu(QContextMenuEvent *e, bool showFromTouch) {
 					Window::PeerMenuAddTodoListTasks(_controller, item);
 				}
 			}),
-			&st::menuIconCreateTodoList);
+			&st::menuIconAdd);
 	};
 	const auto lnkPhoto = link
 		? reinterpret_cast<PhotoData*>(
@@ -2955,11 +2959,9 @@ void HistoryInner::showContextMenu(QContextMenuEvent *e, bool showFromTouch) {
 			: nullptr;
 		if (sponsored) {
 			Menu::FillSponsored(
-				this,
 				Ui::Menu::CreateAddActionCallback(_menu),
 				controller->uiShow(),
-				sponsored->fullId(),
-				false);
+				sponsored->fullId());
 		}
 		if (isUponSelected > 0) {
 			addReplyAction(item);

Telegram/SourceFiles/history/history_item.cpp

@@ -964,12 +964,26 @@ void HistoryItem::updateServiceDependent(bool force) {
 	}
 
 	if (!dependent->lnk) {
+		auto todoItemId = 0;
+		if (const auto done = Get<HistoryServiceTodoCompletions>()) {
+			const auto &items = !done->completed.empty()
+				? done->completed
+				: done->incompleted;
+			if (items.size() == 1) {
+				todoItemId = items.front();
+			}
+		} else if (const auto append = Get<HistoryServiceTodoAppendTasks>()) {
+			if (append->list.size() == 1) {
+				todoItemId = append->list.front().id;
+			}
+		}
 		dependent->lnk = JumpToMessageClickHandler(
 			(dependent->peerId
 				? _history->owner().peer(dependent->peerId)
 				: _history->peer),
 			dependent->msgId,
-			fullId());
+			fullId(),
+			{ .todoItemId = todoItemId });
 	}
 	auto gotDependencyItem = false;
 	if (!dependent->msg) {
@@ -1316,14 +1330,8 @@ void HistoryItem::setCommentsItemId(FullMsgId id) {
 void HistoryItem::setServiceText(PreparedServiceText &&prepared) {
 	auto text = std::move(prepared.text);
 
-	const auto &settings = AyuSettings::getInstance();
 	if (date() > 0) {
-		const auto timeString = QString(" (%1)").arg(QLocale().toString(
-			base::unixtime::parse(_date),
-			settings.showMessageSeconds
-				? QLocale::system().timeFormat(QLocale::LongFormat).remove(" t")
-				: QLocale::system().timeFormat(QLocale::ShortFormat)
-		));
+		const auto timeString = QString(" (%1)").arg(formatMessageTime(base::unixtime::parse(_date).time()));
 		if (!text.text.isEmpty() && !text.text.contains(timeString)) {
 			text = text.append(timeString);
 		}
@@ -1858,7 +1866,10 @@ bool HistoryItem::isAyuNoForwards() const {
 }
 
 bool HistoryItem::canLookupMessageAuthor() const {
-	return isRegular() && _history->amMonoforumAdmin() && _from->isChannel();
+	return isRegular()
+		&& !isService()
+		&& _history->amMonoforumAdmin()
+		&& _from->isChannel();
 }
 
 bool HistoryItem::skipNotification() const {
@@ -4392,6 +4403,7 @@ void HistoryItem::createComponentsHelper(HistoryItemCommonFields &&fields) {
 			: replyTo.monoforumPeerId
 			? replyTo.monoforumPeerId
 			: PeerId();
+		config.reply.todoItemId = replyTo.todoItemId;
 		const auto replyToTop = replyTo.topicRootId
 			? replyTo.topicRootId
 			: LookupReplyToTop(_history, to);

Telegram/SourceFiles/history/history_item_components.cpp

@@ -390,6 +390,7 @@ ReplyFields ReplyFieldsFromMTP(
 				= data.vreply_to_top_id().value_or(result.messageId.bare);
 			result.topicPost = data.is_forum_topic() ? 1 : 0;
 		}
+		result.todoItemId = data.vtodo_item_id().value_or_empty();
 		if (const auto header = data.vreply_from()) {
 			const auto &data = header->data();
 			result.externalPostAuthor
@@ -704,7 +705,8 @@ auto ReplyMarkupClickHandler::getUrlButton() const
 -> const HistoryMessageMarkupButton* {
 	if (const auto button = getButton()) {
 		using Type = HistoryMessageMarkupButton::Type;
-		if (button->type == Type::Url || button->type == Type::Auth || button->type == Type::Callback) {
+		if (button->type == Type::Url || button->type == Type::Auth || button->type == Type::Callback ||
+			button->type == Type::WebView || button->type == Type::SimpleWebView) {
 			return button;
 		}
 	}

Telegram/SourceFiles/history/history_item_components.h

@@ -277,6 +277,7 @@ struct ReplyFields {
 	MsgId messageId = 0;
 	MsgId topMessageId = 0;
 	StoryId storyId = 0;
+	int todoItemId = 0;
 	uint32 quoteOffset : 30 = 0;
 	uint32 manualQuote : 1 = 0;
 	uint32 topicPost : 1 = 0;

Telegram/SourceFiles/history/history_item_helpers.cpp

@@ -722,22 +722,19 @@ bool IsItemScheduledUntilOnline(not_null<const HistoryItem*> item) {
 ClickHandlerPtr JumpToMessageClickHandler(
 		not_null<HistoryItem*> item,
 		FullMsgId returnToId,
-		TextWithEntities highlightPart,
-		int highlightPartOffsetHint) {
+		MessageHighlightId highlight) {
 	return JumpToMessageClickHandler(
 		item->history()->peer,
 		item->id,
 		returnToId,
-		std::move(highlightPart),
-		highlightPartOffsetHint);
+		std::move(highlight));
 }
 
 ClickHandlerPtr JumpToMessageClickHandler(
 		not_null<PeerData*> peer,
 		MsgId msgId,
 		FullMsgId returnToId,
-		TextWithEntities highlightPart,
-		int highlightPartOffsetHint) {
+		MessageHighlightId highlight) {
 	return std::make_shared<LambdaClickHandler>([=] {
 		const auto separate = Core::App().separateWindowFor(peer);
 		const auto controller = separate
@@ -747,8 +744,7 @@ ClickHandlerPtr JumpToMessageClickHandler(
 			auto params = Window::SectionShow{
 				Window::SectionShow::Way::Forward
 			};
-			params.highlightPart = highlightPart;
-			params.highlightPartOffsetHint = highlightPartOffsetHint;
+			params.highlight = highlight;
 			params.origin = Window::SectionShow::OriginMessage{
 				returnToId
 			};
@@ -910,7 +906,8 @@ MTPMessageReplyHeader NewMessageReplyHeader(const Api::SendAction &action) {
 						| Flag::f_quote_offset))
 				| (quoteEntities.v.empty()
 					? Flag()
-					: Flag::f_quote_entities)),
+					: Flag::f_quote_entities)
+				| (replyTo.todoItemId ? Flag::f_todo_item_id : Flag())),
 			MTP_int(replyTo.messageId.msg),
 			peerToMTP(externalPeerId),
 			MTPMessageFwdHeader(), // reply_from
@@ -918,7 +915,8 @@ MTPMessageReplyHeader NewMessageReplyHeader(const Api::SendAction &action) {
 			MTP_int(replyToTop),
 			MTP_string(replyTo.quote.text),
 			quoteEntities,
-			MTP_int(replyTo.quoteOffset));
+			MTP_int(replyTo.quoteOffset),
+			MTP_int(replyTo.todoItemId));
 	}
 	return MTPMessageReplyHeader();
 }
@@ -1173,8 +1171,8 @@ void CheckReactionNotificationSchedule(
 	}
 	const auto peer = item->history()->peer;
 	const auto &settings = AyuSettings::getInstance();
-	if ((peer->isChannel() && !peer->isMegagroup() && !settings.hideChannelReactions)
-		|| (peer->isMegagroup() && !settings.hideGroupReactions)) {
+	if ((peer->isChannel() && !peer->isMegagroup() && !settings.showChannelReactions)
+		|| (peer->isMegagroup() && !settings.showGroupReactions)) {
 		item->markEffectWatched();
 		return;
 	}

Telegram/SourceFiles/history/history_item_helpers.h

@@ -229,13 +229,11 @@ private:
 	not_null<PeerData*> peer,
 	MsgId msgId,
 	FullMsgId returnToId = FullMsgId(),
-	TextWithEntities highlightPart = {},
-	int highlightPartOffsetHint = 0);
+	MessageHighlightId highlight = {});
 [[nodiscard]] ClickHandlerPtr JumpToMessageClickHandler(
 	not_null<HistoryItem*> item,
 	FullMsgId returnToId = FullMsgId(),
-	TextWithEntities highlightPart = {},
-	int highlightPartOffsetHint = 0);
+	MessageHighlightId highlight = {});
 [[nodiscard]] ClickHandlerPtr JumpToStoryClickHandler(
 	not_null<Data::Story*> story);
 ClickHandlerPtr JumpToStoryClickHandler(

Telegram/SourceFiles/history/history_view_highlight_manager.cpp

@@ -65,6 +65,7 @@ Ui::ChatPaintHighlight ElementHighlighter::state(
 	if (item->fullId() == _highlighted.itemId) {
 		auto result = _animation.state();
 		result.range = _highlighted.part;
+		result.todoItemId = _highlighted.todoListId;
 		return result;
 	}
 	return {};
@@ -82,19 +83,27 @@ ElementHighlighter::Highlight ElementHighlighter::computeHighlight(
 		const auto i = ranges::find(group->items, item);
 		if (i != end(group->items)) {
 			const auto index = int(i - begin(group->items));
-			if (quote.text.empty()) {
+			if (quote.highlight.empty()) {
 				return { leaderId, AddGroupItemSelection({}, index) };
 			} else if (const auto leaderView = _viewForItem(leader)) {
-				return { leaderId, leaderView->selectionFromQuote(quote) };
+				return {
+					leaderId,
+					leaderView->selectionFromQuote(quote),
+					quote.highlight.todoItemId,
+				};
 			}
 		}
-		return { leaderId };
-	} else if (quote.text.empty()) {
-		return { item->fullId() };
+		return { leaderId, {}, quote.highlight.todoItemId };
+	} else if (quote.highlight.quote.empty()) {
+		return { item->fullId(), {}, quote.highlight.todoItemId };
 	} else if (const auto view = _viewForItem(item)) {
-		return { item->fullId(), view->selectionFromQuote(quote) };
+		return {
+			item->fullId(),
+			view->selectionFromQuote(quote),
+			quote.highlight.todoItemId,
+		};
 	}
-	return { item->fullId() };
+	return { item->fullId(), {}, quote.highlight.todoItemId };
 }
 
 void ElementHighlighter::highlight(Highlight data) {
@@ -108,7 +117,7 @@ void ElementHighlighter::highlight(Highlight data) {
 				}
 			}
 			_highlighted = data;
-			_animation.start(!data.part.empty()
+			_animation.start((!data.part.empty() || data.todoListId)
 				&& !IsSubGroupSelection(data.part));
 
 			repaintHighlightedItem(view);

Telegram/SourceFiles/history/history_view_highlight_manager.h

@@ -65,6 +65,7 @@ private:
 	struct Highlight {
 		FullMsgId itemId;
 		TextSelection part;
+		int todoListId = 0;
 
 		explicit operator bool() const {
 			return itemId.operator bool();

Telegram/SourceFiles/history/history_widget.cpp

@@ -68,6 +68,7 @@ https://github.com/telegramdesktop/tdesktop/blob/master/LEGAL
 #include "data/data_changes.h"
 #include "data/data_drafts.h"
 #include "data/data_session.h"
+#include "data/data_todo_list.h"
 #include "data/data_web_page.h"
 #include "data/data_document.h"
 #include "data/data_photo.h"
@@ -1575,12 +1576,21 @@ int HistoryWidget::itemTopForHighlight(
 	const auto heightLeft = (visibleAreaHeight - viewHeight);
 	if (heightLeft >= 0) {
 		return std::max(itemTop - (heightLeft / 2), 0);
-	} else if (const auto sel = itemHighlight(item).range
-		; !sel.empty() && !IsSubGroupSelection(sel)) {
+	} else if (const auto highlight = itemHighlight(item)
+		; (!highlight.range.empty() || highlight.todoItemId)
+			&& !IsSubGroupSelection(highlight.range)) {
+		const auto sel = highlight.range;
 		const auto single = st::messageTextStyle.font->height;
-		const auto begin = HistoryView::FindViewY(view, sel.from) - single;
-		const auto end = HistoryView::FindViewY(view, sel.to, begin + single)
-			+ 2 * single;
+		const auto todoy = sel.empty()
+			? HistoryView::FindViewTaskY(view, highlight.todoItemId)
+			: 0;
+		const auto begin = sel.empty()
+			? (todoy - 4 * single)
+			: HistoryView::FindViewY(view, sel.from) - single;
+		const auto end = sel.empty()
+			? (todoy + 4 * single)
+			: (HistoryView::FindViewY(view, sel.to, begin + single)
+				+ 2 * single);
 		auto result = itemTop;
 		if (end > visibleAreaHeight) {
 			result = std::max(result, itemTop + end - visibleAreaHeight);
@@ -5797,8 +5807,7 @@ void HistoryWidget::switchToSearch(QString query) {
 			const auto item = activation.item;
 			auto params = ::Window::SectionShow(
 				::Window::SectionShow::Way::ClearStack);
-			params.highlightPart = { activation.query };
-			params.highlightPartOffsetHint = kSearchQueryOffsetHint;
+			params.highlight = Window::SearchHighlightId(activation.query);
 			controller()->showPeerHistory(
 				item->history()->peer->id,
 				params,
@@ -6907,8 +6916,7 @@ int HistoryWidget::countInitialScrollTop() {
 
 			enqueueMessageHighlight({
 				item,
-				base::take(_showAtMsgParams.highlightPart),
-				base::take(_showAtMsgParams.highlightPartOffsetHint),
+				base::take(_showAtMsgParams.highlight),
 			});
 			const auto result = itemTopForHighlight(view);
 			createUnreadBarIfBelowVisibleArea(result);
@@ -7670,12 +7678,7 @@ void HistoryWidget::editDraftOptions() {
 
 void HistoryWidget::jumpToReply(FullReplyTo to) {
 	if (const auto item = session().data().message(to.messageId)) {
-		JumpToMessageClickHandler(
-			item,
-			{},
-			to.quote,
-			to.quoteOffset
-		)->onClick({});
+		JumpToMessageClickHandler(item, {}, to.highlight())->onClick({});
 	}
 }
 
@@ -8718,7 +8721,7 @@ void HistoryWidget::clearFieldText(
 void HistoryWidget::replyToMessage(FullReplyTo id) {
 	if (const auto item = session().data().message(id.messageId)) {
 		if (CanSendReply(item) && !base::IsCtrlPressed()) {
-			replyToMessage(item, id.quote, id.quoteOffset);
+			replyToMessage(item, id);
 		} else if (item->allowsForward()) {
 			const auto show = controller()->uiShow();
 			HistoryView::Controls::ShowReplyToChatBox(show, id);
@@ -8731,16 +8734,12 @@ void HistoryWidget::replyToMessage(FullReplyTo id) {
 
 void HistoryWidget::replyToMessage(
 		not_null<HistoryItem*> item,
-		TextWithEntities quote,
-		int quoteOffset) {
+		FullReplyTo fields) {
 	if (isJoinChannel()) {
 		return;
 	}
-	_processingReplyTo = {
-		.messageId = item->fullId(),
-		.quote = quote,
-		.quoteOffset = quoteOffset,
-	};
+	fields.messageId = item->fullId();
+	_processingReplyTo = fields;
 	_processingReplyItem = item;
 	processReply();
 }
@@ -9429,11 +9428,24 @@ void HistoryWidget::updateReplyEditText(not_null<HistoryItem*> item) {
 		.session = &session(),
 		.repaint = [=] { updateField(); },
 	});
+	const auto text = [&] {
+		const auto media = _replyTo.todoItemId ? item->media() : nullptr;
+		if (const auto todolist = media ? media->todolist() : nullptr) {
+			const auto i = ranges::find(
+				todolist->items,
+				_replyTo.todoItemId,
+				&TodoListItem::id);
+			if (i != end(todolist->items)) {
+				return i->text;
+			}
+		}
+		return (_editMsgId || _replyTo.quote.empty())
+			? item->inReplyText()
+			: _replyTo.quote;
+	}();
 	_replyEditMsgText.setMarkedText(
 		st::defaultTextStyle,
-		((_editMsgId || _replyTo.quote.empty())
-			? item->inReplyText()
-			: _replyTo.quote),
+		text,
 		Ui::DialogTextOptions(),
 		context);
 	if (fieldOrDisabledShown() || isRecording()) {
@@ -9519,10 +9531,9 @@ void HistoryWidget::updateReplyToName() {
 		.customEmojiLoopLimit = 1,
 	});
 	const auto to = _replyEditMsg ? _replyEditMsg : _kbReplyTo;
-	const auto replyToQuote = _replyTo && !_replyTo.quote.empty();
 	_replyToName.setMarkedText(
 		st::fwdTextStyle,
-		HistoryView::Reply::ComposePreviewName(_history, to, replyToQuote),
+		HistoryView::Reply::ComposePreviewName(_history, to, _replyTo),
 		Ui::NameTextOptions(),
 		context);
 }

Telegram/SourceFiles/history/history_widget.h

@@ -205,8 +205,7 @@ public:
 	void replyToMessage(FullReplyTo id);
 	void replyToMessage(
 		not_null<HistoryItem*> item,
-		TextWithEntities quote = {},
-		int quoteOffset = 0);
+		FullReplyTo fields = {});
 	void editMessage(
 		not_null<HistoryItem*> item,
 		const TextSelection &selection);

Telegram/SourceFiles/history/view/controls/history_view_compose_controls.cpp

@@ -92,6 +92,10 @@ https://github.com/telegramdesktop/tdesktop/blob/master/LEGAL
 #include "styles/style_chat_helpers.h"
 #include "styles/style_menu_icons.h"
 
+// AyuGram includes
+#include "ayu/ayu_settings.h"
+
+
 namespace HistoryView {
 namespace {
 
@@ -119,6 +123,13 @@ using SetHistoryArgs = ComposeControls::SetHistoryArgs;
 using VoiceRecordBar = Controls::VoiceRecordBar;
 using ForwardPanel = Controls::ForwardPanel;
 
+#define SWITCH_BUTTON(button, show_v) \
+	if (show_v) { \
+		(button)->show(); \
+	} else { \
+		(button)->hide(); \
+	}
+
 } // namespace
 
 const ChatHelpers::PauseReason kDefaultPanelsLevel
@@ -492,10 +503,9 @@ void FieldHeader::setShownMessage(HistoryItem *item) {
 			.customEmojiLoopLimit = 1,
 		});
 		const auto replyTo = _replyTo.current();
-		const auto quote = replyTo && !replyTo.quote.empty();
 		_shownMessageName.setMarkedText(
 			st::fwdTextStyle,
-			HistoryView::Reply::ComposePreviewName(_history, item, quote),
+			HistoryView::Reply::ComposePreviewName(_history, item, replyTo),
 			Ui::NameTextOptions(),
 			context);
 	} else {
@@ -1595,6 +1605,14 @@ void ComposeControls::init() {
 		updateAttachBotsMenu();
 	}, _wrap->lifetime());
 
+	AyuSettings::get_historyUpdateReactive() | rpl::start_with_next([=]
+	{
+		updateSendButtonType();
+		updateControlsVisibility();
+		updateControlsGeometry(_wrap->size());
+		orderControls();
+	}, _wrap->lifetime());
+
 	orderControls();
 }
 
@@ -1604,6 +1622,11 @@ void ComposeControls::orderControls() {
 }
 
 bool ComposeControls::showRecordButton() const {
+	const auto &settings = AyuSettings::getInstance();
+	if (!settings.showMicrophoneButtonInMessageField) {
+		return false;
+	}
+
 	return (_recordAvailability != Webrtc::RecordAvailability::None)
 		&& !_voiceRecordBar->isListenState()
 		&& !_voiceRecordBar->isRecordingByAnotherBar()
@@ -2686,17 +2709,19 @@ void ComposeControls::updateControlsGeometry(QSize size) {
 	// (_attachToggle|_replaceMedia) (_sendAs) -- _inlineResults ------ _tabbedPanel -- _fieldBarCancel
 	// (_attachDocument|_attachPhoto) _field (_ttlInfo) (_scheduled) (_silent|_botCommandStart) _tabbedSelectorToggle _send
 
+	const auto &settings = AyuSettings::getInstance();
+
 	const auto fieldWidth = size.width()
-		- _attachToggle->width()
+		- (settings.showAttachButtonInMessageField ? _attachToggle->width() : 0)
 		- (_sendAs ? _sendAs->width() : 0)
 		- st::historySendRight
 		- _send->width()
-		- _tabbedSelectorToggle->width()
+		- (settings.showEmojiButtonInMessageField ? _tabbedSelectorToggle->width() : 0)
 		- (_likeShown ? _like->width() : 0)
-		- (_botCommandShown ? _botCommandStart->width() : 0)
+		- (_botCommandShown && settings.showCommandsButtonInMessageField ? _botCommandStart->width() : 0)
 		- (_silent ? _silent->width() : 0)
 		- (_scheduled ? _scheduled->width() : 0)
-		- (_ttlInfo ? _ttlInfo->width() : 0);
+		- (_ttlInfo && settings.showAutoDeleteButtonInMessageField ? _ttlInfo->width() : 0);
 	{
 		const auto oldFieldHeight = _field->height();
 		_field->resizeToWidth(fieldWidth);
@@ -2713,8 +2738,10 @@ void ComposeControls::updateControlsGeometry(QSize size) {
 	if (_replaceMedia) {
 		_replaceMedia->moveToLeft(left, buttonsTop);
 	}
-	_attachToggle->moveToLeft(left, buttonsTop);
-	left += _attachToggle->width();
+	if (settings.showAttachButtonInMessageField) {
+		_attachToggle->moveToLeft(left, buttonsTop);
+		left += _attachToggle->width();
+	}
 	if (_sendAs) {
 		_sendAs->moveToLeft(left, buttonsTop);
 		left += _sendAs->width();
@@ -2731,8 +2758,10 @@ void ComposeControls::updateControlsGeometry(QSize size) {
 	auto right = st::historySendRight;
 	_send->moveToRight(right, buttonsTop);
 	right += _send->width();
-	_tabbedSelectorToggle->moveToRight(right, buttonsTop);
-	right += _tabbedSelectorToggle->width();
+	if (settings.showEmojiButtonInMessageField) {
+		_tabbedSelectorToggle->moveToRight(right, buttonsTop);
+		right += _tabbedSelectorToggle->width();
+	}
 	if (_like) {
 		using Type = Controls::WriteRestrictionType;
 		if (_writeRestriction.current().type == Type::PremiumRequired) {
@@ -2746,7 +2775,7 @@ void ComposeControls::updateControlsGeometry(QSize size) {
 	}
 	if (_botCommandStart) {
 		_botCommandStart->moveToRight(right, buttonsTop);
-		if (_botCommandShown) {
+		if (_botCommandShown && settings.showCommandsButtonInMessageField) {
 			right += _botCommandStart->width();
 		}
 	}
@@ -2758,7 +2787,7 @@ void ComposeControls::updateControlsGeometry(QSize size) {
 		_scheduled->moveToRight(right, buttonsTop);
 		right += _scheduled->width();
 	}
-	if (_ttlInfo) {
+	if (_ttlInfo && settings.showAutoDeleteButtonInMessageField) {
 		_ttlInfo->move(size.width() - right - _ttlInfo->width(), buttonsTop);
 	}
 
@@ -2769,14 +2798,16 @@ void ComposeControls::updateControlsGeometry(QSize size) {
 }
 
 void ComposeControls::updateControlsVisibility() {
+	const auto &settings = AyuSettings::getInstance();
+
 	if (_botCommandStart) {
-		_botCommandStart->setVisible(_botCommandShown);
+		SWITCH_BUTTON(_botCommandStart, _botCommandShown && settings.showCommandsButtonInMessageField);
 	}
 	if (_like) {
 		_like->setVisible(_likeShown);
 	}
 	if (_ttlInfo) {
-		_ttlInfo->show();
+		SWITCH_BUTTON(_ttlInfo, settings.showAutoDeleteButtonInMessageField);
 	}
 	if (_sendAs) {
 		_sendAs->show();
@@ -2785,11 +2816,12 @@ void ComposeControls::updateControlsVisibility() {
 		_replaceMedia->show();
 		_attachToggle->hide();
 	} else {
-		_attachToggle->show();
+		SWITCH_BUTTON(_attachToggle, settings.showAttachButtonInMessageField);
 	}
 	if (_scheduled) {
 		_scheduled->setVisible(!isEditingMessage());
 	}
+	SWITCH_BUTTON(_tabbedSelectorToggle, settings.showEmojiButtonInMessageField);
 }
 
 bool ComposeControls::updateLikeShown() {

Telegram/SourceFiles/history/view/controls/history_view_draft_options.cpp

@@ -718,8 +718,7 @@ void DraftOptionsBox(
 	state->link = args.usedLink;
 	state->quote = SelectedQuote{
 		replyItem,
-		draft.reply.quote,
-		draft.reply.quoteOffset,
+		{ draft.reply.quote, draft.reply.quoteOffset },
 	};
 	state->forward = std::move(args.forward);
 	state->webpage = draft.webpage;
@@ -783,7 +782,7 @@ void DraftOptionsBox(
 			box->setTitle(hasLink
 				? tr::lng_link_options_header()
 				: hasReply
-				? (state->quote.current().text.empty()
+				? (state->quote.current().highlight.quote.empty()
 					? tr::lng_reply_options_header()
 					: tr::lng_reply_options_quote())
 				: (forwardCount == 1)
@@ -807,10 +806,12 @@ void DraftOptionsBox(
 		auto result = draft.reply;
 		if (const auto current = state->quote.current()) {
 			result.messageId = current.item->fullId();
-			result.quote = current.text;
-			result.quoteOffset = current.offset;
+			result.quote = current.highlight.quote;
+			result.quoteOffset = current.highlight.quoteOffset;
+//			result.todoItemId = current.highlight.todoItemId;
 		} else {
 			result.quote = {};
+//			result.todoItemId = 0;
 		}
 		return result;
 	};
@@ -1112,7 +1113,7 @@ void DraftOptionsBox(
 		state->quote.value(),
 		state->shown.value()
 	) | rpl::map([=](const SelectedQuote &quote, Section shown) {
-		return (quote.text.empty() || shown != Section::Reply)
+		return (quote.highlight.quote.empty() || shown != Section::Reply)
 			? tr::lng_settings_save()
 			: tr::lng_reply_quote_selected();
 	}) | rpl::flatten_latest();

Telegram/SourceFiles/history/view/history_view_bottom_info.cpp

@@ -36,6 +36,7 @@ https://github.com/telegramdesktop/tdesktop/blob/master/LEGAL
 // AyuGram includes
 #include "ayu/ayu_settings.h"
 #include "ayu/features/messageshot/message_shot.h"
+#include "ayu/utils/telegram_helpers.h"
 #include "core/ui_integration.h"
 #include "styles/style_ayu_icons.h"
 
@@ -428,12 +429,7 @@ void BottomInfo::layoutDateText() {
 			: QString();
 		const auto author = _data.author;
 		const auto prefix = !author.isEmpty() ? u", "_q : QString();
-		const auto date = edited + QLocale().toString(
-			_data.date.time(),
-			settings.showMessageSeconds
-				? QLocale::system().timeFormat(QLocale::LongFormat).remove(" t")
-				: QLocale::system().timeFormat(QLocale::ShortFormat)
-		);
+		const auto date = edited + formatMessageTime(_data.date.time());
 		const auto afterAuthor = prefix + date;
 		const auto afterAuthorWidth = st::msgDateFont->width(afterAuthor);
 		const auto authorWidth = st::msgDateFont->width(author);
@@ -494,12 +490,9 @@ void BottomInfo::layoutDateText() {
 		const auto author = _data.author;
 		const auto prefix = !author.isEmpty() ? (_data.flags & Data::Flag::Edited ? u" "_q : u", "_q) : QString();
 
-		const auto date = TextWithEntities{}.append(edited).append(QLocale().toString(
-			_data.date.time(),
-			settings.showMessageSeconds
-				? QLocale::system().timeFormat(QLocale::LongFormat).remove(" t")
-				: QLocale::system().timeFormat(QLocale::ShortFormat)
-		));
+		const auto date = TextWithEntities{}
+			.append(edited)
+			.append(formatMessageTime(_data.date.time()));
 
 		const auto afterAuthor = TextWithEntities{}.append(prefix).append(date);
 		const auto afterAuthorWidth = st::msgDateFont->width(afterAuthor.text);

Telegram/SourceFiles/history/view/history_view_chat_section.cpp

@@ -123,12 +123,10 @@ rpl::producer<Ui::MessageBarContent> RootViewContent(
 ChatMemento::ChatMemento(
 	ChatViewId id,
 	MsgId highlightId,
-	const TextWithEntities &highlightPart,
-	int highlightPartOffsetHint)
+	MessageHighlightId highlight)
 : _id(id)
-, _highlightPart(highlightPart)
-, _highlightPartOffsetHint(highlightPartOffsetHint)
-, _highlightId(highlightId) {
+, _highlightId(highlightId)
+, _highlight(std::move(highlight)) {
 	if (highlightId || _id.sublist) {
 		_list.setAroundPosition({
 			.fullId = FullMsgId(_id.history->peer->id, highlightId),
@@ -884,12 +882,7 @@ void ChatWidget::setupComposeControls() {
 	_composeControls->jumpToItemRequests(
 	) | rpl::start_with_next([=](FullReplyTo to) {
 		if (const auto item = session().data().message(to.messageId)) {
-			JumpToMessageClickHandler(
-				item,
-				{},
-				to.quote,
-				to.quoteOffset
-			)->onClick({});
+			JumpToMessageClickHandler(item, {}, to.highlight())->onClick({});
 		}
 	}, lifetime());
 
@@ -1047,8 +1040,9 @@ void ChatWidget::setupSwipeReplyAndBack() {
 				: still)->fullId();
 			_inner->replyToMessageRequestNotify({
 				.messageId = replyToItemId,
-				.quote = selected.text,
-				.quoteOffset = selected.offset,
+				.quote = selected.highlight.quote,
+				.quoteOffset = selected.highlight.quoteOffset,
+				.todoItemId = selected.highlight.todoItemId,
 			});
 		};
 		return result;
@@ -2648,8 +2642,7 @@ void ChatWidget::restoreState(not_null<ChatMemento*> memento) {
 		auto params = Window::SectionShow(
 			Window::SectionShow::Way::Forward,
 			anim::type::instant);
-		params.highlightPart = memento->highlightPart();
-		params.highlightPartOffsetHint = memento->highlightPartOffsetHint();
+		params.highlight = memento->highlight();
 		showAtPosition(Data::MessagePosition{
 			.fullId = FullMsgId(_peer->id, highlight),
 			.date = TimeId(0),
@@ -3452,8 +3445,7 @@ bool ChatWidget::searchInChatEmbedded(
 		const auto item = activation.item;
 		auto params = ::Window::SectionShow(
 			::Window::SectionShow::Way::ClearStack);
-		params.highlightPart = { activation.query };
-		params.highlightPartOffsetHint = kSearchQueryOffsetHint;
+		params.highlight = Window::SearchHighlightId(activation.query);
 		controller()->showPeerHistory(
 			item->history()->peer->id,
 			params,

Telegram/SourceFiles/history/view/history_view_chat_section.h

@@ -461,8 +461,7 @@ public:
 	explicit ChatMemento(
 		ChatViewId id,
 		MsgId highlightId = 0,
-		const TextWithEntities &highlightPart = {},
-		int highlightPartOffsetHint = 0);
+		MessageHighlightId highlight = {});
 
 	struct Comments {
 	};
@@ -511,20 +510,16 @@ public:
 	[[nodiscard]] MsgId highlightId() const {
 		return _highlightId;
 	}
-	[[nodiscard]] const TextWithEntities &highlightPart() const {
-		return _highlightPart;
-	}
-	[[nodiscard]] int highlightPartOffsetHint() const {
-		return _highlightPartOffsetHint;
+	[[nodiscard]] const MessageHighlightId &highlight() const {
+		return _highlight;
 	}
 
 private:
 	void setupTopicViewer();
 
 	ChatViewId _id;
-	const TextWithEntities _highlightPart;
-	const int _highlightPartOffsetHint = 0;
 	const MsgId _highlightId = 0;
+	const MessageHighlightId _highlight;
 	ListMemento _list;
 	std::shared_ptr<Data::RepliesList> _replies;
 	QVector<FullMsgId> _replyReturns;

Telegram/SourceFiles/history/view/history_view_context_menu.cpp

@@ -644,8 +644,13 @@ bool AddReplyToMessageAction(
 		return false;
 	}
 
+	const auto todoListTaskId = request.link
+		? request.link->property(kTodoListItemIdProperty).toInt()
+		: 0;
 	const auto &quote = request.quote;
-	auto text = (quote.text.empty()
+	auto text = (todoListTaskId
+		? tr::lng_context_reply_to_task
+		: quote.highlight.quote.empty()
 		? tr::lng_context_reply_msg
 		: tr::lng_context_quote_and_reply)(
 			tr::now,
@@ -653,8 +658,9 @@ bool AddReplyToMessageAction(
 	menu->addAction(std::move(text), [=, itemId = item->fullId()] {
 		list->replyToMessageRequestNotify({
 			.messageId = itemId,
-			.quote = quote.text,
-			.quoteOffset = quote.offset,
+			.quote = quote.highlight.quote,
+			.quoteOffset = quote.highlight.quoteOffset,
+			.todoItemId = todoListTaskId,
 		}, base::IsCtrlPressed());
 	}, &st::menuIconReply);
 	return true;
@@ -680,7 +686,7 @@ bool AddTodoListAction(
 		if (const auto item = controller->session().data().message(itemId)) {
 			Window::PeerMenuAddTodoListTasks(controller, item);
 		}
-	}, &st::menuIconCreateTodoList);
+	}, &st::menuIconAdd);
 	return true;
 }
 

Telegram/SourceFiles/history/view/history_view_element.cpp

@@ -46,6 +46,7 @@ https://github.com/telegramdesktop/tdesktop/blob/master/LEGAL
 #include "data/data_channel.h"
 #include "data/data_saved_sublist.h"
 #include "data/data_session.h"
+#include "data/data_todo_list.h"
 #include "data/data_forum.h"
 #include "data/data_forum_topic.h"
 #include "data/data_message_reactions.h"
@@ -1360,9 +1361,18 @@ void Element::validateText() {
 
 		if (const auto done = item->Get<HistoryServiceTodoCompletions>()) {
 			if (!done->completed.empty() && !done->incompleted.empty()) {
+				const auto todoItemId = (done->incompleted.size() == 1)
+					? done->incompleted.front()
+					: 0;
 				setServicePreMessage(
 					item->composeTodoIncompleted(done),
-					done->lnk);
+					JumpToMessageClickHandler(
+						(done->peerId
+							? history()->owner().peer(done->peerId)
+							: history()->peer),
+						done->msgId,
+						item->fullId(),
+						{ .todoItemId = todoItemId }));
 			} else {
 				setServicePreMessage({});
 			}
@@ -2205,7 +2215,7 @@ SelectedQuote Element::FindSelectedQuote(
 			++i;
 		}
 	}
-	return { item, result, modified.from, overflown };
+	return { item, { result, modified.from }, overflown };
 }
 
 TextSelection Element::FindSelectionFromQuote(
@@ -2213,17 +2223,18 @@ TextSelection Element::FindSelectionFromQuote(
 		const SelectedQuote &quote) {
 	Expects(quote.item != nullptr);
 
-	if (quote.text.empty()) {
+	const auto &rich = quote.highlight.quote;
+	if (rich.empty()) {
 		return {};
 	}
 	const auto &original = quote.item->originalText();
-	if (quote.offset == kSearchQueryOffsetHint) {
+	if (quote.highlight.quoteOffset == kSearchQueryOffsetHint) {
 		return ApplyModificationsFrom(
-			FindSearchQueryHighlight(original.text, quote.text.text),
+			FindSearchQueryHighlight(original.text, rich.text),
 			text);
 	}
 	const auto length = int(original.text.size());
-	const auto qlength = int(quote.text.text.size());
+	const auto qlength = int(rich.text.size());
 	const auto checkAt = [&](int offset) {
 		return TextSelection{
 			uint16(offset),
@@ -2234,7 +2245,7 @@ TextSelection Element::FindSelectionFromQuote(
 		if (offset > length - qlength) {
 			return TextSelection();
 		}
-		const auto i = original.text.indexOf(quote.text.text, offset);
+		const auto i = original.text.indexOf(rich.text, offset);
 		return (i >= 0) ? checkAt(i) : TextSelection();
 	};
 	const auto findOneBefore = [&](int offset) {
@@ -2243,7 +2254,7 @@ TextSelection Element::FindSelectionFromQuote(
 		}
 		const auto end = std::min(offset + qlength - 1, length);
 		const auto from = end - length - 1;
-		const auto i = original.text.lastIndexOf(quote.text.text, from);
+		const auto i = original.text.lastIndexOf(rich.text, from);
 		return (i >= 0) ? checkAt(i) : TextSelection();
 	};
 	const auto findAfter = [&](int offset) {
@@ -2281,7 +2292,7 @@ TextSelection Element::FindSelectionFromQuote(
 			? before
 			: after;
 	};
-	auto result = findTwoWays(quote.offset);
+	auto result = findTwoWays(quote.highlight.quoteOffset);
 	if (result.empty()) {
 		return {};
 	}
@@ -2468,6 +2479,70 @@ int FindViewY(not_null<Element*> view, uint16 symbol, int yfrom) {
 	return origin.y() + (yfrom + ytill) / 2;
 }
 
+int FindViewTaskY(not_null<Element*> view, int taskId, int yfrom) {
+	auto request = HistoryView::StateRequest();
+	request.flags = Ui::Text::StateRequest::Flag::LookupLink;
+	const auto single = st::messageTextStyle.font->height;
+	const auto inner = view->innerGeometry();
+	const auto origin = inner.topLeft();
+	const auto top = 0;
+	const auto bottom = view->height();
+	if (origin.y() < top
+		|| origin.y() + inner.height() > bottom
+		|| inner.height() <= 0) {
+		return yfrom;
+	}
+	const auto media = view->data()->media();
+	const auto todolist = media ? media->todolist() : nullptr;
+	if (!todolist) {
+		return yfrom;
+	}
+	const auto &items = todolist->items;
+	const auto indexOf = [&](int id) -> int {
+		return ranges::find(items, id, &TodoListItem::id) - begin(items);
+	};
+	const auto index = indexOf(taskId);
+	const auto count = int(items.size());
+	if (index == count) {
+		return yfrom;
+	}
+	yfrom = std::max(yfrom - origin.y(), 0);
+	auto ytill = inner.height() - 1;
+	const auto middle = (yfrom + ytill) / 2;
+	const auto fory = [&](int y) {
+		const auto state = view->textState(origin + QPoint(0, y), request);
+		const auto &link = state.link;
+		const auto id = link
+			? link->property(kTodoListItemIdProperty).toInt()
+			: -1;
+		const auto index = (id >= 0) ? indexOf(id) : int(items.size());
+		return (index < count) ? index : (y < middle) ? -1 : count;
+	};
+	auto indexfrom = fory(yfrom);
+	auto indextill = fory(ytill);
+	if ((yfrom >= ytill) || (indexfrom >= index)) {
+		return origin.y() + yfrom;
+	} else if (indextill <= index) {
+		return origin.y() + ytill;
+	}
+	while (ytill - yfrom >= 2 * single) {
+		const auto middle = (yfrom + ytill) / 2;
+		const auto found = fory(middle);
+		if (found == index
+			|| indexfrom > found
+			|| indextill < found) {
+			return origin.y() + middle;
+		} else if (found < index) {
+			yfrom = middle;
+			indexfrom = found;
+		} else {
+			ytill = middle;
+			indextill = found;
+		}
+	}
+	return origin.y() + (yfrom + ytill) / 2;
+}
+
 Window::SessionController *ExtractController(const ClickContext &context) {
 	const auto my = context.other.value<ClickHandlerContext>();
 	if (const auto controller = my.sessionWindow.get()) {

Telegram/SourceFiles/history/view/history_view_element.h

@@ -357,12 +357,11 @@ struct TopicButton {
 
 struct SelectedQuote {
 	HistoryItem *item = nullptr;
-	TextWithEntities text;
-	int offset = 0;
+	MessageHighlightId highlight;
 	bool overflown = false;
 
 	explicit operator bool() const {
-		return item && !text.empty();
+		return item && !highlight.quote.empty();
 	}
 	friend inline bool operator==(SelectedQuote, SelectedQuote) = default;
 };
@@ -748,6 +747,11 @@ private:
 	uint16 symbol,
 	int yfrom = 0);
 
+[[nodiscard]] int FindViewTaskY(
+	not_null<Element*> view,
+	int taskId,
+	int yfrom = 0);
+
 [[nodiscard]] Window::SessionController *ExtractController(
 	const ClickContext &context);
 

Telegram/SourceFiles/history/view/history_view_list_widget.cpp

@@ -720,12 +720,21 @@ std::optional<int> ListWidget::scrollTopForView(
 	const auto heightLeft = (available - height);
 	if (heightLeft >= 0) {
 		return std::max(top - (heightLeft / 2), 0);
-	} else if (const auto sel = _highlighter.state(view->data()).range
-		; !sel.empty() && !IsSubGroupSelection(sel)) {
+	} else if (const auto highlight = _highlighter.state(view->data())
+		; (!highlight.range.empty() || highlight.todoItemId)
+		&& !IsSubGroupSelection(highlight.range)) {
+		const auto sel = highlight.range;
 		const auto single = st::messageTextStyle.font->height;
-		const auto begin = HistoryView::FindViewY(view, sel.from) - single;
-		const auto end = HistoryView::FindViewY(view, sel.to, begin + single)
-			+ 2 * single;
+		const auto todoy = sel.empty()
+			? HistoryView::FindViewTaskY(view, highlight.todoItemId)
+			: 0;
+		const auto begin = sel.empty()
+			? (todoy - 4 * single)
+			: HistoryView::FindViewY(view, sel.from) - single;
+		const auto end = sel.empty()
+			? (todoy + 4 * single)
+			: (HistoryView::FindViewY(view, sel.to, begin + single)
+				+ 2 * single);
 		auto result = top;
 		if (end > available) {
 			result = std::max(result, top + end - available);
@@ -822,10 +831,9 @@ bool ListWidget::isBelowPosition(Data::MessagePosition position) const {
 
 void ListWidget::highlightMessage(
 		FullMsgId itemId,
-		const TextWithEntities &part,
-		int partOffsetHint) {
+		const MessageHighlightId &highlight) {
 	if (const auto view = viewForItem(itemId)) {
-		_highlighter.highlight({ view->data(), part, partOffsetHint });
+		_highlighter.highlight({ view->data(), highlight });
 	}
 }
 
@@ -903,11 +911,8 @@ bool ListWidget::showAtPositionNow(
 	}
 	if (position != Data::MaxMessagePosition
 		&& position != Data::UnreadMessagePosition) {
-		const auto hasHighlight = !params.highlightPart.empty();
-		highlightMessage(
-			position.fullId,
-			params.highlightPart,
-			params.highlightPartOffsetHint);
+		const auto hasHighlight = !params.highlight.empty();
+		highlightMessage(position.fullId, params.highlight);
 		if (hasHighlight) {
 			// We may want to scroll to a different part of the message.
 			scrollTop = scrollTopForPosition(position);

Telegram/SourceFiles/history/view/history_view_list_widget.h

@@ -314,8 +314,7 @@ public:
 	bool isBelowPosition(Data::MessagePosition position) const;
 	void highlightMessage(
 		FullMsgId itemId,
-		const TextWithEntities &part,
-		int partOffsetHint);
+		const MessageHighlightId &highlight);
 
 	void showAtPosition(
 		Data::MessagePosition position,

Telegram/SourceFiles/history/view/history_view_message.cpp

@@ -490,6 +490,8 @@ void Message::initPaidInformation() {
 			refreshSuggestedInfo(item, suggest, replyData);
 		}
 		return;
+	} else if (!item->history()->peer->isUser()) {
+		return;
 	}
 	const auto media = this->media();
 	const auto mine = PaidInformation{
@@ -3348,7 +3350,7 @@ TextSelection Message::selectionFromQuote(
 		const SelectedQuote &quote) const {
 	Expects(quote.item != nullptr);
 
-	if (quote.text.empty()) {
+	if (quote.highlight.quote.empty()) {
 		return {};
 	}
 	const auto item = quote.item;

Telegram/SourceFiles/history/view/history_view_reply.cpp

@@ -14,6 +14,7 @@ https://github.com/telegramdesktop/tdesktop/blob/master/LEGAL
 #include "data/data_peer.h"
 #include "data/data_session.h"
 #include "data/data_story.h"
+#include "data/data_todo_list.h"
 #include "data/data_user.h"
 #include "history/view/history_view_item_preview.h"
 #include "history/history.h"
@@ -42,6 +43,85 @@ namespace {
 
 constexpr auto kNonExpandedLinesLimit = 5;
 
+[[nodiscard]] QImage MakeTaskImage() {
+	const auto diameter = st::normalFont->ascent;
+	const auto line = st::historyPollRadio.thickness;
+	const auto size = 2 * line + diameter;
+	const auto ratio = style::DevicePixelRatio();
+	auto result = QImage(
+		QSize(size, size) * ratio,
+		QImage::Format_ARGB32_Premultiplied);
+	result.fill(Qt::transparent);
+	result.setDevicePixelRatio(ratio);
+
+	auto p = QPainter(&result);
+	PainterHighQualityEnabler hq(p);
+
+	p.setOpacity(st::historyPollRadioOpacity);
+
+	const auto rect = QRectF(line, line, diameter, diameter).marginsRemoved(
+		QMarginsF(line / 2., line / 2., line / 2., line / 2.));
+	auto pen = QPen(QColor(255, 255, 255));
+	pen.setWidth(line);
+	p.setPen(pen);
+	p.drawEllipse(rect);
+
+	p.end();
+
+	return result;
+}
+
+[[nodiscard]] QImage MakeTaskDoneImage() {
+	const auto white = QColor(255, 255, 255);
+	const auto black = QColor(0, 0, 0);
+
+	const auto diameter = st::normalFont->ascent;
+	const auto line = st::historyPollRadio.thickness;
+	const auto size = 2 * line + diameter;
+	const auto ratio = style::DevicePixelRatio();
+	auto result = QImage(
+		QSize(size, size) * ratio,
+		QImage::Format_ARGB32_Premultiplied);
+	result.fill(black);
+	result.setDevicePixelRatio(ratio);
+
+	auto p = QPainter(&result);
+	PainterHighQualityEnabler hq(p);
+
+	const auto rect = QRectF(line, line, diameter, diameter).marginsRemoved(
+		QMarginsF(line / 2., line / 2., line / 2., line / 2.));
+	auto pen = QPen(white);
+	pen.setWidth(line);
+	p.setPen(pen);
+	p.setBrush(white);
+	p.drawEllipse(rect);
+	const auto &icon = st::historyPollInChoiceRight;
+	icon.paint(
+		p,
+		line + (diameter - icon.width()) / 2,
+		line + (diameter - icon.height()) / 2,
+		size,
+		black);
+	p.end();
+
+	return style::colorizeImage(result, white);
+}
+
+[[nodiscard]] TextWithEntities TaskDoneIcon(
+		not_null<Main::Session*> session) {
+	return Ui::Text::SingleCustomEmoji(
+		session->data().customEmojiManager().registerInternalEmoji(
+			MakeTaskDoneImage(),
+			QMargins(0, st::lineWidth, st::lineWidth, 0)));
+}
+
+[[nodiscard]] TextWithEntities TaskIcon(not_null<Main::Session*> session) {
+	return Ui::Text::SingleCustomEmoji(
+		session->data().customEmojiManager().registerInternalEmoji(
+			MakeTaskImage(),
+			QMargins(0, st::lineWidth, st::lineWidth, 0)));
+}
+
 } // namespace
 
 void ValidateBackgroundEmoji(
@@ -197,6 +277,22 @@ void Reply::update(
 	const auto item = view->data();
 	const auto &fields = data->fields();
 	const auto message = data->resolvedMessage.get();
+	const auto messageMedia = (message && fields.todoItemId)
+		? message->media()
+		: nullptr;
+	const auto messageTodoList = messageMedia
+		? messageMedia->todolist()
+		: nullptr;
+	const auto taskIndex = messageTodoList
+		? int(ranges::find(
+			messageTodoList->items,
+			fields.todoItemId,
+			&TodoListItem::id) - begin(messageTodoList->items))
+		: -1;
+	const auto task = (taskIndex >= 0
+		&& taskIndex < messageTodoList->items.size())
+		? &messageTodoList->items[taskIndex]
+		: nullptr;
 	const auto story = data->resolvedStory.get();
 	const auto externalMedia = fields.externalMedia.get();
 	if (!_externalSender) {
@@ -214,7 +310,6 @@ void Reply::update(
 	_hiddenSenderColorIndexPlusOne = (!_colorPeer && message)
 		? (message->originalHiddenSenderInfo()->colorIndex + 1)
 		: 0;
-
 	const auto hasPreview = (story && story->hasReplyPreview())
 		|| (message
 			&& message->media()
@@ -229,8 +324,13 @@ void Reply::update(
 		&& !fields.quote.empty();
 	_hasQuoteIcon = hasQuoteIcon ? 1 : 0;
 
+	const auto session = &view->history()->session();
 	const auto text = (!_displaying && data->unavailable())
 		? TextWithEntities()
+		: task
+		? Ui::Text::Colorized(task->completionDate
+			? TaskDoneIcon(session)
+			: TaskIcon(session)).append(task->text)
 		: (message && (fields.quote.empty() || !fields.manualQuote))
 		? message->inReplyText()
 		: !fields.quote.empty()
@@ -288,10 +388,11 @@ void Reply::setLinkFrom(
 	const auto &fields = data->fields();
 	const auto externalChannelId = peerToChannel(fields.externalPeerId);
 	const auto messageId = fields.messageId;
-	const auto quote = fields.manualQuote
-		? fields.quote
-		: TextWithEntities();
-	const auto quoteOffset = fields.quoteOffset;
+	const auto highlight = MessageHighlightId{
+		.quote = fields.manualQuote ? fields.quote : TextWithEntities(),
+		.quoteOffset = int(fields.quoteOffset),
+		.todoItemId = fields.todoItemId,
+	};
 	const auto returnToId = view->data()->fullId();
 	const auto externalLink = [=](ClickContext context) {
 		const auto my = context.other.value<ClickHandlerContext>();
@@ -314,8 +415,7 @@ void Reply::setLinkFrom(
 							channel,
 							messageId,
 							returnToId,
-							quote,
-							quoteOffset
+							highlight
 						)->onClick(context);
 					} else {
 						controller->showPeerInfo(channel);
@@ -336,7 +436,7 @@ void Reply::setLinkFrom(
 	const auto message = data->resolvedMessage.get();
 	const auto story = data->resolvedStory.get();
 	_link = message
-		? JumpToMessageClickHandler(message, returnToId, quote, quoteOffset)
+		? JumpToMessageClickHandler(message, returnToId, highlight)
 		: story
 		? JumpToStoryClickHandler(story)
 		: (data->external()
@@ -873,18 +973,28 @@ TextWithEntities Reply::ForwardEmoji(not_null<Data::Session*> owner) {
 TextWithEntities Reply::ComposePreviewName(
 		not_null<History*> history,
 		not_null<HistoryItem*> to,
-		bool quote) {
+		const FullReplyTo &replyTo) {
 	const auto sender = [&] {
 		if (const auto from = to->displayFrom()) {
 			return not_null(from);
 		}
 		return to->author();
 	}();
+	if (const auto media = replyTo.todoItemId ? to->media() : nullptr) {
+		if (const auto todolist = media->todolist()) {
+			return tr::lng_preview_reply_to_task(
+				tr::now,
+				lt_title,
+				todolist->title,
+				Ui::Text::WithEntities);
+		}
+	}
 	const auto toPeer = to->history()->peer;
 	const auto displayAsExternal = (to->history() != history);
 	const auto groupNameAdded = displayAsExternal
 		&& (toPeer != sender)
 		&& (toPeer->isChat() || toPeer->isMegagroup());
+	const auto quote = replyTo && !replyTo.quote.empty();
 	const auto shorten = groupNameAdded || quote;
 
 	auto nameFull = TextWithEntities();

Telegram/SourceFiles/history/view/history_view_reply.h

@@ -110,7 +110,7 @@ public:
 	[[nodiscard]] static TextWithEntities ComposePreviewName(
 		not_null<History*> history,
 		not_null<HistoryItem*> to,
-		bool quote);
+		const FullReplyTo &replyTo);
 
 private:
 	[[nodiscard]] Ui::Text::GeometryDescriptor textGeometry(

Telegram/SourceFiles/history/view/history_view_scheduled_section.cpp

@@ -438,12 +438,8 @@ void ScheduledWidget::setupComposeControls() {
 			if (item->isScheduled() && item->history() == _history) {
 				showAtPosition(item->position());
 			} else {
-				JumpToMessageClickHandler(
-					item,
-					{},
-					to.quote,
-					to.quoteOffset
-				)->onClick({});
+				const auto highlight = to.highlight();
+				JumpToMessageClickHandler(item, {}, highlight)->onClick({});
 			}
 		}
 	}, lifetime());

Telegram/SourceFiles/history/view/history_view_service_message.cpp

@@ -463,17 +463,16 @@ QSize Service::performCountCurrentSize(int newWidth) {
 	const auto media = this->media();
 	const auto mediaDisplayed = media && media->isDisplayed();
 	auto contentWidth = newWidth;
+	if (delegate()->elementChatMode() == ElementChatMode::Wide) {
+		accumulate_min(contentWidth, st::msgMaxWidth + 2 * st::msgPhotoSkip + 2 * st::msgMargin.left());
+	}
+	contentWidth -= st::msgServiceMargin.left() + st::msgServiceMargin.left(); // two small margins
+	if (contentWidth < st::msgServicePadding.left() + st::msgServicePadding.right() + 1) {
+		contentWidth = st::msgServicePadding.left() + st::msgServicePadding.right() + 1;
+	}
 	if (mediaDisplayed && media->hideServiceText()) {
 		newHeight += media->resizeGetHeight(newWidth) + marginBottom();
 	} else if (!text().isEmpty()) {
-		if (delegate()->elementChatMode() == ElementChatMode::Wide) {
-			accumulate_min(contentWidth, st::msgMaxWidth + 2 * st::msgPhotoSkip + 2 * st::msgMargin.left());
-		}
-		contentWidth -= st::msgServiceMargin.left() + st::msgServiceMargin.left(); // two small margins
-		if (contentWidth < st::msgServicePadding.left() + st::msgServicePadding.right() + 1) {
-			contentWidth = st::msgServicePadding.left() + st::msgServicePadding.right() + 1;
-		}
-
 		auto nwidth = qMax(contentWidth - st::msgServicePadding.left() - st::msgServicePadding.right(), 0);
 		newHeight += (contentWidth >= maxWidth())
 			? minHeight()

Telegram/SourceFiles/history/view/history_view_subsection_tabs.cpp

@@ -432,10 +432,14 @@ void SubsectionTabs::setupSlider(
 				.session = &session(),
 			}),
 		}, paused);
-		slider->setActiveSectionFast(activeIndex);
+
+		const auto ignoreActiveScroll = (scrollSavingIndex >= 0);
+		slider->setActiveSectionFast(activeIndex, ignoreActiveScroll);
 
 		_sectionsSlice = _slice;
-		if (scrollSavingIndex >= 0) {
+		Assert(slider->sectionsCount() == _slice.size());
+		if (ignoreActiveScroll) {
+			Assert(scrollSavingIndex < slider->sectionsCount());
 			const auto position = scrollSavingShift
 				+ slider->lookupSectionPosition(scrollSavingIndex);
 			if (vertical) {
@@ -702,6 +706,8 @@ void SubsectionTabs::refreshSlice() {
 		if (_slice != slice) {
 			_slice = std::move(slice);
 			_refreshed.fire({});
+			Assert((!_horizontal && !_vertical)
+				|| (_slice.size() == _sectionsSlice.size()));
 		}
 	});
 	const auto push = [&](not_null<Data::Thread*> thread) {

Telegram/SourceFiles/history/view/media/history_view_todo_list.cpp

@@ -334,9 +334,11 @@ void TodoList::updateTasks(bool skipAnimations) {
 ClickHandlerPtr TodoList::createTaskClickHandler(
 		const Task &task) {
 	const auto id = task.id;
-	return std::make_shared<LambdaClickHandler>(crl::guard(this, [=] {
+	auto result = std::make_shared<LambdaClickHandler>(crl::guard(this, [=] {
 		toggleCompletion(id);
 	}));
+	result->setProperty(kTodoListItemIdProperty, id);
+	return result;
 }
 
 void TodoList::startToggleAnimation(Task &task) {
@@ -375,11 +377,24 @@ void TodoList::toggleCompletion(int id) {
 	if (i == end(_tasks)) {
 		return;
 	}
+
 	const auto selected = (i->completionDate != 0);
 	i->completionDate = selected ? TimeId() : base::unixtime::now();
 	if (!selected) {
 		i->setCompletedBy(_parent->history()->session().user());
 	}
+
+	const auto parentMedia = _parent->data()->media();
+	const auto baseList = parentMedia ? parentMedia->todolist() : nullptr;
+	if (baseList) {
+		const auto j = ranges::find(baseList->items, id, &TodoListItem::id);
+		if (j != end(baseList->items)) {
+			j->completionDate = i->completionDate;
+			j->completedBy = i->completedBy;
+		}
+		history()->owner().updateDependentMessages(_parent->data());
+	}
+
 	startToggleAnimation(*i);
 	repaint();
 
@@ -467,6 +482,7 @@ void TodoList::draw(Painter &p, const PaintContext &context) const {
 			paintw,
 			width(),
 			context);
+		appendTaskHighlight(task.id, tshift, height, context);
 		if (was) {
 			heavy = true;
 		} else if (!task.userpic.null()) {
@@ -561,6 +577,33 @@ int TodoList::paintTask(
 	return height;
 }
 
+void TodoList::appendTaskHighlight(
+		int id,
+		int top,
+		int height,
+		const PaintContext &context) const {
+	if (context.highlight.todoItemId != id
+		|| context.highlight.collapsion <= 0.) {
+		return;
+	}
+	const auto to = context.highlightInterpolateTo;
+	const auto toProgress = (1. - context.highlight.collapsion);
+	if (toProgress >= 1.) {
+		context.highlightPathCache->addRect(to);
+	} else if (toProgress <= 0.) {
+		context.highlightPathCache->addRect(0, top, width(), height);
+	} else {
+		const auto lerp = [=](int from, int to) {
+			return from + (to - from) * toProgress;
+		};
+		context.highlightPathCache->addRect(
+			lerp(0, to.x()),
+			lerp(top, to.y()),
+			lerp(width(), to.width()),
+			lerp(height, to.height()));
+	}
+}
+
 void TodoList::paintRadio(
 		Painter &p,
 		const Task &task,

Telegram/SourceFiles/history/view/media/history_view_todo_list.h

@@ -117,6 +117,11 @@ private:
 		int top,
 		int paintw,
 		const PaintContext &context) const;
+	void appendTaskHighlight(
+		int id,
+		int top,
+		int height,
+		const PaintContext &context) const;
 
 	void radialAnimationCallback() const;
 

Telegram/SourceFiles/history/view/reactions/history_view_reactions.cpp

@@ -835,12 +835,12 @@ InlineListData InlineListDataFromMessage(not_null<Element*> view) {
 	using Flag = InlineListData::Flag;
 	const auto item = view->data();
 	const auto &settings = AyuSettings::getInstance();
-	if (!settings.hideChannelReactions
+	if (!settings.showChannelReactions
 		&& item->history()->peer->isChannel()
 		&& !item->history()->peer->isMegagroup()) {
 		return InlineListData();
 	}
-	if (!settings.hideGroupReactions
+	if (!settings.showGroupReactions
 		&& item->history()->peer->isMegagroup()) {
 		return InlineListData();
 	}

Telegram/SourceFiles/history/view/reactions/history_view_reactions_selector.cpp

@@ -1189,11 +1189,6 @@ bool AdjustMenuGeometryForSelector(
 		not_null<Ui::PopupMenu*> menu,
 		QPoint desiredPosition,
 		not_null<Selector*> selector) {
-	const auto &settings = AyuSettings::getInstance();
-	if (!AyuUi::needToShowItem(settings.showReactionsPanelInContextMenu)) {
-		return false;
-	}
-
 	const auto useTransparency = selector->useTransparency();
 	const auto extend = useTransparency
 		? st::reactStripExtend
@@ -1362,6 +1357,12 @@ AttachSelectorResult AttachSelectorToMenu(
 		return AttachSelectorResult::Skipped;
 	}
 
+	const auto peer = item->history()->peer;
+	if ((peer->isChannel() && !peer->isMegagroup() && !settings.showChannelReactions)
+		|| (peer->isMegagroup() && !settings.showGroupReactions)) {
+		return AttachSelectorResult::Skipped;
+	}
+
 	const auto result = AttachSelectorToMenu(
 		menu,
 		desiredPosition,

Telegram/SourceFiles/info/info.style

@@ -731,8 +731,8 @@ manageDeleteGroupButton: SettingsCountButton(manageGroupNoIconButton) {
 manageGroupReactions: IconButton(defaultIconButton) {
 	width: 24px;
 	height: 36px;
-	icon: icon{{ "info/edit/stickers_add", historyComposeIconFg }};
-	iconOver: icon{{ "info/edit/stickers_add", historyComposeIconFgOver }};
+	icon: icon{{ "menu/add", historyComposeIconFg }};
+	iconOver: icon{{ "menu/add", historyComposeIconFgOver }};
 }
 manageGroupReactionsField: InputField(defaultInputField) {
 	textMargins: margins(1px, 12px, 24px, 8px);

Telegram/SourceFiles/info/peer_gifts/info_peer_gifts_widget.cpp

@@ -9,6 +9,7 @@ https://github.com/telegramdesktop/tdesktop/blob/master/LEGAL
 
 #include "api/api_premium.h"
 #include "apiwrap.h"
+#include "boxes/star_gift_box.h"
 #include "data/data_channel.h"
 #include "data/data_credits.h"
 #include "data/data_session.h"
@@ -380,6 +381,7 @@ void InnerWidget::loadMore() {
 			_entries.clear();
 		}
 		_entries.reserve(_entries.size() + data.vgifts().v.size());
+		auto hasUnique = false;
 		for (const auto &gift : data.vgifts().v) {
 			if (auto parsed = Api::FromTL(_peer, gift)) {
 				auto descriptor = DescriptorForGift(_peer, *parsed);
@@ -387,10 +389,15 @@ void InnerWidget::loadMore() {
 					.gift = std::move(*parsed),
 					.descriptor = std::move(descriptor),
 				});
+				hasUnique = (parsed->info.unique != nullptr);
 			}
 		}
 		refreshButtons();
 		refreshAbout();
+
+		if (hasUnique) {
+			Ui::PreloadUniqueGiftResellPrices(&_peer->session());
+		}
 	}).fail([=] {
 		_loadMoreRequestId = 0;
 		_allLoaded = true;

Telegram/SourceFiles/lang/lang_tag.cpp

@@ -949,7 +949,20 @@ QString FormatCountDecimal(int64 number) {
 }
 
 QString FormatExactCountDecimal(float64 number) {
-	return QLocale().toString(number, 'f', QLocale::FloatingPointShortest);
+	const auto locale = QLocale();
+	if (qFuzzyCompare(number, base::SafeRound(number))) {
+		return locale.toString(int64(base::SafeRound(number)));
+	}
+
+	// Somehow using QLocale::FloatingPointShortest sometimes produces
+	// "0.8500000000000001" on some systems / locales,
+	// so I want to stick to 6 digits max (default third argument value).
+	auto result = locale.toString(number, 'f');
+	const auto zero = locale.zeroDigit();
+	while (result.endsWith(zero)) {
+		result.chop(1);
+	}
+	return result;
 }
 
 ShortenedCount FormatCreditsAmountToShort(CreditsAmount amount) {

Telegram/SourceFiles/media/view/media_view.style

@@ -1087,3 +1087,34 @@ mediaviewSponsoredButton: RoundButton(defaultActiveButton) {
 
 	ripple: universalRippleAnimation;
 }
+
+mediaSponsoredSkip: 16px;
+mediaSponsoredShift: 16px;
+mediaSponsoredPadding: margins(12px, 8px, 8px, 8px);
+mediaSponsoredThumb: 48px;
+mediaSponsoredCloseTwice: 3px;
+mediaSponsoredCloseSmall: 3px;
+mediaSponsoredCloseSize: 11px;
+mediaSponsoredCloseCorner: 6px;
+mediaSponsoredCloseFull: 64px;
+mediaSponsoredCloseStroke: 2px;
+mediaSponsoredCloseRipple: 36px;
+mediaSponsoredCloseDiameter: 24px;
+mediaSponsoredCloseFont: font(12px bold);
+
+mediaSponsoredAbout: RoundButton(defaultActiveButton) {
+	textFg: windowActiveTextFg;
+	textFgOver: windowActiveTextFg;
+	textBg: lightButtonBgOver;
+	textBgOver: lightButtonBgOver;
+	width: -12px;
+	height: 18px;
+	radius: 9px;
+	textTop: 0px;
+	style: TextStyle(defaultTextStyle) {
+		font: font(12px);
+	}
+	ripple: RippleAnimation(defaultRippleAnimation) {
+		color: lightButtonBgRipple;
+	}
+}

Telegram/SourceFiles/media/view/media_view_overlay_widget.cpp

@@ -51,6 +51,7 @@ https://github.com/telegramdesktop/tdesktop/blob/master/LEGAL
 #include "media/view/media_view_pip.h"
 #include "media/view/media_view_overlay_raster.h"
 #include "media/view/media_view_overlay_opengl.h"
+#include "media/view/media_view_playback_sponsored.h"
 #include "media/stories/media_stories_share.h"
 #include "media/stories/media_stories_view.h"
 #include "media/streaming/media_streaming_document.h"
@@ -339,6 +340,7 @@ struct OverlayWidget::Streamed {
 
 	Streaming::Instance instance;
 	std::unique_ptr<PlaybackControls> controls;
+	std::unique_ptr<PlaybackSponsored> sponsored;
 	std::unique_ptr<base::PowerSaveBlocker> powerSaveBlocker;
 
 	bool ready = false;
@@ -1617,7 +1619,11 @@ void OverlayWidget::fillContextMenuActions(
 		if (const auto window = findWindow()) {
 			const auto show = window->uiShow();
 			const auto fullId = _message->fullId();
-			Menu::FillSponsored(_body, addAction, show, fullId, true);
+			Menu::FillSponsored(
+				addAction,
+				show,
+				fullId,
+				{ .dark = true, .skipInfo = true });
 		}
 		return;
 	}
@@ -3981,7 +3987,11 @@ bool OverlayWidget::initStreaming(const StartStreaming &startStreaming) {
 			&& !_streamed->instance.player().finished())) {
 		startStreamingPlayer(startStreaming);
 	} else {
-		_streamed->ready = _streamed->instance.player().ready();
+		if (_streamed->instance.player().ready()) {
+			markStreamedReady();
+		} else {
+			_streamed->ready = false;
+		}
 		updatePlaybackState();
 	}
 	return true;
@@ -3994,7 +4004,7 @@ void OverlayWidget::startStreamingPlayer(
 	const auto &player = _streamed->instance.player();
 	if (player.playing()) {
 		if (!_streamed->withSound) {
-			_streamed->ready = true;
+			markStreamedReady();
 			return;
 		}
 		_pip = nullptr;
@@ -4012,6 +4022,18 @@ void OverlayWidget::startStreamingPlayer(
 	restartAtSeekPosition(_streamedPosition);
 }
 
+void OverlayWidget::markStreamedReady() {
+	Expects(_streamed != nullptr);
+
+	if (_streamed->ready) {
+		return;
+	}
+	_streamed->ready = true;
+	if (const auto sponsored = _streamed->sponsored.get()) {
+		sponsored->start();
+	}
+}
+
 void OverlayWidget::initStreamingThumbnail() {
 	Expects(_photo || _document);
 
@@ -4083,7 +4105,7 @@ void OverlayWidget::initStreamingThumbnail() {
 }
 
 void OverlayWidget::streamingReady(Streaming::Information &&info) {
-	_streamed->ready = true;
+	markStreamedReady();
 	if (videoShown()) {
 		applyVideoSize();
 		_streamedQualityChangeFrame = QImage();
@@ -4105,6 +4127,7 @@ void OverlayWidget::applyVideoSize() {
 
 bool OverlayWidget::createStreamingObjects() {
 	Expects(_photo || _document);
+	Expects(!_streamed);
 
 	const auto origin = fileOrigin();
 	const auto callback = [=] { waitingAnimationCallback(); };
@@ -4137,6 +4160,18 @@ bool OverlayWidget::createStreamingObjects() {
 			_body,
 			static_cast<PlaybackControls::Delegate*>(this));
 		_streamed->controls->show();
+		_streamed->sponsored = PlaybackSponsored::Has(_message)
+			? std::make_unique<PlaybackSponsored>(
+				_streamed->controls.get(),
+				uiShow(),
+				_message)
+			: nullptr;
+		if (const auto sponsored = _streamed->sponsored.get()) {
+			_layerBg->layerShownValue(
+			) | rpl::start_with_next([=](bool shown) {
+				sponsored->setPaused(shown);
+			}, sponsored->lifetime());
+		}
 		refreshClipControllerGeometry();
 	}
 	return true;

Telegram/SourceFiles/media/view/media_view_overlay_widget.h

@@ -78,6 +78,7 @@ struct ContentLayout;
 
 namespace Media::View {
 
+class PlaybackSponsored;
 class GroupThumbs;
 class Pip;
 
@@ -412,6 +413,7 @@ private:
 		const StartStreaming &startStreaming = StartStreaming());
 	void startStreamingPlayer(const StartStreaming &startStreaming);
 	void initStreamingThumbnail();
+	void markStreamedReady();
 	void streamingReady(Streaming::Information &&info);
 	[[nodiscard]] bool createStreamingObjects();
 	void handleStreamingUpdate(Streaming::Update &&update);

Telegram/SourceFiles/media/view/media_view_playback_controls.h

@@ -19,14 +19,13 @@ class MediaSlider;
 class PopupMenu;
 } // namespace Ui
 
-namespace Media {
-namespace Player {
+namespace Media::Player {
 struct TrackState;
 class SettingsButton;
 class SpeedController;
-} // namespace Player
+} // namespace Media::Player
 
-namespace View {
+namespace Media::View {
 
 class PlaybackProgress;
 
@@ -131,5 +130,4 @@ private:
 
 };
 
-} // namespace View
-} // namespace Media
+} // namespace Media::View

Telegram/SourceFiles/media/view/media_view_playback_sponsored.cpp

@@ -0,0 +1,767 @@
+/*
+This file is part of Telegram Desktop,
+the official desktop application for the Telegram messaging service.
+
+For license and copyright information please follow this link:
+https://github.com/telegramdesktop/tdesktop/blob/master/LEGAL
+*/
+#include "media/view/media_view_playback_sponsored.h"
+
+#include "boxes/premium_preview_box.h"
+#include "data/components/sponsored_messages.h"
+#include "data/data_file_origin.h"
+#include "data/data_photo.h"
+#include "data/data_photo_media.h"
+#include "data/data_session.h"
+#include "history/history.h"
+#include "history/history_item.h"
+#include "lang/lang_keys.h"
+#include "main/main_session.h"
+#include "menu/menu_sponsored.h"
+#include "ui/effects/numbers_animation.h"
+#include "ui/effects/ripple_animation.h"
+#include "ui/widgets/menu/menu_add_action_callback.h"
+#include "ui/widgets/menu/menu_add_action_callback_factory.h"
+#include "ui/widgets/buttons.h"
+#include "ui/widgets/popup_menu.h"
+#include "ui/basic_click_handlers.h"
+#include "ui/painter.h"
+#include "ui/ui_utility.h"
+#include "ui/cached_round_corners.h"
+#include "styles/style_chat.h"
+#include "styles/style_media_view.h"
+
+namespace Media::View {
+namespace {
+
+constexpr auto kStartDelayMin = crl::time(1000);
+constexpr auto kDurationMin = 5 * crl::time(1000);
+
+enum class Action {
+	Close,
+	PromotePremium,
+	Pause,
+	Unpause,
+};
+
+class Close final : public Ui::RippleButton {
+public:
+	Close(
+		not_null<QWidget*> parent,
+		const style::RippleAnimation &st,
+		rpl::producer<crl::time> allowCloseAt);
+
+	[[nodiscard]] rpl::producer<Action> actions() const;
+
+private:
+	QPoint prepareRippleStartPosition() const override;
+	QImage prepareRippleMask() const override;
+	void paintEvent(QPaintEvent *e) override;
+
+	void updateProgress(crl::time now);
+
+	rpl::event_stream<Action> _actions;
+
+	Ui::NumbersAnimation _countdown;
+	Ui::Animations::Basic _progress;
+	base::Timer _noAnimationTimer;
+	crl::time _allowCloseAt = 0;
+	crl::time _startedAt = 0;
+	crl::time _pausedAt = 0;
+	int _secondsTill = 0;
+	int _rippleSize = 0;
+	QPoint _rippleOrigin;
+	bool _allowClose = false;
+
+};
+
+Close::Close(
+	not_null<QWidget*> parent,
+	const style::RippleAnimation &st,
+	rpl::producer<crl::time> allowCloseAt)
+: RippleButton(parent, st)
+, _countdown(st::mediaSponsoredCloseFont, [=] { update(); })
+, _progress([=](crl::time now) { updateProgress(now); })
+, _noAnimationTimer([=] { updateProgress(crl::now()); })
+, _startedAt(crl::now()) {
+	resize(st::mediaSponsoredCloseFull, st::mediaSponsoredCloseFull);
+
+	const auto size = st::mediaSponsoredCloseRipple;
+	const auto cut = int(base::SafeRound((width() - size) / 2.));
+	_rippleSize = std::min(width() - 2 * cut, height() - 2 * cut);
+	_rippleOrigin = QPoint(
+		(width() - _rippleSize) / 2,
+		(height() - _rippleSize) / 2);
+
+	std::move(
+		allowCloseAt
+	) | rpl::start_with_next([=](crl::time at) {
+		const auto now = crl::now();
+		if (!at) {
+			updateProgress(now);
+			_pausedAt = now;
+			_progress.stop();
+		} else {
+			if (_pausedAt) {
+				_startedAt += now - base::take(_pausedAt);
+			}
+			_allowCloseAt = at;
+			updateProgress(now);
+			if (!anim::Disabled()) {
+				_progress.start();
+			} else if (!_allowClose) {
+				_noAnimationTimer.callEach(crl::time(200));
+			}
+		}
+	}, lifetime());
+	updateProgress(_startedAt);
+
+	setClickedCallback([=] {
+		_actions.fire(_allowClose ? Action::Close : Action::PromotePremium);
+	});
+}
+
+rpl::producer<Action> Close::actions() const {
+	return _actions.events();
+}
+
+void Close::updateProgress(crl::time now) {
+	update();
+}
+
+QPoint Close::prepareRippleStartPosition() const {
+	return mapFromGlobal(QCursor::pos()) - _rippleOrigin;
+}
+
+QImage Close::prepareRippleMask() const {
+	return Ui::RippleAnimation::EllipseMask({ _rippleSize, _rippleSize });
+}
+
+void Close::paintEvent(QPaintEvent *e) {
+	auto p = QPainter(this);
+
+	paintRipple(p, _rippleOrigin);
+
+	const auto now = crl::now();
+	if (!_pausedAt) {
+		_allowClose = (now >= _allowCloseAt);
+	}
+	const auto msTill = _allowCloseAt - (_pausedAt ? _pausedAt : now);
+	const auto msFull = _allowCloseAt - _startedAt;
+	const auto secondsTill = (std::max(msTill, crl::time()) + 999) / 1000;
+	const auto secondsFull = (std::max(msFull, crl::time()) + 999) / 1000;
+	const auto allowCloseLeft = anim::Disabled()
+		? (secondsFull ? (secondsTill / float64(secondsFull)) : 0)
+		: std::max(msFull ? (msTill / float64(msFull)) : 0., 0.);
+	const auto duration = crl::time(st::fadeWrapDuration);
+	const auto allowedProgress = anim::Disabled()
+		? (secondsTill ? 0. : 1.)
+		: std::clamp(-msTill, crl::time(), duration) / float64(duration);
+
+	if (_secondsTill != secondsTill) {
+		const auto initial = !_secondsTill;
+		_secondsTill = secondsTill;
+		_countdown.setText(QString::number(_secondsTill), _secondsTill);
+		if (initial) {
+			_countdown.finishAnimating();
+		}
+	}
+
+	auto pen = st::mediaviewTextLinkFg->p;
+	if (allowedProgress < 1.) {
+		if (allowedProgress > 0.) {
+			p.setOpacity(1. - allowedProgress);
+		}
+		p.setPen(pen);
+
+		const auto inner = QRect(
+			(width() - st::mediaSponsoredCloseDiameter) / 2,
+			(height() - st::mediaSponsoredCloseDiameter) / 2,
+			st::mediaSponsoredCloseDiameter,
+			st::mediaSponsoredCloseDiameter);
+		p.setFont(st::mediaSponsoredCloseFont);
+		_countdown.paint(
+			p,
+			inner.x() + (inner.width() - _countdown.countWidth()) / 2,
+			(inner.y()
+				+ (inner.height()
+					- st::mediaSponsoredCloseFont->height) / 2),
+			width());
+
+		const auto skip = 0.23;
+		const auto len = int(base::SafeRound(
+			arc::kFullLength * (1. - skip) * allowCloseLeft));
+		if (len > 0) {
+			const auto from = arc::kFullLength / 4;
+			auto hq = PainterHighQualityEnabler(p);
+			pen.setWidthF(st::mediaSponsoredCloseStroke);
+			pen.setCapStyle(Qt::RoundCap);
+			p.setPen(pen);
+			p.drawArc(inner, from, len);
+		}
+
+		p.setOpacity(1.);
+	}
+
+	const auto sizeFinal = st::mediaSponsoredCloseSize;
+	const auto sizeSmall = st::mediaSponsoredCloseCorner;
+	const auto twiceFinal = st::mediaSponsoredCloseTwice;
+	const auto twiceSmall = st::mediaSponsoredCloseSmall;
+	const auto size = sizeSmall + allowedProgress * (sizeFinal - sizeSmall);
+	const auto twice = twiceSmall
+		+ allowedProgress * (twiceFinal - twiceSmall);
+	const auto leftFinal = (width() - size) / 2.;
+	const auto leftSmall = (width() + st::mediaSponsoredCloseDiameter) / 2.
+		- (st::mediaSponsoredCloseStroke / 2.)
+		- sizeSmall;
+	const auto topFinal = (height() - size) / 2.;
+	const auto topSmall = (height() - st::mediaSponsoredCloseDiameter) / 2.;
+	const auto left = leftSmall + allowedProgress * (leftFinal - leftSmall);
+	const auto top = topSmall + allowedProgress * (topFinal - topSmall);
+
+	auto hq = PainterHighQualityEnabler(p);
+	pen.setWidthF(twice / 2.);
+	p.setPen(pen);
+	p.drawLine(QPointF(left, top), QPointF(left + size, top + size));
+	p.drawLine(QPointF(left + size, top), QPointF(left, top + size));
+}
+
+[[nodiscard]] style::RoundButton PrepareAboutStyle() {
+	static auto textBg = style::complex_color([] {
+		auto result = st::mediaviewTextLinkFg->c;
+		result.setAlphaF(result.alphaF() * 0.1);
+		return result;
+	});
+	static auto textBgOver = style::complex_color([] {
+		auto result = st::mediaviewTextLinkFg->c;
+		result.setAlphaF(result.alphaF() * 0.15);
+		return result;
+	});
+	static auto rippleColor = style::complex_color([] {
+		auto result = st::mediaviewTextLinkFg->c;
+		result.setAlphaF(result.alphaF() * 0.2);
+		return result;
+	});
+
+	auto result = st::mediaSponsoredAbout;
+	result.textFg = st::mediaviewTextLinkFg;
+	result.textFgOver = st::mediaviewTextLinkFg;
+	result.textBg = textBg.color();
+	result.textBgOver = textBgOver.color();
+	result.ripple.color = rippleColor.color();
+	return result;
+}
+
+} // namespace
+
+class PlaybackSponsored::Message final : public Ui::RpWidget {
+public:
+	Message(
+		QWidget *parent,
+		std::shared_ptr<ChatHelpers::Show> show,
+		const Data::SponsoredMessage &data,
+		rpl::producer<crl::time> allowCloseAt);
+
+	[[nodiscard]] rpl::producer<Action> actions() const;
+
+	void setFinalPosition(int x, int y);
+
+	void fadeIn();
+	void fadeOut(Fn<void()> hidden);
+
+private:
+	void paintEvent(QPaintEvent *e) override;
+	void mouseMoveEvent(QMouseEvent *e) override;
+	void mousePressEvent(QMouseEvent *e) override;
+	void mouseReleaseEvent(QMouseEvent *e) override;
+
+	int resizeGetHeight(int newWidth) override;
+
+	void populate();
+	void startFadeIn();
+	void updateShown(Fn<void()> finished = nullptr);
+	void startFade(Fn<void()> finished);
+
+	const not_null<Main::Session*> _session;
+	const std::shared_ptr<ChatHelpers::Show> _show;
+	const Data::SponsoredMessage _data;
+
+	style::RoundButton _aboutSt;
+	std::unique_ptr<Ui::RoundButton> _about;
+	std::unique_ptr<Close> _close;
+
+	base::unique_qptr<Ui::PopupMenu> _menu;
+	rpl::event_stream<Action> _actions;
+
+	std::shared_ptr<Data::PhotoMedia> _photo;
+	Ui::Text::String _title;
+	Ui::Text::String _text;
+
+	QPoint _finalPosition;
+	int _left = 0;
+	int _top = 0;
+	int _titleHeight = 0;
+	int _textHeight = 0;
+
+	QImage _cache;
+	Ui::Animations::Simple _showAnimation;
+	bool _shown = false;
+	bool _over = false;
+	bool _pressed = false;
+
+	rpl::lifetime _photoLifetime;
+
+};
+
+PlaybackSponsored::Message::Message(
+	QWidget *parent,
+	std::shared_ptr<ChatHelpers::Show> show,
+	const Data::SponsoredMessage &data,
+	rpl::producer<crl::time> allowCloseAt)
+: RpWidget(parent)
+, _session(&data.history->session())
+, _show(std::move(show))
+, _data(data)
+, _aboutSt(PrepareAboutStyle())
+, _about(std::make_unique<Ui::RoundButton>(
+	this,
+	tr::lng_search_sponsored_button(),
+	_aboutSt))
+, _close(
+	std::make_unique<Close>(
+		this,
+		_aboutSt.ripple,
+		std::move(allowCloseAt))) {
+	_about->setTextTransform(Ui::RoundButton::TextTransform::NoTransform);
+	setMouseTracking(true);
+	populate();
+	hide();
+}
+
+rpl::producer<Action> PlaybackSponsored::Message::actions() const {
+	return rpl::merge(_actions.events(), _close->actions());
+}
+
+void PlaybackSponsored::Message::setFinalPosition(int x, int y) {
+	_finalPosition = { x, y };
+	if (_shown) {
+		updateShown();
+	}
+}
+
+void PlaybackSponsored::Message::fadeIn() {
+	_shown = true;
+	if (!_photo || _photo->loaded()) {
+		startFadeIn();
+		return;
+	}
+	_photo->owner()->session().downloaderTaskFinished(
+	) | rpl::filter([=] {
+		return _photo->loaded();
+	}) | rpl::start_with_next([=] {
+		_photoLifetime.destroy();
+		startFadeIn();
+	}, _photoLifetime);
+}
+
+void PlaybackSponsored::Message::startFadeIn() {
+	if (!_shown) {
+		return;
+	}
+	startFade([=] {
+		_session->sponsoredMessages().view(_data.randomId);
+	});
+	show();
+}
+
+void PlaybackSponsored::Message::fadeOut(Fn<void()> hidden) {
+	if (!_shown) {
+		if (const auto onstack = hidden) {
+			onstack();
+		}
+		return;
+	}
+	_shown = false;
+	startFade(std::move(hidden));
+}
+
+void PlaybackSponsored::Message::startFade(Fn<void()> finished) {
+	_cache = Ui::GrabWidgetToImage(this);
+	_about->hide();
+	_close->hide();
+	const auto from = _shown ? 0. : 1.;
+	const auto till = _shown ? 1. : 0.;
+	_showAnimation.start([=] {
+		updateShown(finished);
+	}, from, till, st::fadeWrapDuration);
+}
+
+void PlaybackSponsored::Message::updateShown(Fn<void()> finished) {
+	const auto shown = _showAnimation.value(_shown ? 1. : 0.);
+	const auto shift = anim::interpolate(st::mediaSponsoredShift, 0, shown);
+	move(_finalPosition.x(), _finalPosition.y() + shift);
+	update();
+	if (!_showAnimation.animating()) {
+		_cache = QImage();
+		_close->show();
+		_about->show();
+		if (const auto onstack = finished) {
+			onstack();
+		}
+	}
+}
+
+void PlaybackSponsored::Message::paintEvent(QPaintEvent *e) {
+	auto p = QPainter(this);
+
+	const auto shown = _showAnimation.value(_shown ? 1. : 0.);
+	if (!_cache.isNull()) {
+		p.setOpacity(shown);
+		p.drawImage(0, 0, _cache);
+		return;
+	}
+
+	Ui::FillRoundRect(
+		p,
+		rect(),
+		st::mediaviewSaveMsgBg,
+		Ui::MediaviewSaveCorners);
+
+	const auto &padding = st::mediaSponsoredPadding;
+	if (_photo) {
+		if (const auto image = _photo->image(Data::PhotoSize::Large)) {
+			const auto size = st::mediaSponsoredThumb;
+			const auto x = padding.left();
+			const auto y = (height() - size) / 2;
+			p.drawPixmap(
+				x,
+				y,
+				image->pixSingle(
+					size,
+					size,
+					{ .options = Images::Option::RoundCircle }));
+		}
+	}
+
+	p.setPen(st::mediaviewControlFg);
+
+	_title.draw(p, {
+		.position = { _left, _top },
+		.availableWidth = _about->x() - _left,
+		.palette = &st::mediaviewTextPalette,
+	});
+
+	_text.draw(p, {
+		.position = { _left, _top + _titleHeight },
+		.availableWidth = _close->x() - _left,
+		.palette = &st::mediaviewTextPalette,
+	});
+}
+
+void PlaybackSponsored::Message::mouseMoveEvent(QMouseEvent *e) {
+	const auto &padding = st::mediaSponsoredPadding;
+	const auto point = e->pos();
+	const auto about = _about->geometry();
+	const auto close = _close->geometry();
+	const auto over = !about.marginsAdded(padding).contains(point)
+		&& !close.marginsAdded(padding).contains(point);
+	if (_over != over) {
+		_over = over;
+		setCursor(_over ? style::cur_pointer : style::cur_default);
+	}
+}
+
+void PlaybackSponsored::Message::mousePressEvent(QMouseEvent *e) {
+	if (_over) {
+		_pressed = true;
+	}
+}
+
+void PlaybackSponsored::Message::mouseReleaseEvent(QMouseEvent *e) {
+	if (base::take(_pressed) && _over) {
+		_session->sponsoredMessages().clicked(_data.randomId, false, false);
+		UrlClickHandler::Open(_data.link);
+	}
+}
+
+int PlaybackSponsored::Message::resizeGetHeight(int newWidth) {
+	const auto &padding = st::mediaSponsoredPadding;
+	const auto userpic = st::mediaSponsoredThumb;
+	const auto innerWidth = newWidth - _left - _close->width();
+	const auto titleWidth = innerWidth - _about->width() - padding.right();
+	_titleHeight = _title.countHeight(titleWidth);
+	_textHeight = _text.countHeight(innerWidth);
+
+	const auto use = std::max(_titleHeight + _textHeight, userpic);
+
+	const auto height = padding.top() + use + padding.bottom();
+	_left = padding.left() + (_photo ? (userpic + padding.left()) : 0);
+	_top = padding.top() + (use - _titleHeight - _textHeight) / 2;
+
+	_about->move(
+		_left + std::min(titleWidth, _title.maxWidth()) + padding.right(),
+		_top);
+	_close->move(
+		newWidth - _close->width(),
+		(height - _close->height()) / 2);
+
+	return height;
+}
+
+void PlaybackSponsored::Message::populate() {
+	const auto &from = _data.from;
+	const auto photo = from.photoId
+		? _data.history->owner().photo(from.photoId).get()
+		: nullptr;
+	if (photo) {
+		_photo = photo->createMediaView();
+		photo->load({}, LoadFromCloudOrLocal, true);
+	}
+	_title = Ui::Text::String(
+		st::semiboldTextStyle,
+		from.title,
+		kDefaultTextOptions,
+		st::msgMinWidth);
+	_text = Ui::Text::String(
+		st::defaultTextStyle,
+		_data.textWithEntities,
+		kMarkupTextOptions,
+		st::msgMinWidth);
+
+	_about->setClickedCallback([=] {
+		_menu = nullptr;
+		const auto parent = parentWidget();
+		_menu = base::make_unique_q<Ui::PopupMenu>(
+			parent,
+			st::mediaviewPopupMenu);
+		const auto raw = _menu.get();
+		const auto addAction = Ui::Menu::CreateAddActionCallback(raw);
+		Menu::FillSponsored(
+			addAction,
+			_show,
+			Menu::SponsoredPhrases::Channel,
+			_session->sponsoredMessages().lookupDetails(_data),
+			_session->sponsoredMessages().createReportCallback(
+				_data.randomId,
+				crl::guard(this, [=] { _actions.fire(Action::Close); })),
+			{ .dark = true });
+		_actions.fire(Action::Pause);
+		Ui::Connect(raw, &QObject::destroyed, this, [=] {
+			_actions.fire(Action::Unpause);
+		});
+		raw->popup(QCursor::pos());
+	});
+}
+
+PlaybackSponsored::PlaybackSponsored(
+	not_null<Ui::RpWidget*> controls,
+	std::shared_ptr<ChatHelpers::Show> show,
+	not_null<HistoryItem*> item)
+: _parent(controls->parentWidget())
+, _session(&item->history()->session())
+, _show(std::move(show))
+, _itemId(item->fullId())
+, _controlsGeometry(controls->geometryValue())
+, _timer([=] { update(); }) {
+	_session->sponsoredMessages().requestForVideo(item, crl::guard(this, [=](
+			Data::SponsoredForVideo data) {
+		if (data.list.empty()) {
+			return;
+		}
+		_data = std::move(data);
+		if (_data->state.initial()
+			|| (_data->state.itemIndex > _data->list.size())
+			|| (_data->state.itemIndex == _data->list.size()
+				&& _data->state.leftTillShow <= 0)) {
+			_data->state.itemIndex = 0;
+			_data->state.leftTillShow = std::max(
+				_data->startDelay,
+				kStartDelayMin);
+		}
+		update();
+	}));
+}
+
+PlaybackSponsored::~PlaybackSponsored() {
+	saveState();
+}
+
+void PlaybackSponsored::start() {
+	_started = true;
+	if (!_paused) {
+		_start = crl::now();
+		update();
+	}
+}
+
+void PlaybackSponsored::setPaused(bool paused) {
+	setPausedOutside(paused);
+}
+
+void PlaybackSponsored::updatePaused() {
+	const auto paused = _pausedInside || _pausedOutside;
+	if (_paused == paused) {
+		return;
+	} else if (_started && paused) {
+		update();
+	}
+	_paused = paused;
+	if (!_started) {
+		return;
+	} else if (_paused) {
+		_start = 0;
+		_timer.cancel();
+		_allowCloseAt = 0;
+	} else {
+		_start = crl::now();
+		update();
+	}
+}
+
+void PlaybackSponsored::setPausedInside(bool paused) {
+	if (_pausedInside == paused) {
+		return;
+	}
+	_pausedInside = paused;
+	updatePaused();
+}
+
+void PlaybackSponsored::setPausedOutside(bool paused) {
+	if (_pausedOutside == paused) {
+		return;
+	}
+	_pausedOutside = paused;
+	updatePaused();
+}
+
+void PlaybackSponsored::finish() {
+	_timer.cancel();
+	if (_data) {
+		saveState();
+		_data = std::nullopt;
+	}
+}
+
+void PlaybackSponsored::update() {
+	if (!_data || !_start) {
+		return;
+	}
+
+	const auto [now, state] = computeState();
+	const auto message = (_data->state.itemIndex < _data->list.size())
+		? &_data->list[state.itemIndex]
+		: nullptr;
+	const auto duration = message
+		? std::max(
+			message->durationMin + kDurationMin,
+			message->durationMax)
+		: crl::time(0);
+	if (_data->state.leftTillShow > 0 && state.leftTillShow <= 0) {
+		_data->state.leftTillShow = 0;
+		if (duration) {
+			_allowCloseAt = now + message->durationMin;
+			show(*message);
+
+			_start = now;
+			_timer.callOnce(duration);
+			saveState();
+		} else {
+			finish();
+		}
+	} else if (_data->state.leftTillShow <= 0
+		&& state.leftTillShow <= -duration) {
+		hide(now);
+	} else {
+		if (state.leftTillShow <= 0 && duration) {
+			_allowCloseAt = now + state.leftTillShow + message->durationMin;
+			if (!_widget) {
+				show(*message);
+			}
+		}
+		_data->state = state;
+		_timer.callOnce((state.leftTillShow > 0)
+			? state.leftTillShow
+			: (state.leftTillShow + duration));
+	}
+}
+
+
+void PlaybackSponsored::show(const Data::SponsoredMessage &data) {
+	_widget = std::make_unique<Message>(
+		_parent,
+		_show,
+		data,
+		_allowCloseAt.value());
+	const auto raw = _widget.get();
+
+	_controlsGeometry.value() | rpl::start_with_next([=](QRect controls) {
+		raw->resizeToWidth(controls.width());
+		raw->setFinalPosition(
+			controls.x(),
+			controls.y() - st::mediaSponsoredSkip - raw->height());
+	}, raw->lifetime());
+
+	raw->actions() | rpl::start_with_next([=](Action action) {
+		switch (action) {
+		case Action::Close: hide(crl::now()); break;
+		case Action::PromotePremium: showPremiumPromo(); break;
+		case Action::Pause: setPausedInside(true); break;
+		case Action::Unpause: setPausedInside(false); break;
+		}
+	}, raw->lifetime());
+
+	raw->fadeIn();
+}
+
+void PlaybackSponsored::showPremiumPromo() {
+	ShowPremiumPreviewBox(_show, PremiumFeature::NoAds);
+}
+
+void PlaybackSponsored::hide(crl::time now) {
+	Expects(_widget != nullptr);
+
+	_widget->fadeOut([this, raw = _widget.get()] {
+		if (_widget.get() == raw) {
+			_widget = nullptr;
+		}
+	});
+
+	++_data->state.itemIndex;
+	_data->state.leftTillShow = std::max(
+		_data->betweenDelay,
+		kStartDelayMin);
+	_start = now;
+	_timer.callOnce(_data->state.leftTillShow);
+	saveState();
+}
+
+void PlaybackSponsored::saveState() {
+	_session->sponsoredMessages().updateForVideo(
+		_itemId,
+		computeState().data);
+}
+
+PlaybackSponsored::State PlaybackSponsored::computeState() const {
+	auto result = State{ crl::now() };
+	if (!_data) {
+		return result;
+	}
+	result.data = _data->state;
+	if (!_start) {
+		return result;
+	}
+	const auto elapsed = result.now - _start;
+	result.data.leftTillShow -= elapsed;
+	return result;
+}
+
+rpl::lifetime &PlaybackSponsored::lifetime() {
+	return _lifetime;
+}
+
+bool PlaybackSponsored::Has(HistoryItem *item) {
+	return item
+		&& item->history()->session().sponsoredMessages().canHaveFor(item);
+}
+
+} // namespace Media::View

Telegram/SourceFiles/media/view/media_view_playback_sponsored.h

@@ -0,0 +1,83 @@
+/*
+This file is part of Telegram Desktop,
+the official desktop application for the Telegram messaging service.
+
+For license and copyright information please follow this link:
+https://github.com/telegramdesktop/tdesktop/blob/master/LEGAL
+*/
+#pragma once
+
+#include "base/timer.h"
+#include "base/weak_ptr.h"
+#include "data/components/sponsored_messages.h"
+
+namespace ChatHelpers {
+class Show;
+} // namespace ChatHelpers
+
+namespace Main {
+class Session;
+} // namespace Main
+
+namespace Ui {
+class RpWidget;
+} // namespace Ui
+
+namespace Media::View {
+
+class PlaybackSponsored final : public base::has_weak_ptr {
+public:
+	PlaybackSponsored(
+		not_null<Ui::RpWidget*> controls,
+		std::shared_ptr<ChatHelpers::Show> show,
+		not_null<HistoryItem*> item);
+	~PlaybackSponsored();
+
+	void start();
+	void setPaused(bool paused);
+
+	[[nodiscard]] rpl::lifetime &lifetime();
+
+	[[nodiscard]] static bool Has(HistoryItem *item);
+
+private:
+	class Message;
+	struct State {
+		crl::time now = 0;
+		Data::SponsoredForVideoState data;
+	};
+
+	void update();
+	void finish();
+	void updatePaused();
+	void showPremiumPromo();
+	void setPausedInside(bool paused);
+	void setPausedOutside(bool paused);
+	void show(const Data::SponsoredMessage &data);
+	void hide(crl::time now);
+	[[nodiscard]] State computeState() const;
+	void saveState();
+
+	const not_null<QWidget*> _parent;
+	const not_null<Main::Session*> _session;
+	const std::shared_ptr<ChatHelpers::Show> _show;
+	const FullMsgId _itemId;
+
+	rpl::variable<QRect> _controlsGeometry;
+	std::unique_ptr<Message> _widget;
+
+	rpl::variable<crl::time> _allowCloseAt;
+	crl::time _start = 0;
+	bool _started = false;
+	bool _paused = false;
+	bool _pausedInside = false;
+	bool _pausedOutside = false;
+	base::Timer _timer;
+
+	std::optional<Data::SponsoredForVideo> _data;
+
+	rpl::lifetime _lifetime;
+
+};
+
+} // namespace Media::View

Telegram/SourceFiles/menu/menu_sponsored.cpp

@@ -287,14 +287,12 @@ void AboutBox(
 				top->setForceRippled(false);
 			});
 			FillSponsored(
-				top,
 				Ui::Menu::CreateAddActionCallback(menu->get()),
 				show,
 				phrases,
 				details,
 				report,
-				false,
-				true);
+				{ .skipAbout = true });
 			const auto global = top->mapToGlobal(
 				QPoint(top->width() / 4 * 3, top->height() / 2));
 			raw->setForcedOrigin(Ui::PanelAnimation::Origin::TopRight);
@@ -390,18 +388,17 @@ void ShowReportSponsoredBox(
 } // namespace
 
 void FillSponsored(
-		not_null<Ui::RpWidget*> parent,
 		const Ui::Menu::MenuCallback &addAction,
 		std::shared_ptr<ChatHelpers::Show> show,
 		SponsoredPhrases phrases,
 		const Data::SponsoredMessages::Details &details,
 		Data::SponsoredReportAction report,
-		bool mediaViewer,
-		bool skipAbout) {
+		SponsoredMenuSettings settings) {
 	const auto session = &show->session();
 	const auto &info = details.info;
+	const auto dark = settings.dark;
 
-	if (!mediaViewer && !info.empty()) {
+	if (!settings.skipInfo && !info.empty()) {
 		auto fillSubmenu = [&](not_null<Ui::PopupMenu*> menu) {
 			const auto allText = ranges::accumulate(
 				info,
@@ -416,8 +413,10 @@ void FillSponsored(
 			for (const auto &i : info) {
 				auto item = base::make_unique_q<Ui::Menu::MultilineAction>(
 					menu,
-					st::defaultMenu,
-					st::historySponsorInfoItem,
+					dark ? st::storiesMenu : st::defaultMenu,
+					(dark
+						? st::historySponsorInfoItemDark
+						: st::historySponsorInfoItem),
 					st::historyHasCustomEmojiPosition,
 					base::duplicate(i));
 				item->clicks(
@@ -431,27 +430,31 @@ void FillSponsored(
 		addAction({
 			.text = tr::lng_sponsored_info_menu(tr::now),
 			.handler = nullptr,
-			.icon = &st::menuIconChannel,
+			.icon = (dark
+				? &st::mediaMenuIconChannel
+				: &st::menuIconChannel),
 			.fillSubmenu = std::move(fillSubmenu),
 		});
 		addAction({
-			.separatorSt = &st::expandedMenuSeparator,
+			.separatorSt = (dark
+				? &st::mediaviewMenuSeparator
+				: &st::expandedMenuSeparator),
 			.isSeparator = true,
 		});
 	}
 	if (details.canReport) {
-		if (!skipAbout) {
+		if (!settings.skipAbout) {
 			addAction(tr::lng_sponsored_menu_revenued_about(tr::now), [=] {
 				show->show(Box(AboutBox, show, phrases, details, report));
-			}, (mediaViewer ? &st::mediaMenuIconInfo : &st::menuIconInfo));
+			}, (dark ? &st::mediaMenuIconInfo : &st::menuIconInfo));
 		}
 
 		addAction(tr::lng_sponsored_menu_revenued_report(tr::now), [=] {
 			ShowReportSponsoredBox(show, report);
-		}, (mediaViewer ? &st::mediaMenuIconBlock : &st::menuIconBlock));
+		}, (dark ? &st::mediaMenuIconBlock : &st::menuIconBlock));
 
 		addAction({
-			.separatorSt = (mediaViewer
+			.separatorSt = (dark
 				? &st::mediaviewMenuSeparator
 				: &st::expandedMenuSeparator),
 			.isSeparator = true,
@@ -464,26 +467,22 @@ void FillSponsored(
 		} else {
 			ShowPremiumPreviewBox(show, PremiumFeature::NoAds);
 		}
-	}, (mediaViewer ? &st::mediaMenuIconCancel : &st::menuIconCancel));
+	}, (dark ? &st::mediaMenuIconCancel : &st::menuIconCancel));
 }
 
 void FillSponsored(
-		not_null<Ui::RpWidget*> parent,
 		const Ui::Menu::MenuCallback &addAction,
 		std::shared_ptr<ChatHelpers::Show> show,
 		const FullMsgId &fullId,
-		bool mediaViewer,
-		bool skipAbout) {
+		SponsoredMenuSettings settings) {
 	const auto session = &show->session();
 	FillSponsored(
-		parent,
 		addAction,
 		show,
 		PhrasesForMessage(fullId),
 		session->sponsoredMessages().lookupDetails(fullId),
 		session->sponsoredMessages().createReportCallback(fullId),
-		mediaViewer,
-		skipAbout);
+		settings);
 }
 
 void ShowSponsored(
@@ -495,11 +494,9 @@ void ShowSponsored(
 		st::popupMenuWithIcons);
 
 	FillSponsored(
-		parent,
 		Ui::Menu::CreateAddActionCallback(menu),
 		show,
-		fullId,
-		false);
+		fullId);
 
 	menu->popup(QCursor::pos());
 }

Telegram/SourceFiles/menu/menu_sponsored.h

@@ -33,23 +33,25 @@ enum class SponsoredPhrases {
 	Search,
 };
 
+struct SponsoredMenuSettings {
+	bool dark = false;
+	bool skipAbout = false;
+	bool skipInfo = false;
+};
+
 void FillSponsored(
-	not_null<Ui::RpWidget*> parent,
 	const Ui::Menu::MenuCallback &addAction,
 	std::shared_ptr<ChatHelpers::Show> show,
 	SponsoredPhrases phrases,
 	const Data::SponsoredMessageDetails &details,
 	Data::SponsoredReportAction report,
-	bool mediaViewer,
-	bool skipAbout);
+	SponsoredMenuSettings settings = {});
 
 void FillSponsored(
-	not_null<Ui::RpWidget*> parent,
 	const Ui::Menu::MenuCallback &addAction,
 	std::shared_ptr<ChatHelpers::Show> show,
 	const FullMsgId &fullId,
-	bool mediaViewer,
-	bool skipAbout = false);
+	SponsoredMenuSettings settings = {});
 
 void ShowSponsored(
 	not_null<Ui::RpWidget*> parent,